diff options
author | Bryan Berry <bryan@olenepal.org> | 2010-02-17 09:39:34 (GMT) |
---|---|---|
committer | Bryan Berry <bryan@olenepal.org> | 2010-02-17 09:39:34 (GMT) |
commit | 0aa48d0503c69c9ebc1d2bb209bfbec10e8bed64 (patch) | |
tree | 5008d89f95d62696440785a85c08949a7fd27c97 /js |
initial commit. Lesson English_Animal_Identification is current template
Diffstat (limited to 'js')
-rwxr-xr-x | js/jquery-1.3.2.js | 4376 | ||||
-rwxr-xr-x | js/jquery-1.3.2.min.js | 19 | ||||
-rw-r--r-- | js/jquery.i18n.js | 68 | ||||
-rw-r--r-- | js/jquery.ne.json | 13 | ||||
-rwxr-xr-x | js/jquery.svg.js | 1325 | ||||
-rwxr-xr-x | js/jquery.svganim.min.js | 7 | ||||
-rwxr-xr-x | js/jquery.svgdom.js | 355 | ||||
-rwxr-xr-x | js/kDoc.js | 24 | ||||
-rwxr-xr-x | js/karma.js | 1758 | ||||
-rwxr-xr-x | js/lesson.js | 191 | ||||
-rwxr-xr-x | js/ui.core-draggable-resizable-dialog.js | 2756 | ||||
-rwxr-xr-x | js/ui.feedback.js | 131 | ||||
-rwxr-xr-x | js/ui.kFooter.js | 362 | ||||
-rw-r--r-- | js/ui.kFooter.ne.json | 5 | ||||
-rwxr-xr-x | js/ui.kHeader.js | 235 | ||||
-rw-r--r-- | js/ui.kHeader.ne.json | 7 |
16 files changed, 11632 insertions, 0 deletions
diff --git a/js/jquery-1.3.2.js b/js/jquery-1.3.2.js new file mode 100755 index 0000000..462cde5 --- /dev/null +++ b/js/jquery-1.3.2.js @@ -0,0 +1,4376 @@ +/*! + * jQuery JavaScript Library v1.3.2 + * http://jquery.com/ + * + * Copyright (c) 2009 John Resig + * Dual licensed under the MIT and GPL licenses. + * http://docs.jquery.com/License + * + * Date: 2009-02-19 17:34:21 -0500 (Thu, 19 Feb 2009) + * Revision: 6246 + */ +(function(){ + +var + // Will speed up references to window, and allows munging its name. + window = this, + // Will speed up references to undefined, and allows munging its name. + undefined, + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + // Map over the $ in case of overwrite + _$ = window.$, + + jQuery = window.jQuery = window.$ = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context ); + }, + + // A simple way to check for HTML strings or ID strings + // (both of which we optimize for) + quickExpr = /^[^<]*(<(.|\s)+>)[^>]*$|^#([\w-]+)$/, + // Is it a simple selector + isSimple = /^.[^:#\[\.,]*$/; + +jQuery.fn = jQuery.prototype = { + init: function( selector, context ) { + // Make sure that a selection was provided + selector = selector || document; + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this[0] = selector; + this.length = 1; + this.context = selector; + return this; + } + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + var match = quickExpr.exec( selector ); + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) + selector = jQuery.clean( [ match[1] ], context ); + + // HANDLE: $("#id") + else { + var elem = document.getElementById( match[3] ); + + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem && elem.id != match[3] ) + return jQuery().find( selector ); + + // Otherwise, we inject the element directly into the jQuery object + var ret = jQuery( elem || [] ); + ret.context = document; + ret.selector = selector; + return ret; + } + + // HANDLE: $(expr, [context]) + // (which is just equivalent to: $(content).find(expr) + } else + return jQuery( context ).find( selector ); + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) + return jQuery( document ).ready( selector ); + + // Make sure that old selector state is passed along + if ( selector.selector && selector.context ) { + this.selector = selector.selector; + this.context = selector.context; + } + + return this.setArray(jQuery.isArray( selector ) ? + selector : + jQuery.makeArray(selector)); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.3.2", + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num === undefined ? + + // Return a 'clean' array + Array.prototype.slice.call( this ) : + + // Return just the object + this[ num ]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = jQuery( elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) + ret.selector = this.selector + (this.selector ? " " : "") + selector; + else if ( name ) + ret.selector = this.selector + "." + name + "(" + selector + ")"; + + // Return the newly-formed element set + return ret; + }, + + // Force the current matched set of elements to become + // the specified array of elements (destroying the stack in the process) + // You should use pushStack() in order to do this, but maintain the stack + setArray: function( elems ) { + // Resetting the length to 0, then using the native Array push + // is a super-fast way to populate an object with array-like properties + this.length = 0; + Array.prototype.push.apply( this, elems ); + + return this; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem && elem.jquery ? elem[0] : elem + , this ); + }, + + attr: function( name, value, type ) { + var options = name; + + // Look for the case where we're accessing a style value + if ( typeof name === "string" ) + if ( value === undefined ) + return this[0] && jQuery[ type || "attr" ]( this[0], name ); + + else { + options = {}; + options[ name ] = value; + } + + // Check to see if we're setting style values + return this.each(function(i){ + // Set all the styles + for ( name in options ) + jQuery.attr( + type ? + this.style : + this, + name, jQuery.prop( this, options[ name ], type, i, name ) + ); + }); + }, + + css: function( key, value ) { + // ignore negative width and height values + if ( (key == 'width' || key == 'height') && parseFloat(value) < 0 ) + value = undefined; + return this.attr( key, value, "curCSS" ); + }, + + text: function( text ) { + if ( typeof text !== "object" && text != null ) + return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) ); + + var ret = ""; + + jQuery.each( text || this, function(){ + jQuery.each( this.childNodes, function(){ + if ( this.nodeType != 8 ) + ret += this.nodeType != 1 ? + this.nodeValue : + jQuery.fn.text( [ this ] ); + }); + }); + + return ret; + }, + + wrapAll: function( html ) { + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).clone(); + + if ( this[0].parentNode ) + wrap.insertBefore( this[0] ); + + wrap.map(function(){ + var elem = this; + + while ( elem.firstChild ) + elem = elem.firstChild; + + return elem; + }).append(this); + } + + return this; + }, + + wrapInner: function( html ) { + return this.each(function(){ + jQuery( this ).contents().wrapAll( html ); + }); + }, + + wrap: function( html ) { + return this.each(function(){ + jQuery( this ).wrapAll( html ); + }); + }, + + append: function() { + return this.domManip(arguments, true, function(elem){ + if (this.nodeType == 1) + this.appendChild( elem ); + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function(elem){ + if (this.nodeType == 1) + this.insertBefore( elem, this.firstChild ); + }); + }, + + before: function() { + return this.domManip(arguments, false, function(elem){ + this.parentNode.insertBefore( elem, this ); + }); + }, + + after: function() { + return this.domManip(arguments, false, function(elem){ + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + }, + + end: function() { + return this.prevObject || jQuery( [] ); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: [].push, + sort: [].sort, + splice: [].splice, + + find: function( selector ) { + if ( this.length === 1 ) { + var ret = this.pushStack( [], "find", selector ); + ret.length = 0; + jQuery.find( selector, this[0], ret ); + return ret; + } else { + return this.pushStack( jQuery.unique(jQuery.map(this, function(elem){ + return jQuery.find( selector, elem ); + })), "find", selector ); + } + }, + + clone: function( events ) { + // Do the clone + var ret = this.map(function(){ + if ( !jQuery.support.noCloneEvent && !jQuery.isXMLDoc(this) ) { + // IE copies events bound via attachEvent when + // using cloneNode. Calling detachEvent on the + // clone will also remove the events from the orignal + // In order to get around this, we use innerHTML. + // Unfortunately, this means some modifications to + // attributes in IE that are actually only stored + // as properties will not be copied (such as the + // the name attribute on an input). + var html = this.outerHTML; + if ( !html ) { + var div = this.ownerDocument.createElement("div"); + div.appendChild( this.cloneNode(true) ); + html = div.innerHTML; + } + + return jQuery.clean([html.replace(/ jQuery\d+="(?:\d+|null)"/g, "").replace(/^\s*/, "")])[0]; + } else + return this.cloneNode(true); + }); + + // Copy the events from the original to the clone + if ( events === true ) { + var orig = this.find("*").andSelf(), i = 0; + + ret.find("*").andSelf().each(function(){ + if ( this.nodeName !== orig[i].nodeName ) + return; + + var events = jQuery.data( orig[i], "events" ); + + for ( var type in events ) { + for ( var handler in events[ type ] ) { + jQuery.event.add( this, type, events[ type ][ handler ], events[ type ][ handler ].data ); + } + } + + i++; + }); + } + + // Return the cloned set + return ret; + }, + + filter: function( selector ) { + return this.pushStack( + jQuery.isFunction( selector ) && + jQuery.grep(this, function(elem, i){ + return selector.call( elem, i ); + }) || + + jQuery.multiFilter( selector, jQuery.grep(this, function(elem){ + return elem.nodeType === 1; + }) ), "filter", selector ); + }, + + closest: function( selector ) { + var pos = jQuery.expr.match.POS.test( selector ) ? jQuery(selector) : null, + closer = 0; + + return this.map(function(){ + var cur = this; + while ( cur && cur.ownerDocument ) { + if ( pos ? pos.index(cur) > -1 : jQuery(cur).is(selector) ) { + jQuery.data(cur, "closest", closer); + return cur; + } + cur = cur.parentNode; + closer++; + } + }); + }, + + not: function( selector ) { + if ( typeof selector === "string" ) + // test special case where just one selector is passed in + if ( isSimple.test( selector ) ) + return this.pushStack( jQuery.multiFilter( selector, this, true ), "not", selector ); + else + selector = jQuery.multiFilter( selector, this ); + + var isArrayLike = selector.length && selector[selector.length - 1] !== undefined && !selector.nodeType; + return this.filter(function() { + return isArrayLike ? jQuery.inArray( this, selector ) < 0 : this != selector; + }); + }, + + add: function( selector ) { + return this.pushStack( jQuery.unique( jQuery.merge( + this.get(), + typeof selector === "string" ? + jQuery( selector ) : + jQuery.makeArray( selector ) + ))); + }, + + is: function( selector ) { + return !!selector && jQuery.multiFilter( selector, this ).length > 0; + }, + + hasClass: function( selector ) { + return !!selector && this.is( "." + selector ); + }, + + val: function( value ) { + if ( value === undefined ) { + var elem = this[0]; + + if ( elem ) { + if( jQuery.nodeName( elem, 'option' ) ) + return (elem.attributes.value || {}).specified ? elem.value : elem.text; + + // We need to handle select boxes special + if ( jQuery.nodeName( elem, "select" ) ) { + var index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type == "select-one"; + + // Nothing was selected + if ( index < 0 ) + return null; + + // Loop through all the selected options + for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) { + var option = options[ i ]; + + if ( option.selected ) { + // Get the specifc value for the option + value = jQuery(option).val(); + + // We don't need an array for one selects + if ( one ) + return value; + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + } + + // Everything else, we just grab the value + return (elem.value || "").replace(/\r/g, ""); + + } + + return undefined; + } + + if ( typeof value === "number" ) + value += ''; + + return this.each(function(){ + if ( this.nodeType != 1 ) + return; + + if ( jQuery.isArray(value) && /radio|checkbox/.test( this.type ) ) + this.checked = (jQuery.inArray(this.value, value) >= 0 || + jQuery.inArray(this.name, value) >= 0); + + else if ( jQuery.nodeName( this, "select" ) ) { + var values = jQuery.makeArray(value); + + jQuery( "option", this ).each(function(){ + this.selected = (jQuery.inArray( this.value, values ) >= 0 || + jQuery.inArray( this.text, values ) >= 0); + }); + + if ( !values.length ) + this.selectedIndex = -1; + + } else + this.value = value; + }); + }, + + html: function( value ) { + return value === undefined ? + (this[0] ? + this[0].innerHTML.replace(/ jQuery\d+="(?:\d+|null)"/g, "") : + null) : + this.empty().append( value ); + }, + + replaceWith: function( value ) { + return this.after( value ).remove(); + }, + + eq: function( i ) { + return this.slice( i, +i + 1 ); + }, + + slice: function() { + return this.pushStack( Array.prototype.slice.apply( this, arguments ), + "slice", Array.prototype.slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function(elem, i){ + return callback.call( elem, i, elem ); + })); + }, + + andSelf: function() { + return this.add( this.prevObject ); + }, + + domManip: function( args, table, callback ) { + if ( this[0] ) { + var fragment = (this[0].ownerDocument || this[0]).createDocumentFragment(), + scripts = jQuery.clean( args, (this[0].ownerDocument || this[0]), fragment ), + first = fragment.firstChild; + + if ( first ) + for ( var i = 0, l = this.length; i < l; i++ ) + callback.call( root(this[i], first), this.length > 1 || i > 0 ? + fragment.cloneNode(true) : fragment ); + + if ( scripts ) + jQuery.each( scripts, evalScript ); + } + + return this; + + function root( elem, cur ) { + return table && jQuery.nodeName(elem, "table") && jQuery.nodeName(cur, "tr") ? + (elem.getElementsByTagName("tbody")[0] || + elem.appendChild(elem.ownerDocument.createElement("tbody"))) : + elem; + } + } +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +function evalScript( i, elem ) { + if ( elem.src ) + jQuery.ajax({ + url: elem.src, + async: false, + dataType: "script" + }); + + else + jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" ); + + if ( elem.parentNode ) + elem.parentNode.removeChild( elem ); +} + +function now(){ + return +new Date; +} + +jQuery.extend = jQuery.fn.extend = function() { + // copy reference to target object + var target = arguments[0] || {}, i = 1, length = arguments.length, deep = false, options; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) + target = {}; + + // extend jQuery itself if only one argument is passed + if ( length == i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) + // Extend the base object + for ( var name in options ) { + var src = target[ name ], copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) + continue; + + // Recurse if we're merging object values + if ( deep && copy && typeof copy === "object" && !copy.nodeType ) + target[ name ] = jQuery.extend( deep, + // Never move original objects, clone them + src || ( copy.length != null ? [ ] : { } ) + , copy ); + + // Don't bring in undefined values + else if ( copy !== undefined ) + target[ name ] = copy; + + } + + // Return the modified object + return target; +}; + +// exclude the following css properties to add px +var exclude = /z-?index|font-?weight|opacity|zoom|line-?height/i, + // cache defaultView + defaultView = document.defaultView || {}, + toString = Object.prototype.toString; + +jQuery.extend({ + noConflict: function( deep ) { + window.$ = _$; + + if ( deep ) + window.jQuery = _jQuery; + + return jQuery; + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return toString.call(obj) === "[object Function]"; + }, + + isArray: function( obj ) { + return toString.call(obj) === "[object Array]"; + }, + + // check if an element is in a (or is an) XML document + isXMLDoc: function( elem ) { + return elem.nodeType === 9 && elem.documentElement.nodeName !== "HTML" || + !!elem.ownerDocument && jQuery.isXMLDoc( elem.ownerDocument ); + }, + + // Evalulates a script in a global context + globalEval: function( data ) { + if ( data && /\S/.test(data) ) { + // Inspired by code by Andrea Giammarchi + // http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html + var head = document.getElementsByTagName("head")[0] || document.documentElement, + script = document.createElement("script"); + + script.type = "text/javascript"; + if ( jQuery.support.scriptEval ) + script.appendChild( document.createTextNode( data ) ); + else + script.text = data; + + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709). + head.insertBefore( script, head.firstChild ); + head.removeChild( script ); + } + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() == name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, length = object.length; + + if ( args ) { + if ( length === undefined ) { + for ( name in object ) + if ( callback.apply( object[ name ], args ) === false ) + break; + } else + for ( ; i < length; ) + if ( callback.apply( object[ i++ ], args ) === false ) + break; + + // A special, fast, case for the most common use of each + } else { + if ( length === undefined ) { + for ( name in object ) + if ( callback.call( object[ name ], name, object[ name ] ) === false ) + break; + } else + for ( var value = object[0]; + i < length && callback.call( value, i, value ) !== false; value = object[++i] ){} + } + + return object; + }, + + prop: function( elem, value, type, i, name ) { + // Handle executable functions + if ( jQuery.isFunction( value ) ) + value = value.call( elem, i ); + + // Handle passing in a number to a CSS property + return typeof value === "number" && type == "curCSS" && !exclude.test( name ) ? + value + "px" : + value; + }, + + className: { + // internal only, use addClass("class") + add: function( elem, classNames ) { + jQuery.each((classNames || "").split(/\s+/), function(i, className){ + if ( elem.nodeType == 1 && !jQuery.className.has( elem.className, className ) ) + elem.className += (elem.className ? " " : "") + className; + }); + }, + + // internal only, use removeClass("class") + remove: function( elem, classNames ) { + if (elem.nodeType == 1) + elem.className = classNames !== undefined ? + jQuery.grep(elem.className.split(/\s+/), function(className){ + return !jQuery.className.has( classNames, className ); + }).join(" ") : + ""; + }, + + // internal only, use hasClass("class") + has: function( elem, className ) { + return elem && jQuery.inArray( className, (elem.className || elem).toString().split(/\s+/) ) > -1; + } + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var old = {}; + // Remember the old values, and insert the new ones + for ( var name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + callback.call( elem ); + + // Revert the old values + for ( var name in options ) + elem.style[ name ] = old[ name ]; + }, + + css: function( elem, name, force, extra ) { + if ( name == "width" || name == "height" ) { + var val, props = { position: "absolute", visibility: "hidden", display:"block" }, which = name == "width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ]; + + function getWH() { + val = name == "width" ? elem.offsetWidth : elem.offsetHeight; + + if ( extra === "border" ) + return; + + jQuery.each( which, function() { + if ( !extra ) + val -= parseFloat(jQuery.curCSS( elem, "padding" + this, true)) || 0; + if ( extra === "margin" ) + val += parseFloat(jQuery.curCSS( elem, "margin" + this, true)) || 0; + else + val -= parseFloat(jQuery.curCSS( elem, "border" + this + "Width", true)) || 0; + }); + } + + if ( elem.offsetWidth !== 0 ) + getWH(); + else + jQuery.swap( elem, props, getWH ); + + return Math.max(0, Math.round(val)); + } + + return jQuery.curCSS( elem, name, force ); + }, + + curCSS: function( elem, name, force ) { + var ret, style = elem.style; + + // We need to handle opacity special in IE + if ( name == "opacity" && !jQuery.support.opacity ) { + ret = jQuery.attr( style, "opacity" ); + + return ret == "" ? + "1" : + ret; + } + + // Make sure we're using the right name for getting the float value + if ( name.match( /float/i ) ) + name = styleFloat; + + if ( !force && style && style[ name ] ) + ret = style[ name ]; + + else if ( defaultView.getComputedStyle ) { + + // Only "float" is needed here + if ( name.match( /float/i ) ) + name = "float"; + + name = name.replace( /([A-Z])/g, "-$1" ).toLowerCase(); + + var computedStyle = defaultView.getComputedStyle( elem, null ); + + if ( computedStyle ) + ret = computedStyle.getPropertyValue( name ); + + // We should always get a number back from opacity + if ( name == "opacity" && ret == "" ) + ret = "1"; + + } else if ( elem.currentStyle ) { + var camelCase = name.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + + ret = elem.currentStyle[ name ] || elem.currentStyle[ camelCase ]; + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + if ( !/^\d+(px)?$/i.test( ret ) && /^\d/.test( ret ) ) { + // Remember the original values + var left = style.left, rsLeft = elem.runtimeStyle.left; + + // Put in the new values to get a computed value out + elem.runtimeStyle.left = elem.currentStyle.left; + style.left = ret || 0; + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + elem.runtimeStyle.left = rsLeft; + } + } + + return ret; + }, + + clean: function( elems, context, fragment ) { + context = context || document; + + // !context.createElement fails in IE with an error but returns typeof 'object' + if ( typeof context.createElement === "undefined" ) + context = context.ownerDocument || context[0] && context[0].ownerDocument || document; + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + if ( !fragment && elems.length === 1 && typeof elems[0] === "string" ) { + var match = /^<(\w+)\s*\/?>$/.exec(elems[0]); + if ( match ) + return [ context.createElement( match[1] ) ]; + } + + var ret = [], scripts = [], div = context.createElement("div"); + + jQuery.each(elems, function(i, elem){ + if ( typeof elem === "number" ) + elem += ''; + + if ( !elem ) + return; + + // Convert html string into DOM nodes + if ( typeof elem === "string" ) { + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(/(<(\w+)[^>]*?)\/>/g, function(all, front, tag){ + return tag.match(/^(abbr|br|col|img|input|link|meta|param|hr|area|embed)$/i) ? + all : + front + "></" + tag + ">"; + }); + + // Trim whitespace, otherwise indexOf won't work as expected + var tags = elem.replace(/^\s+/, "").substring(0, 10).toLowerCase(); + + var wrap = + // option or optgroup + !tags.indexOf("<opt") && + [ 1, "<select multiple='multiple'>", "</select>" ] || + + !tags.indexOf("<leg") && + [ 1, "<fieldset>", "</fieldset>" ] || + + tags.match(/^<(thead|tbody|tfoot|colg|cap)/) && + [ 1, "<table>", "</table>" ] || + + !tags.indexOf("<tr") && + [ 2, "<table><tbody>", "</tbody></table>" ] || + + // <thead> matched above + (!tags.indexOf("<td") || !tags.indexOf("<th")) && + [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ] || + + !tags.indexOf("<col") && + [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ] || + + // IE can't serialize <link> and <script> tags normally + !jQuery.support.htmlSerialize && + [ 1, "div<div>", "</div>" ] || + + [ 0, "", "" ]; + + // Go to html and back, then peel off extra wrappers + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( wrap[0]-- ) + div = div.lastChild; + + // Remove IE's autoinserted <tbody> from table fragments + if ( !jQuery.support.tbody ) { + + // String was a <table>, *may* have spurious <tbody> + var hasBody = /<tbody/i.test(elem), + tbody = !tags.indexOf("<table") && !hasBody ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare <thead> or <tfoot> + wrap[1] == "<table>" && !hasBody ? + div.childNodes : + []; + + for ( var j = tbody.length - 1; j >= 0 ; --j ) + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && /^\s/.test( elem ) ) + div.insertBefore( context.createTextNode( elem.match(/^\s*/)[0] ), div.firstChild ); + + elem = jQuery.makeArray( div.childNodes ); + } + + if ( elem.nodeType ) + ret.push( elem ); + else + ret = jQuery.merge( ret, elem ); + + }); + + if ( fragment ) { + for ( var i = 0; ret[i]; i++ ) { + if ( jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) { + scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] ); + } else { + if ( ret[i].nodeType === 1 ) + ret.splice.apply( ret, [i + 1, 0].concat(jQuery.makeArray(ret[i].getElementsByTagName("script"))) ); + fragment.appendChild( ret[i] ); + } + } + + return scripts; + } + + return ret; + }, + + attr: function( elem, name, value ) { + // don't set attributes on text and comment nodes + if (!elem || elem.nodeType == 3 || elem.nodeType == 8) + return undefined; + + var notxml = !jQuery.isXMLDoc( elem ), + // Whether we are setting (or getting) + set = value !== undefined; + + // Try to normalize/fix the name + name = notxml && jQuery.props[ name ] || name; + + // Only do all the following if this is a node (faster for style) + // IE elem.getAttribute passes even for style + if ( elem.tagName ) { + + // These attributes require special treatment + var special = /href|src|style/.test( name ); + + // Safari mis-reports the default selected property of a hidden option + // Accessing the parent's selectedIndex property fixes it + if ( name == "selected" && elem.parentNode ) + elem.parentNode.selectedIndex; + + // If applicable, access the attribute via the DOM 0 way + if ( name in elem && notxml && !special ) { + if ( set ){ + // We can't allow the type property to be changed (since it causes problems in IE) + if ( name == "type" && jQuery.nodeName( elem, "input" ) && elem.parentNode ) + throw "type property can't be changed"; + + elem[ name ] = value; + } + + // browsers index elements by id/name on forms, give priority to attributes. + if( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) ) + return elem.getAttributeNode( name ).nodeValue; + + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + if ( name == "tabIndex" ) { + var attributeNode = elem.getAttributeNode( "tabIndex" ); + return attributeNode && attributeNode.specified + ? attributeNode.value + : elem.nodeName.match(/(button|input|object|select|textarea)/i) + ? 0 + : elem.nodeName.match(/^(a|area)$/i) && elem.href + ? 0 + : undefined; + } + + return elem[ name ]; + } + + if ( !jQuery.support.style && notxml && name == "style" ) + return jQuery.attr( elem.style, "cssText", value ); + + if ( set ) + // convert the value to a string (all browsers do this but IE) see #1070 + elem.setAttribute( name, "" + value ); + + var attr = !jQuery.support.hrefNormalized && notxml && special + // Some attributes require a special call on IE + ? elem.getAttribute( name, 2 ) + : elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return attr === null ? undefined : attr; + } + + // elem is actually elem.style ... set the style + + // IE uses filters for opacity + if ( !jQuery.support.opacity && name == "opacity" ) { + if ( set ) { + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + elem.zoom = 1; + + // Set the alpha filter to set the opacity + elem.filter = (elem.filter || "").replace( /alpha\([^)]*\)/, "" ) + + (parseInt( value ) + '' == "NaN" ? "" : "alpha(opacity=" + value * 100 + ")"); + } + + return elem.filter && elem.filter.indexOf("opacity=") >= 0 ? + (parseFloat( elem.filter.match(/opacity=([^)]*)/)[1] ) / 100) + '': + ""; + } + + name = name.replace(/-([a-z])/ig, function(all, letter){ + return letter.toUpperCase(); + }); + + if ( set ) + elem[ name ] = value; + + return elem[ name ]; + }, + + trim: function( text ) { + return (text || "").replace( /^\s+|\s+$/g, "" ); + }, + + makeArray: function( array ) { + var ret = []; + + if( array != null ){ + var i = array.length; + // The window, strings (and functions) also have 'length' + if( i == null || typeof array === "string" || jQuery.isFunction(array) || array.setInterval ) + ret[0] = array; + else + while( i ) + ret[--i] = array[i]; + } + + return ret; + }, + + inArray: function( elem, array ) { + for ( var i = 0, length = array.length; i < length; i++ ) + // Use === because on IE, window == document + if ( array[ i ] === elem ) + return i; + + return -1; + }, + + merge: function( first, second ) { + // We have to loop this way because IE & Opera overwrite the length + // expando of getElementsByTagName + var i = 0, elem, pos = first.length; + // Also, we need to make sure that the correct elements are being returned + // (IE returns comment nodes in a '*' query) + if ( !jQuery.support.getAll ) { + while ( (elem = second[ i++ ]) != null ) + if ( elem.nodeType != 8 ) + first[ pos++ ] = elem; + + } else + while ( (elem = second[ i++ ]) != null ) + first[ pos++ ] = elem; + + return first; + }, + + unique: function( array ) { + var ret = [], done = {}; + + try { + + for ( var i = 0, length = array.length; i < length; i++ ) { + var id = jQuery.data( array[ i ] ); + + if ( !done[ id ] ) { + done[ id ] = true; + ret.push( array[ i ] ); + } + } + + } catch( e ) { + ret = array; + } + + return ret; + }, + + grep: function( elems, callback, inv ) { + var ret = []; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) + if ( !inv != !callback( elems[ i ], i ) ) + ret.push( elems[ i ] ); + + return ret; + }, + + map: function( elems, callback ) { + var ret = []; + + // Go through the array, translating each of the items to their + // new value (or values). + for ( var i = 0, length = elems.length; i < length; i++ ) { + var value = callback( elems[ i ], i ); + + if ( value != null ) + ret[ ret.length ] = value; + } + + return ret.concat.apply( [], ret ); + } +}); + +// Use of jQuery.browser is deprecated. +// It's included for backwards compatibility and plugins, +// although they should work to migrate away. + +var userAgent = navigator.userAgent.toLowerCase(); + +// Figure out what browser is being used +jQuery.browser = { + version: (userAgent.match( /.+(?:rv|it|ra|ie)[\/: ]([\d.]+)/ ) || [0,'0'])[1], + safari: /webkit/.test( userAgent ), + opera: /opera/.test( userAgent ), + msie: /msie/.test( userAgent ) && !/opera/.test( userAgent ), + mozilla: /mozilla/.test( userAgent ) && !/(compatible|webkit)/.test( userAgent ) +}; + +jQuery.each({ + parent: function(elem){return elem.parentNode;}, + parents: function(elem){return jQuery.dir(elem,"parentNode");}, + next: function(elem){return jQuery.nth(elem,2,"nextSibling");}, + prev: function(elem){return jQuery.nth(elem,2,"previousSibling");}, + nextAll: function(elem){return jQuery.dir(elem,"nextSibling");}, + prevAll: function(elem){return jQuery.dir(elem,"previousSibling");}, + siblings: function(elem){return jQuery.sibling(elem.parentNode.firstChild,elem);}, + children: function(elem){return jQuery.sibling(elem.firstChild);}, + contents: function(elem){return jQuery.nodeName(elem,"iframe")?elem.contentDocument||elem.contentWindow.document:jQuery.makeArray(elem.childNodes);} +}, function(name, fn){ + jQuery.fn[ name ] = function( selector ) { + var ret = jQuery.map( this, fn ); + + if ( selector && typeof selector == "string" ) + ret = jQuery.multiFilter( selector, ret ); + + return this.pushStack( jQuery.unique( ret ), name, selector ); + }; +}); + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function(name, original){ + jQuery.fn[ name ] = function( selector ) { + var ret = [], insert = jQuery( selector ); + + for ( var i = 0, l = insert.length; i < l; i++ ) { + var elems = (i > 0 ? this.clone(true) : this).get(); + jQuery.fn[ original ].apply( jQuery(insert[i]), elems ); + ret = ret.concat( elems ); + } + + return this.pushStack( ret, name, selector ); + }; +}); + +jQuery.each({ + removeAttr: function( name ) { + jQuery.attr( this, name, "" ); + if (this.nodeType == 1) + this.removeAttribute( name ); + }, + + addClass: function( classNames ) { + jQuery.className.add( this, classNames ); + }, + + removeClass: function( classNames ) { + jQuery.className.remove( this, classNames ); + }, + + toggleClass: function( classNames, state ) { + if( typeof state !== "boolean" ) + state = !jQuery.className.has( this, classNames ); + jQuery.className[ state ? "add" : "remove" ]( this, classNames ); + }, + + remove: function( selector ) { + if ( !selector || jQuery.filter( selector, [ this ] ).length ) { + // Prevent memory leaks + jQuery( "*", this ).add([this]).each(function(){ + jQuery.event.remove(this); + jQuery.removeData(this); + }); + if (this.parentNode) + this.parentNode.removeChild( this ); + } + }, + + empty: function() { + // Remove element nodes and prevent memory leaks + jQuery(this).children().remove(); + + // Remove any remaining nodes + while ( this.firstChild ) + this.removeChild( this.firstChild ); + } +}, function(name, fn){ + jQuery.fn[ name ] = function(){ + return this.each( fn, arguments ); + }; +}); + +// Helper function used by the dimensions and offset modules +function num(elem, prop) { + return elem[0] && parseInt( jQuery.curCSS(elem[0], prop, true), 10 ) || 0; +} +var expando = "jQuery" + now(), uuid = 0, windowData = {}; + +jQuery.extend({ + cache: {}, + + data: function( elem, name, data ) { + elem = elem == window ? + windowData : + elem; + + var id = elem[ expando ]; + + // Compute a unique ID for the element + if ( !id ) + id = elem[ expando ] = ++uuid; + + // Only generate the data cache if we're + // trying to access or manipulate it + if ( name && !jQuery.cache[ id ] ) + jQuery.cache[ id ] = {}; + + // Prevent overriding the named cache with undefined values + if ( data !== undefined ) + jQuery.cache[ id ][ name ] = data; + + // Return the named cache data, or the ID for the element + return name ? + jQuery.cache[ id ][ name ] : + id; + }, + + removeData: function( elem, name ) { + elem = elem == window ? + windowData : + elem; + + var id = elem[ expando ]; + + // If we want to remove a specific section of the element's data + if ( name ) { + if ( jQuery.cache[ id ] ) { + // Remove the section of cache data + delete jQuery.cache[ id ][ name ]; + + // If we've removed all the data, remove the element's cache + name = ""; + + for ( name in jQuery.cache[ id ] ) + break; + + if ( !name ) + jQuery.removeData( elem ); + } + + // Otherwise, we want to remove all of the element's data + } else { + // Clean up the element expando + try { + delete elem[ expando ]; + } catch(e){ + // IE has trouble directly removing the expando + // but it's ok with using removeAttribute + if ( elem.removeAttribute ) + elem.removeAttribute( expando ); + } + + // Completely remove the data cache + delete jQuery.cache[ id ]; + } + }, + queue: function( elem, type, data ) { + if ( elem ){ + + type = (type || "fx") + "queue"; + + var q = jQuery.data( elem, type ); + + if ( !q || jQuery.isArray(data) ) + q = jQuery.data( elem, type, jQuery.makeArray(data) ); + else if( data ) + q.push( data ); + + } + return q; + }, + + dequeue: function( elem, type ){ + var queue = jQuery.queue( elem, type ), + fn = queue.shift(); + + if( !type || type === "fx" ) + fn = queue[0]; + + if( fn !== undefined ) + fn.call(elem); + } +}); + +jQuery.fn.extend({ + data: function( key, value ){ + var parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + var data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + if ( data === undefined && this.length ) + data = jQuery.data( this[0], key ); + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + } else + return this.trigger("setData" + parts[1] + "!", [parts[0], value]).each(function(){ + jQuery.data( this, key, value ); + }); + }, + + removeData: function( key ){ + return this.each(function(){ + jQuery.removeData( this, key ); + }); + }, + queue: function(type, data){ + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) + return jQuery.queue( this[0], type ); + + return this.each(function(){ + var queue = jQuery.queue( this, type, data ); + + if( type == "fx" && queue.length == 1 ) + queue[0].call(this); + }); + }, + dequeue: function(type){ + return this.each(function(){ + jQuery.dequeue( this, type ); + }); + } +});/*! + * Sizzle CSS Selector Engine - v0.9.3 + * Copyright 2009, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?/g, + done = 0, + toString = Object.prototype.toString; + +var Sizzle = function(selector, context, results, seed) { + results = results || []; + context = context || document; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) + return []; + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var parts = [], m, set, checkSet, check, mode, extra, prune = true; + + // Reset the position of the chunker regexp (start from head) + chunker.lastIndex = 0; + + while ( (m = chunker.exec(selector)) !== null ) { + parts.push( m[1] ); + + if ( m[2] ) { + extra = RegExp.rightContext; + break; + } + } + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context ); + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) + selector += parts.shift(); + + set = posProcess( selector, set ); + } + } + } else { + var ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && context.parentNode ? context.parentNode : context, isXML(context) ); + set = Sizzle.filter( ret.expr, ret.set ); + + if ( parts.length > 0 ) { + checkSet = makeArray(set); + } else { + prune = false; + } + + while ( parts.length ) { + var cur = parts.pop(), pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, isXML(context) ); + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + throw "Syntax error, unrecognized expression: " + (cur || selector); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + } else if ( context.nodeType === 1 ) { + for ( var i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + } else { + for ( var i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, context, results, seed ); + + if ( sortOrder ) { + hasDuplicate = false; + results.sort(sortOrder); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[i-1] ) { + results.splice(i--, 1); + } + } + } + } + } + + return results; +}; + +Sizzle.matches = function(expr, set){ + return Sizzle(expr, null, null, set); +}; + +Sizzle.find = function(expr, context, isXML){ + var set, match; + + if ( !expr ) { + return []; + } + + for ( var i = 0, l = Expr.order.length; i < l; i++ ) { + var type = Expr.order[i], match; + + if ( (match = Expr.match[ type ].exec( expr )) ) { + var left = RegExp.leftContext; + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace(/\\/g, ""); + set = Expr.find[ type ]( match, context, isXML ); + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = context.getElementsByTagName("*"); + } + + return {set: set, expr: expr}; +}; + +Sizzle.filter = function(expr, set, inplace, not){ + var old = expr, result = [], curLoop = set, match, anyFound, + isXMLFilter = set && set[0] && isXML(set[0]); + + while ( expr && set.length ) { + for ( var type in Expr.filter ) { + if ( (match = Expr.match[ type ].exec( expr )) != null ) { + var filter = Expr.filter[ type ], found, item; + anyFound = false; + + if ( curLoop == result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( var i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + var pass = not ^ !!found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + } else { + curLoop[i] = false; + } + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + // Improper expression + if ( expr == old ) { + if ( anyFound == null ) { + throw "Syntax error, unrecognized expression: " + expr; + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + match: { + ID: /#((?:[\w\u00c0-\uFFFF_-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF_-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF_-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF_-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*_-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF_-]|\\.)+)(?:\((['"]*)((?:\([^\)]+\)|[^\2\(\)]*)+)\2\))?/ + }, + attrMap: { + "class": "className", + "for": "htmlFor" + }, + attrHandle: { + href: function(elem){ + return elem.getAttribute("href"); + } + }, + relative: { + "+": function(checkSet, part, isXML){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !/\W/.test(part), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag && !isXML ) { + part = part.toUpperCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + ">": function(checkSet, part, isXML){ + var isPartStr = typeof part === "string"; + + if ( isPartStr && !/\W/.test(part) ) { + part = isXML ? part : part.toUpperCase(); + + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName === part ? parent : false; + } + } + } else { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + "": function(checkSet, part, isXML){ + var doneName = done++, checkFn = dirCheck; + + if ( !part.match(/\W/) ) { + var nodeCheck = part = isXML ? part : part.toUpperCase(); + checkFn = dirNodeCheck; + } + + checkFn("parentNode", part, doneName, checkSet, nodeCheck, isXML); + }, + "~": function(checkSet, part, isXML){ + var doneName = done++, checkFn = dirCheck; + + if ( typeof part === "string" && !part.match(/\W/) ) { + var nodeCheck = part = isXML ? part : part.toUpperCase(); + checkFn = dirNodeCheck; + } + + checkFn("previousSibling", part, doneName, checkSet, nodeCheck, isXML); + } + }, + find: { + ID: function(match, context, isXML){ + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + return m ? [m] : []; + } + }, + NAME: function(match, context, isXML){ + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], results = context.getElementsByName(match[1]); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + TAG: function(match, context){ + return context.getElementsByTagName(match[1]); + } + }, + preFilter: { + CLASS: function(match, curLoop, inplace, result, not, isXML){ + match = " " + match[1].replace(/\\/g, "") + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").indexOf(match) >= 0) ) { + if ( !inplace ) + result.push( elem ); + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + ID: function(match){ + return match[1].replace(/\\/g, ""); + }, + TAG: function(match, curLoop){ + for ( var i = 0; curLoop[i] === false; i++ ){} + return curLoop[i] && isXML(curLoop[i]) ? match[1] : match[1].toUpperCase(); + }, + CHILD: function(match){ + if ( match[1] == "nth" ) { + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)n((?:\+|-)?\d*)/.exec( + match[2] == "even" && "2n" || match[2] == "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + + // TODO: Move to normal caching system + match[0] = done++; + + return match; + }, + ATTR: function(match, curLoop, inplace, result, not, isXML){ + var name = match[1].replace(/\\/g, ""); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + PSEUDO: function(match, curLoop, inplace, result, not){ + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( match[3].match(chunker).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + if ( !inplace ) { + result.push.apply( result, ret ); + } + return false; + } + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + POS: function(match){ + match.unshift( true ); + return match; + } + }, + filters: { + enabled: function(elem){ + return elem.disabled === false && elem.type !== "hidden"; + }, + disabled: function(elem){ + return elem.disabled === true; + }, + checked: function(elem){ + return elem.checked === true; + }, + selected: function(elem){ + // Accessing this property makes selected-by-default + // options in Safari work properly + elem.parentNode.selectedIndex; + return elem.selected === true; + }, + parent: function(elem){ + return !!elem.firstChild; + }, + empty: function(elem){ + return !elem.firstChild; + }, + has: function(elem, i, match){ + return !!Sizzle( match[3], elem ).length; + }, + header: function(elem){ + return /h\d/i.test( elem.nodeName ); + }, + text: function(elem){ + return "text" === elem.type; + }, + radio: function(elem){ + return "radio" === elem.type; + }, + checkbox: function(elem){ + return "checkbox" === elem.type; + }, + file: function(elem){ + return "file" === elem.type; + }, + password: function(elem){ + return "password" === elem.type; + }, + submit: function(elem){ + return "submit" === elem.type; + }, + image: function(elem){ + return "image" === elem.type; + }, + reset: function(elem){ + return "reset" === elem.type; + }, + button: function(elem){ + return "button" === elem.type || elem.nodeName.toUpperCase() === "BUTTON"; + }, + input: function(elem){ + return /input|select|textarea|button/i.test(elem.nodeName); + } + }, + setFilters: { + first: function(elem, i){ + return i === 0; + }, + last: function(elem, i, match, array){ + return i === array.length - 1; + }, + even: function(elem, i){ + return i % 2 === 0; + }, + odd: function(elem, i){ + return i % 2 === 1; + }, + lt: function(elem, i, match){ + return i < match[3] - 0; + }, + gt: function(elem, i, match){ + return i > match[3] - 0; + }, + nth: function(elem, i, match){ + return match[3] - 0 == i; + }, + eq: function(elem, i, match){ + return match[3] - 0 == i; + } + }, + filter: { + PSEUDO: function(elem, match, i, array){ + var name = match[1], filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || "").indexOf(match[3]) >= 0; + } else if ( name === "not" ) { + var not = match[3]; + + for ( var i = 0, l = not.length; i < l; i++ ) { + if ( not[i] === elem ) { + return false; + } + } + + return true; + } + }, + CHILD: function(elem, match){ + var type = match[1], node = elem; + switch (type) { + case 'only': + case 'first': + while (node = node.previousSibling) { + if ( node.nodeType === 1 ) return false; + } + if ( type == 'first') return true; + node = elem; + case 'last': + while (node = node.nextSibling) { + if ( node.nodeType === 1 ) return false; + } + return true; + case 'nth': + var first = match[2], last = match[3]; + + if ( first == 1 && last == 0 ) { + return true; + } + + var doneName = match[0], + parent = elem.parentNode; + + if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) { + var count = 0; + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + parent.sizcache = doneName; + } + + var diff = elem.nodeIndex - last; + if ( first == 0 ) { + return diff == 0; + } else { + return ( diff % first == 0 && diff / first >= 0 ); + } + } + }, + ID: function(elem, match){ + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + TAG: function(elem, match){ + return (match === "*" && elem.nodeType === 1) || elem.nodeName === match; + }, + CLASS: function(elem, match){ + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + ATTR: function(elem, match){ + var name = match[1], + result = Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value != check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + POS: function(elem, match, i, array){ + var name = match[2], filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS; + +for ( var type in Expr.match ) { + Expr.match[ type ] = RegExp( Expr.match[ type ].source + /(?![^\[]*\])(?![^\(]*\))/.source ); +} + +var makeArray = function(array, results) { + array = Array.prototype.slice.call( array ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +try { + Array.prototype.slice.call( document.documentElement.childNodes ); + +// Provide a fallback method if it does not work +} catch(e){ + makeArray = function(array, results) { + var ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + } else { + if ( typeof array.length === "number" ) { + for ( var i = 0, l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + } else { + for ( var i = 0; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +var sortOrder; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + var ret = a.compareDocumentPosition(b) & 4 ? -1 : a === b ? 0 : 1; + if ( ret === 0 ) { + hasDuplicate = true; + } + return ret; + }; +} else if ( "sourceIndex" in document.documentElement ) { + sortOrder = function( a, b ) { + var ret = a.sourceIndex - b.sourceIndex; + if ( ret === 0 ) { + hasDuplicate = true; + } + return ret; + }; +} else if ( document.createRange ) { + sortOrder = function( a, b ) { + var aRange = a.ownerDocument.createRange(), bRange = b.ownerDocument.createRange(); + aRange.selectNode(a); + aRange.collapse(true); + bRange.selectNode(b); + bRange.collapse(true); + var ret = aRange.compareBoundaryPoints(Range.START_TO_END, bRange); + if ( ret === 0 ) { + hasDuplicate = true; + } + return ret; + }; +} + +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + var form = document.createElement("form"), + id = "script" + (new Date).getTime(); + form.innerHTML = "<input name='" + id + "'/>"; + + // Inject it into the root element, check its status, and remove it quickly + var root = document.documentElement; + root.insertBefore( form, root.firstChild ); + + // The workaround has to do additional checks after a getElementById + // Which slows things down for other browsers (hence the branching) + if ( !!document.getElementById( id ) ) { + Expr.find.ID = function(match, context, isXML){ + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + return m ? m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? [m] : undefined : []; + } + }; + + Expr.filter.ID = function(elem, match){ + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); +})(); + +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + // Make sure no comments are found + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function(match, context){ + var results = context.getElementsByTagName(match[1]); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + // Check to see if an attribute returns normalized href attributes + div.innerHTML = "<a href='#'></a>"; + if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + div.firstChild.getAttribute("href") !== "#" ) { + Expr.attrHandle.href = function(elem){ + return elem.getAttribute("href", 2); + }; + } +})(); + +if ( document.querySelectorAll ) (function(){ + var oldSizzle = Sizzle, div = document.createElement("div"); + div.innerHTML = "<p class='TEST'></p>"; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function(query, context, extra, seed){ + context = context || document; + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && context.nodeType === 9 && !isXML(context) ) { + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(e){} + } + + return oldSizzle(query, context, extra, seed); + }; + + Sizzle.find = oldSizzle.find; + Sizzle.filter = oldSizzle.filter; + Sizzle.selectors = oldSizzle.selectors; + Sizzle.matches = oldSizzle.matches; +})(); + +if ( document.getElementsByClassName && document.documentElement.getElementsByClassName ) (function(){ + var div = document.createElement("div"); + div.innerHTML = "<div class='test e'></div><div class='test'></div>"; + + // Opera can't find a second classname (in 9.6) + if ( div.getElementsByClassName("e").length === 0 ) + return; + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) + return; + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function(match, context, isXML) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + var sibDir = dir == "previousSibling" && !isXML; + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + if ( sibDir && elem.nodeType === 1 ){ + elem.sizcache = doneName; + elem.sizset = i; + } + elem = elem[dir]; + var match = false; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( elem.nodeName === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + var sibDir = dir == "previousSibling" && !isXML; + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + if ( sibDir && elem.nodeType === 1 ) { + elem.sizcache = doneName; + elem.sizset = i; + } + elem = elem[dir]; + var match = false; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem.sizcache = doneName; + elem.sizset = i; + } + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +var contains = document.compareDocumentPosition ? function(a, b){ + return a.compareDocumentPosition(b) & 16; +} : function(a, b){ + return a !== b && (a.contains ? a.contains(b) : true); +}; + +var isXML = function(elem){ + return elem.nodeType === 9 && elem.documentElement.nodeName !== "HTML" || + !!elem.ownerDocument && isXML( elem.ownerDocument ); +}; + +var posProcess = function(selector, context){ + var tmpSet = [], later = "", match, + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +jQuery.find = Sizzle; +jQuery.filter = Sizzle.filter; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; + +Sizzle.selectors.filters.hidden = function(elem){ + return elem.offsetWidth === 0 || elem.offsetHeight === 0; +}; + +Sizzle.selectors.filters.visible = function(elem){ + return elem.offsetWidth > 0 || elem.offsetHeight > 0; +}; + +Sizzle.selectors.filters.animated = function(elem){ + return jQuery.grep(jQuery.timers, function(fn){ + return elem === fn.elem; + }).length; +}; + +jQuery.multiFilter = function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return Sizzle.matches(expr, elems); +}; + +jQuery.dir = function( elem, dir ){ + var matched = [], cur = elem[dir]; + while ( cur && cur != document ) { + if ( cur.nodeType == 1 ) + matched.push( cur ); + cur = cur[dir]; + } + return matched; +}; + +jQuery.nth = function(cur, result, dir, elem){ + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) + if ( cur.nodeType == 1 && ++num == result ) + break; + + return cur; +}; + +jQuery.sibling = function(n, elem){ + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType == 1 && n != elem ) + r.push( n ); + } + + return r; +}; + +return; + +window.Sizzle = Sizzle; + +})(); +/* + * A number of helper functions used for managing events. + * Many of the ideas behind this code originated from + * Dean Edwards' addEvent library. + */ +jQuery.event = { + + // Bind an event to an element + // Original by Dean Edwards + add: function(elem, types, handler, data) { + if ( elem.nodeType == 3 || elem.nodeType == 8 ) + return; + + // For whatever reason, IE has trouble passing the window object + // around, causing it to be cloned in the process + if ( elem.setInterval && elem != window ) + elem = window; + + // Make sure that the function being executed has a unique ID + if ( !handler.guid ) + handler.guid = this.guid++; + + // if data is passed, bind to handler + if ( data !== undefined ) { + // Create temporary function pointer to original handler + var fn = handler; + + // Create unique handler function, wrapped around original handler + handler = this.proxy( fn ); + + // Store data in unique handler + handler.data = data; + } + + // Init the element's event structure + var events = jQuery.data(elem, "events") || jQuery.data(elem, "events", {}), + handle = jQuery.data(elem, "handle") || jQuery.data(elem, "handle", function(){ + // Handle the second event of a trigger and when + // an event is called after a page has unloaded + return typeof jQuery !== "undefined" && !jQuery.event.triggered ? + jQuery.event.handle.apply(arguments.callee.elem, arguments) : + undefined; + }); + // Add elem as a property of the handle function + // This is to prevent a memory leak with non-native + // event in IE. + handle.elem = elem; + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + jQuery.each(types.split(/\s+/), function(index, type) { + // Namespaced event handlers + var namespaces = type.split("."); + type = namespaces.shift(); + handler.type = namespaces.slice().sort().join("."); + + // Get the current list of functions bound to this event + var handlers = events[type]; + + if ( jQuery.event.specialAll[type] ) + jQuery.event.specialAll[type].setup.call(elem, data, namespaces); + + // Init the event handler queue + if (!handlers) { + handlers = events[type] = {}; + + // Check for a special event handler + // Only use addEventListener/attachEvent if the special + // events handler returns false + if ( !jQuery.event.special[type] || jQuery.event.special[type].setup.call(elem, data, namespaces) === false ) { + // Bind the global event handler to the element + if (elem.addEventListener) + elem.addEventListener(type, handle, false); + else if (elem.attachEvent) + elem.attachEvent("on" + type, handle); + } + } + + // Add the function to the element's handler list + handlers[handler.guid] = handler; + + // Keep track of which events have been used, for global triggering + jQuery.event.global[type] = true; + }); + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + guid: 1, + global: {}, + + // Detach an event or set of events from an element + remove: function(elem, types, handler) { + // don't do events on text and comment nodes + if ( elem.nodeType == 3 || elem.nodeType == 8 ) + return; + + var events = jQuery.data(elem, "events"), ret, index; + + if ( events ) { + // Unbind all events for the element + if ( types === undefined || (typeof types === "string" && types.charAt(0) == ".") ) + for ( var type in events ) + this.remove( elem, type + (types || "") ); + else { + // types is actually an event object here + if ( types.type ) { + handler = types.handler; + types = types.type; + } + + // Handle multiple events seperated by a space + // jQuery(...).unbind("mouseover mouseout", fn); + jQuery.each(types.split(/\s+/), function(index, type){ + // Namespaced event handlers + var namespaces = type.split("."); + type = namespaces.shift(); + var namespace = RegExp("(^|\\.)" + namespaces.slice().sort().join(".*\\.") + "(\\.|$)"); + + if ( events[type] ) { + // remove the given handler for the given type + if ( handler ) + delete events[type][handler.guid]; + + // remove all handlers for the given type + else + for ( var handle in events[type] ) + // Handle the removal of namespaced events + if ( namespace.test(events[type][handle].type) ) + delete events[type][handle]; + + if ( jQuery.event.specialAll[type] ) + jQuery.event.specialAll[type].teardown.call(elem, namespaces); + + // remove generic event handler if no more handlers exist + for ( ret in events[type] ) break; + if ( !ret ) { + if ( !jQuery.event.special[type] || jQuery.event.special[type].teardown.call(elem, namespaces) === false ) { + if (elem.removeEventListener) + elem.removeEventListener(type, jQuery.data(elem, "handle"), false); + else if (elem.detachEvent) + elem.detachEvent("on" + type, jQuery.data(elem, "handle")); + } + ret = null; + delete events[type]; + } + } + }); + } + + // Remove the expando if it's no longer used + for ( ret in events ) break; + if ( !ret ) { + var handle = jQuery.data( elem, "handle" ); + if ( handle ) handle.elem = null; + jQuery.removeData( elem, "events" ); + jQuery.removeData( elem, "handle" ); + } + } + }, + + // bubbling is internal + trigger: function( event, data, elem, bubbling ) { + // Event object or event type + var type = event.type || event; + + if( !bubbling ){ + event = typeof event === "object" ? + // jQuery.Event object + event[expando] ? event : + // Object literal + jQuery.extend( jQuery.Event(type), event ) : + // Just the event type (string) + jQuery.Event(type); + + if ( type.indexOf("!") >= 0 ) { + event.type = type = type.slice(0, -1); + event.exclusive = true; + } + + // Handle a global trigger + if ( !elem ) { + // Don't bubble custom events when global (to avoid too much overhead) + event.stopPropagation(); + // Only trigger if we've ever bound an event for it + if ( this.global[type] ) + jQuery.each( jQuery.cache, function(){ + if ( this.events && this.events[type] ) + jQuery.event.trigger( event, data, this.handle.elem ); + }); + } + + // Handle triggering a single element + + // don't do events on text and comment nodes + if ( !elem || elem.nodeType == 3 || elem.nodeType == 8 ) + return undefined; + + // Clean up in case it is reused + event.result = undefined; + event.target = elem; + + // Clone the incoming data, if any + data = jQuery.makeArray(data); + data.unshift( event ); + } + + event.currentTarget = elem; + + // Trigger the event, it is assumed that "handle" is a function + var handle = jQuery.data(elem, "handle"); + if ( handle ) + handle.apply( elem, data ); + + // Handle triggering native .onfoo handlers (and on links since we don't call .click() for links) + if ( (!elem[type] || (jQuery.nodeName(elem, 'a') && type == "click")) && elem["on"+type] && elem["on"+type].apply( elem, data ) === false ) + event.result = false; + + // Trigger the native events (except for clicks on links) + if ( !bubbling && elem[type] && !event.isDefaultPrevented() && !(jQuery.nodeName(elem, 'a') && type == "click") ) { + this.triggered = true; + try { + elem[ type ](); + // prevent IE from throwing an error for some hidden elements + } catch (e) {} + } + + this.triggered = false; + + if ( !event.isPropagationStopped() ) { + var parent = elem.parentNode || elem.ownerDocument; + if ( parent ) + jQuery.event.trigger(event, data, parent, true); + } + }, + + handle: function(event) { + // returned undefined or false + var all, handlers; + + event = arguments[0] = jQuery.event.fix( event || window.event ); + event.currentTarget = this; + + // Namespaced event handlers + var namespaces = event.type.split("."); + event.type = namespaces.shift(); + + // Cache this now, all = true means, any handler + all = !namespaces.length && !event.exclusive; + + var namespace = RegExp("(^|\\.)" + namespaces.slice().sort().join(".*\\.") + "(\\.|$)"); + + handlers = ( jQuery.data(this, "events") || {} )[event.type]; + + for ( var j in handlers ) { + var handler = handlers[j]; + + // Filter the functions by class + if ( all || namespace.test(handler.type) ) { + // Pass in a reference to the handler function itself + // So that we can later remove it + event.handler = handler; + event.data = handler.data; + + var ret = handler.apply(this, arguments); + + if( ret !== undefined ){ + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + + if( event.isImmediatePropagationStopped() ) + break; + + } + } + }, + + props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode metaKey newValue originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), + + fix: function(event) { + if ( event[expando] ) + return event; + + // store a copy of the original event object + // and "clone" to set read-only properties + var originalEvent = event; + event = jQuery.Event( originalEvent ); + + for ( var i = this.props.length, prop; i; ){ + prop = this.props[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary + if ( !event.target ) + event.target = event.srcElement || document; // Fixes #1925 where srcElement might not be defined either + + // check if target is a textnode (safari) + if ( event.target.nodeType == 3 ) + event.target = event.target.parentNode; + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && event.fromElement ) + event.relatedTarget = event.fromElement == event.target ? event.toElement : event.fromElement; + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && event.clientX != null ) { + var doc = document.documentElement, body = document.body; + event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc.clientLeft || 0); + event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc.clientTop || 0); + } + + // Add which for key events + if ( !event.which && ((event.charCode || event.charCode === 0) ? event.charCode : event.keyCode) ) + event.which = event.charCode || event.keyCode; + + // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs) + if ( !event.metaKey && event.ctrlKey ) + event.metaKey = event.ctrlKey; + + // Add which for click: 1 == left; 2 == middle; 3 == right + // Note: button is not normalized, so don't use it + if ( !event.which && event.button ) + event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) )); + + return event; + }, + + proxy: function( fn, proxy ){ + proxy = proxy || function(){ return fn.apply(this, arguments); }; + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || proxy.guid || this.guid++; + // So proxy can be declared as an argument + return proxy; + }, + + special: { + ready: { + // Make sure the ready event is setup + setup: bindReady, + teardown: function() {} + } + }, + + specialAll: { + live: { + setup: function( selector, namespaces ){ + jQuery.event.add( this, namespaces[0], liveHandler ); + }, + teardown: function( namespaces ){ + if ( namespaces.length ) { + var remove = 0, name = RegExp("(^|\\.)" + namespaces[0] + "(\\.|$)"); + + jQuery.each( (jQuery.data(this, "events").live || {}), function(){ + if ( name.test(this.type) ) + remove++; + }); + + if ( remove < 1 ) + jQuery.event.remove( this, namespaces[0], liveHandler ); + } + } + } + } +}; + +jQuery.Event = function( src ){ + // Allow instantiation without the 'new' keyword + if( !this.preventDefault ) + return new jQuery.Event(src); + + // Event object + if( src && src.type ){ + this.originalEvent = src; + this.type = src.type; + // Event type + }else + this.type = src; + + // timeStamp is buggy for some events on Firefox(#3843) + // So we won't rely on the native value + this.timeStamp = now(); + + // Mark it as fixed + this[expando] = true; +}; + +function returnFalse(){ + return false; +} +function returnTrue(){ + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if( !e ) + return; + // if preventDefault exists run it on the original event + if (e.preventDefault) + e.preventDefault(); + // otherwise set the returnValue property of the original event to false (IE) + e.returnValue = false; + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if( !e ) + return; + // if stopPropagation exists run it on the original event + if (e.stopPropagation) + e.stopPropagation(); + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation:function(){ + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; +// Checks if an event happened on an element within another element +// Used in jQuery.event.special.mouseenter and mouseleave handlers +var withinElement = function(event) { + // Check if mouse(over|out) are still within the same parent element + var parent = event.relatedTarget; + // Traverse up the tree + while ( parent && parent != this ) + try { parent = parent.parentNode; } + catch(e) { parent = this; } + + if( parent != this ){ + // set the correct event type + event.type = event.data; + // handle event if we actually just moused on to a non sub-element + jQuery.event.handle.apply( this, arguments ); + } +}; + +jQuery.each({ + mouseover: 'mouseenter', + mouseout: 'mouseleave' +}, function( orig, fix ){ + jQuery.event.special[ fix ] = { + setup: function(){ + jQuery.event.add( this, orig, withinElement, fix ); + }, + teardown: function(){ + jQuery.event.remove( this, orig, withinElement ); + } + }; +}); + +jQuery.fn.extend({ + bind: function( type, data, fn ) { + return type == "unload" ? this.one(type, data, fn) : this.each(function(){ + jQuery.event.add( this, type, fn || data, fn && data ); + }); + }, + + one: function( type, data, fn ) { + var one = jQuery.event.proxy( fn || data, function(event) { + jQuery(this).unbind(event, one); + return (fn || data).apply( this, arguments ); + }); + return this.each(function(){ + jQuery.event.add( this, type, one, fn && data); + }); + }, + + unbind: function( type, fn ) { + return this.each(function(){ + jQuery.event.remove( this, type, fn ); + }); + }, + + trigger: function( type, data ) { + return this.each(function(){ + jQuery.event.trigger( type, data, this ); + }); + }, + + triggerHandler: function( type, data ) { + if( this[0] ){ + var event = jQuery.Event(type); + event.preventDefault(); + event.stopPropagation(); + jQuery.event.trigger( event, data, this[0] ); + return event.result; + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, i = 1; + + // link all the functions, so any of them can unbind this click handler + while( i < args.length ) + jQuery.event.proxy( fn, args[i++] ); + + return this.click( jQuery.event.proxy( fn, function(event) { + // Figure out which function to execute + this.lastToggle = ( this.lastToggle || 0 ) % i; + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ this.lastToggle++ ].apply( this, arguments ) || false; + })); + }, + + hover: function(fnOver, fnOut) { + return this.mouseenter(fnOver).mouseleave(fnOut); + }, + + ready: function(fn) { + // Attach the listeners + bindReady(); + + // If the DOM is already ready + if ( jQuery.isReady ) + // Execute the function immediately + fn.call( document, jQuery ); + + // Otherwise, remember the function for later + else + // Add the function to the wait list + jQuery.readyList.push( fn ); + + return this; + }, + + live: function( type, fn ){ + var proxy = jQuery.event.proxy( fn ); + proxy.guid += this.selector + type; + + jQuery(document).bind( liveConvert(type, this.selector), this.selector, proxy ); + + return this; + }, + + die: function( type, fn ){ + jQuery(document).unbind( liveConvert(type, this.selector), fn ? { guid: fn.guid + this.selector + type } : null ); + return this; + } +}); + +function liveHandler( event ){ + var check = RegExp("(^|\\.)" + event.type + "(\\.|$)"), + stop = true, + elems = []; + + jQuery.each(jQuery.data(this, "events").live || [], function(i, fn){ + if ( check.test(fn.type) ) { + var elem = jQuery(event.target).closest(fn.data)[0]; + if ( elem ) + elems.push({ elem: elem, fn: fn }); + } + }); + + elems.sort(function(a,b) { + return jQuery.data(a.elem, "closest") - jQuery.data(b.elem, "closest"); + }); + + jQuery.each(elems, function(){ + if ( this.fn.call(this.elem, event, this.fn.data) === false ) + return (stop = false); + }); + + return stop; +} + +function liveConvert(type, selector){ + return ["live", type, selector.replace(/\./g, "`").replace(/ /g, "|")].join("."); +} + +jQuery.extend({ + isReady: false, + readyList: [], + // Handle when the DOM is ready + ready: function() { + // Make sure that the DOM is not already loaded + if ( !jQuery.isReady ) { + // Remember that the DOM is ready + jQuery.isReady = true; + + // If there are functions bound, to execute + if ( jQuery.readyList ) { + // Execute all of them + jQuery.each( jQuery.readyList, function(){ + this.call( document, jQuery ); + }); + + // Reset the list of functions + jQuery.readyList = null; + } + + // Trigger any bound ready events + jQuery(document).triggerHandler("ready"); + } + } +}); + +var readyBound = false; + +function bindReady(){ + if ( readyBound ) return; + readyBound = true; + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", function(){ + document.removeEventListener( "DOMContentLoaded", arguments.callee, false ); + jQuery.ready(); + }, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent("onreadystatechange", function(){ + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", arguments.callee ); + jQuery.ready(); + } + }); + + // If IE and not an iframe + // continually check to see if the document is ready + if ( document.documentElement.doScroll && window == window.top ) (function(){ + if ( jQuery.isReady ) return; + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch( error ) { + setTimeout( arguments.callee, 0 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); + })(); + } + + // A fallback to window.onload, that will always work + jQuery.event.add( window, "load", jQuery.ready ); +} + +jQuery.each( ("blur,focus,load,resize,scroll,unload,click,dblclick," + + "mousedown,mouseup,mousemove,mouseover,mouseout,mouseenter,mouseleave," + + "change,select,submit,keydown,keypress,keyup,error").split(","), function(i, name){ + + // Handle event binding + jQuery.fn[name] = function(fn){ + return fn ? this.bind(name, fn) : this.trigger(name); + }; +}); + +// Prevent memory leaks in IE +// And prevent errors on refresh with events like mouseover in other browsers +// Window isn't included so as not to unbind existing unload events +jQuery( window ).bind( 'unload', function(){ + for ( var id in jQuery.cache ) + // Skip the window + if ( id != 1 && jQuery.cache[ id ].handle ) + jQuery.event.remove( jQuery.cache[ id ].handle.elem ); +}); +(function(){ + + jQuery.support = {}; + + var root = document.documentElement, + script = document.createElement("script"), + div = document.createElement("div"), + id = "script" + (new Date).getTime(); + + div.style.display = "none"; + div.innerHTML = ' <link/><table></table><a href="/a" style="color:red;float:left;opacity:.5;">a</a><select><option>text</option></select><object><param/></object>'; + + var all = div.getElementsByTagName("*"), + a = div.getElementsByTagName("a")[0]; + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return; + } + + jQuery.support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: div.firstChild.nodeType == 3, + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that you can get all elements in an <object> element + // IE 7 always returns no results + objectAll: !!div.getElementsByTagName("object")[0] + .getElementsByTagName("*").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Get the style information from getAttribute + // (IE uses .cssText insted) + style: /red/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: a.getAttribute("href") === "/a", + + // Make sure that element opacity exists + // (IE uses filter instead) + opacity: a.style.opacity === "0.5", + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Will be defined later + scriptEval: false, + noCloneEvent: true, + boxModel: null + }; + + script.type = "text/javascript"; + try { + script.appendChild( document.createTextNode( "window." + id + "=1;" ) ); + } catch(e){} + + root.insertBefore( script, root.firstChild ); + + // Make sure that the execution of code works by injecting a script + // tag with appendChild/createTextNode + // (IE doesn't support this, fails, and uses .text instead) + if ( window[ id ] ) { + jQuery.support.scriptEval = true; + delete window[ id ]; + } + + root.removeChild( script ); + + if ( div.attachEvent && div.fireEvent ) { + div.attachEvent("onclick", function(){ + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + jQuery.support.noCloneEvent = false; + div.detachEvent("onclick", arguments.callee); + }); + div.cloneNode(true).fireEvent("onclick"); + } + + // Figure out if the W3C box model works as expected + // document.body must exist before we can do this + jQuery(function(){ + var div = document.createElement("div"); + div.style.width = div.style.paddingLeft = "1px"; + + document.body.appendChild( div ); + jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2; + document.body.removeChild( div ).style.display = 'none'; + }); +})(); + +var styleFloat = jQuery.support.cssFloat ? "cssFloat" : "styleFloat"; + +jQuery.props = { + "for": "htmlFor", + "class": "className", + "float": styleFloat, + cssFloat: styleFloat, + styleFloat: styleFloat, + readonly: "readOnly", + maxlength: "maxLength", + cellspacing: "cellSpacing", + rowspan: "rowSpan", + tabindex: "tabIndex" +}; +jQuery.fn.extend({ + // Keep a copy of the old load + _load: jQuery.fn.load, + + load: function( url, params, callback ) { + if ( typeof url !== "string" ) + return this._load( url ); + + var off = url.indexOf(" "); + if ( off >= 0 ) { + var selector = url.slice(off, url.length); + url = url.slice(0, off); + } + + // Default to a GET request + var type = "GET"; + + // If the second parameter was provided + if ( params ) + // If it's a function + if ( jQuery.isFunction( params ) ) { + // We assume that it's the callback + callback = params; + params = null; + + // Otherwise, build a param string + } else if( typeof params === "object" ) { + params = jQuery.param( params ); + type = "POST"; + } + + var self = this; + + // Request the remote document + jQuery.ajax({ + url: url, + type: type, + dataType: "html", + data: params, + complete: function(res, status){ + // If successful, inject the HTML into all the matched elements + if ( status == "success" || status == "notmodified" ) + // See if a selector was specified + self.html( selector ? + // Create a dummy div to hold the results + jQuery("<div/>") + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append(res.responseText.replace(/<script(.|\s)*?\/script>/g, "")) + + // Locate the specified elements + .find(selector) : + + // If not, just inject the full result + res.responseText ); + + if( callback ) + self.each( callback, [res.responseText, status, res] ); + } + }); + return this; + }, + + serialize: function() { + return jQuery.param(this.serializeArray()); + }, + serializeArray: function() { + return this.map(function(){ + return this.elements ? jQuery.makeArray(this.elements) : this; + }) + .filter(function(){ + return this.name && !this.disabled && + (this.checked || /select|textarea/i.test(this.nodeName) || + /text|hidden|password|search/i.test(this.type)); + }) + .map(function(i, elem){ + var val = jQuery(this).val(); + return val == null ? null : + jQuery.isArray(val) ? + jQuery.map( val, function(val, i){ + return {name: elem.name, value: val}; + }) : + {name: elem.name, value: val}; + }).get(); + } +}); + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( "ajaxStart,ajaxStop,ajaxComplete,ajaxError,ajaxSuccess,ajaxSend".split(","), function(i,o){ + jQuery.fn[o] = function(f){ + return this.bind(o, f); + }; +}); + +var jsc = now(); + +jQuery.extend({ + + get: function( url, data, callback, type ) { + // shift arguments if data argument was ommited + if ( jQuery.isFunction( data ) ) { + callback = data; + data = null; + } + + return jQuery.ajax({ + type: "GET", + url: url, + data: data, + success: callback, + dataType: type + }); + }, + + getScript: function( url, callback ) { + return jQuery.get(url, null, callback, "script"); + }, + + getJSON: function( url, data, callback ) { + return jQuery.get(url, data, callback, "json"); + }, + + post: function( url, data, callback, type ) { + if ( jQuery.isFunction( data ) ) { + callback = data; + data = {}; + } + + return jQuery.ajax({ + type: "POST", + url: url, + data: data, + success: callback, + dataType: type + }); + }, + + ajaxSetup: function( settings ) { + jQuery.extend( jQuery.ajaxSettings, settings ); + }, + + ajaxSettings: { + url: location.href, + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded", + processData: true, + async: true, + /* + timeout: 0, + data: null, + username: null, + password: null, + */ + // Create the request object; Microsoft failed to properly + // implement the XMLHttpRequest in IE7, so we use the ActiveXObject when it is available + // This function can be overriden by calling jQuery.ajaxSetup + xhr:function(){ + return window.ActiveXObject ? new ActiveXObject("Microsoft.XMLHTTP") : new XMLHttpRequest(); + }, + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + script: "text/javascript, application/javascript", + json: "application/json, text/javascript", + text: "text/plain", + _default: "*/*" + } + }, + + // Last-Modified header cache for next request + lastModified: {}, + + ajax: function( s ) { + // Extend the settings, but re-extend 's' so that it can be + // checked again later (in the test suite, specifically) + s = jQuery.extend(true, s, jQuery.extend(true, {}, jQuery.ajaxSettings, s)); + + var jsonp, jsre = /=\?(&|$)/g, status, data, + type = s.type.toUpperCase(); + + // convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) + s.data = jQuery.param(s.data); + + // Handle JSONP Parameter Callbacks + if ( s.dataType == "jsonp" ) { + if ( type == "GET" ) { + if ( !s.url.match(jsre) ) + s.url += (s.url.match(/\?/) ? "&" : "?") + (s.jsonp || "callback") + "=?"; + } else if ( !s.data || !s.data.match(jsre) ) + s.data = (s.data ? s.data + "&" : "") + (s.jsonp || "callback") + "=?"; + s.dataType = "json"; + } + + // Build temporary JSONP function + if ( s.dataType == "json" && (s.data && s.data.match(jsre) || s.url.match(jsre)) ) { + jsonp = "jsonp" + jsc++; + + // Replace the =? sequence both in the query string and the data + if ( s.data ) + s.data = (s.data + "").replace(jsre, "=" + jsonp + "$1"); + s.url = s.url.replace(jsre, "=" + jsonp + "$1"); + + // We need to make sure + // that a JSONP style response is executed properly + s.dataType = "script"; + + // Handle JSONP-style loading + window[ jsonp ] = function(tmp){ + data = tmp; + success(); + complete(); + // Garbage collect + window[ jsonp ] = undefined; + try{ delete window[ jsonp ]; } catch(e){} + if ( head ) + head.removeChild( script ); + }; + } + + if ( s.dataType == "script" && s.cache == null ) + s.cache = false; + + if ( s.cache === false && type == "GET" ) { + var ts = now(); + // try replacing _= if it is there + var ret = s.url.replace(/(\?|&)_=.*?(&|$)/, "$1_=" + ts + "$2"); + // if nothing was replaced, add timestamp to the end + s.url = ret + ((ret == s.url) ? (s.url.match(/\?/) ? "&" : "?") + "_=" + ts : ""); + } + + // If data is available, append data to url for get requests + if ( s.data && type == "GET" ) { + s.url += (s.url.match(/\?/) ? "&" : "?") + s.data; + + // IE likes to send both get and post data, prevent this + s.data = null; + } + + // Watch for a new set of requests + if ( s.global && ! jQuery.active++ ) + jQuery.event.trigger( "ajaxStart" ); + + // Matches an absolute URL, and saves the domain + var parts = /^(\w+:)?\/\/([^\/?#]+)/.exec( s.url ); + + // If we're requesting a remote document + // and trying to load JSON or Script with a GET + if ( s.dataType == "script" && type == "GET" && parts + && ( parts[1] && parts[1] != location.protocol || parts[2] != location.host )){ + + var head = document.getElementsByTagName("head")[0]; + var script = document.createElement("script"); + script.src = s.url; + if (s.scriptCharset) + script.charset = s.scriptCharset; + + // Handle Script loading + if ( !jsonp ) { + var done = false; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function(){ + if ( !done && (!this.readyState || + this.readyState == "loaded" || this.readyState == "complete") ) { + done = true; + success(); + complete(); + + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; + head.removeChild( script ); + } + }; + } + + head.appendChild(script); + + // We handle everything using the script element injection + return undefined; + } + + var requestDone = false; + + // Create the request object + var xhr = s.xhr(); + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if( s.username ) + xhr.open(type, s.url, s.async, s.username, s.password); + else + xhr.open(type, s.url, s.async); + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + // Set the correct header, if data is being sent + if ( s.data ) + xhr.setRequestHeader("Content-Type", s.contentType); + + // Set the If-Modified-Since header, if ifModified mode. + if ( s.ifModified ) + xhr.setRequestHeader("If-Modified-Since", + jQuery.lastModified[s.url] || "Thu, 01 Jan 1970 00:00:00 GMT" ); + + // Set header so the called script knows that it's an XMLHttpRequest + xhr.setRequestHeader("X-Requested-With", "XMLHttpRequest"); + + // Set the Accepts header for the server, depending on the dataType + xhr.setRequestHeader("Accept", s.dataType && s.accepts[ s.dataType ] ? + s.accepts[ s.dataType ] + ", */*" : + s.accepts._default ); + } catch(e){} + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && s.beforeSend(xhr, s) === false ) { + // Handle the global AJAX counter + if ( s.global && ! --jQuery.active ) + jQuery.event.trigger( "ajaxStop" ); + // close opended socket + xhr.abort(); + return false; + } + + if ( s.global ) + jQuery.event.trigger("ajaxSend", [xhr, s]); + + // Wait for a response to come back + var onreadystatechange = function(isTimeout){ + // The request was aborted, clear the interval and decrement jQuery.active + if (xhr.readyState == 0) { + if (ival) { + // clear poll interval + clearInterval(ival); + ival = null; + // Handle the global AJAX counter + if ( s.global && ! --jQuery.active ) + jQuery.event.trigger( "ajaxStop" ); + } + // The transfer is complete and the data is available, or the request timed out + } else if ( !requestDone && xhr && (xhr.readyState == 4 || isTimeout == "timeout") ) { + requestDone = true; + + // clear poll interval + if (ival) { + clearInterval(ival); + ival = null; + } + + status = isTimeout == "timeout" ? "timeout" : + !jQuery.httpSuccess( xhr ) ? "error" : + s.ifModified && jQuery.httpNotModified( xhr, s.url ) ? "notmodified" : + "success"; + + if ( status == "success" ) { + // Watch for, and catch, XML document parse errors + try { + // process the data (runs the xml through httpData regardless of callback) + data = jQuery.httpData( xhr, s.dataType, s ); + } catch(e) { + status = "parsererror"; + } + } + + // Make sure that the request was successful or notmodified + if ( status == "success" ) { + // Cache Last-Modified header, if ifModified mode. + var modRes; + try { + modRes = xhr.getResponseHeader("Last-Modified"); + } catch(e) {} // swallow exception thrown by FF if header is not available + + if ( s.ifModified && modRes ) + jQuery.lastModified[s.url] = modRes; + + // JSONP handles its own success callback + if ( !jsonp ) + success(); + } else + jQuery.handleError(s, xhr, status); + + // Fire the complete handlers + complete(); + + if ( isTimeout ) + xhr.abort(); + + // Stop memory leaks + if ( s.async ) + xhr = null; + } + }; + + if ( s.async ) { + // don't attach the handler to the request, just poll it instead + var ival = setInterval(onreadystatechange, 13); + + // Timeout checker + if ( s.timeout > 0 ) + setTimeout(function(){ + // Check to see if the request is still happening + if ( xhr && !requestDone ) + onreadystatechange( "timeout" ); + }, s.timeout); + } + + // Send the data + try { + xhr.send(s.data); + } catch(e) { + jQuery.handleError(s, xhr, null, e); + } + + // firefox 1.5 doesn't fire statechange for sync requests + if ( !s.async ) + onreadystatechange(); + + function success(){ + // If a local callback was specified, fire it and pass it the data + if ( s.success ) + s.success( data, status ); + + // Fire the global callback + if ( s.global ) + jQuery.event.trigger( "ajaxSuccess", [xhr, s] ); + } + + function complete(){ + // Process result + if ( s.complete ) + s.complete(xhr, status); + + // The request was completed + if ( s.global ) + jQuery.event.trigger( "ajaxComplete", [xhr, s] ); + + // Handle the global AJAX counter + if ( s.global && ! --jQuery.active ) + jQuery.event.trigger( "ajaxStop" ); + } + + // return XMLHttpRequest to allow aborting the request etc. + return xhr; + }, + + handleError: function( s, xhr, status, e ) { + // If a local callback was specified, fire it + if ( s.error ) s.error( xhr, status, e ); + + // Fire the global callback + if ( s.global ) + jQuery.event.trigger( "ajaxError", [xhr, s, e] ); + }, + + // Counter for holding the number of active queries + active: 0, + + // Determines if an XMLHttpRequest was successful or not + httpSuccess: function( xhr ) { + try { + // IE error sometimes returns 1223 when it should be 204 so treat it as success, see #1450 + return !xhr.status && location.protocol == "file:" || + ( xhr.status >= 200 && xhr.status < 300 ) || xhr.status == 304 || xhr.status == 1223; + } catch(e){} + return false; + }, + + // Determines if an XMLHttpRequest returns NotModified + httpNotModified: function( xhr, url ) { + try { + var xhrRes = xhr.getResponseHeader("Last-Modified"); + + // Firefox always returns 200. check Last-Modified date + return xhr.status == 304 || xhrRes == jQuery.lastModified[url]; + } catch(e){} + return false; + }, + + httpData: function( xhr, type, s ) { + var ct = xhr.getResponseHeader("content-type"), + xml = type == "xml" || !type && ct && ct.indexOf("xml") >= 0, + data = xml ? xhr.responseXML : xhr.responseText; + + if ( xml && data.documentElement.tagName == "parsererror" ) + throw "parsererror"; + + // Allow a pre-filtering function to sanitize the response + // s != null is checked to keep backwards compatibility + if( s && s.dataFilter ) + data = s.dataFilter( data, type ); + + // The filter can actually parse the response + if( typeof data === "string" ){ + + // If the type is "script", eval it in global context + if ( type == "script" ) + jQuery.globalEval( data ); + + // Get the JavaScript object, if JSON is used. + if ( type == "json" ) + data = window["eval"]("(" + data + ")"); + } + + return data; + }, + + // Serialize an array of form elements or a set of + // key/values into a query string + param: function( a ) { + var s = [ ]; + + function add( key, value ){ + s[ s.length ] = encodeURIComponent(key) + '=' + encodeURIComponent(value); + }; + + // If an array was passed in, assume that it is an array + // of form elements + if ( jQuery.isArray(a) || a.jquery ) + // Serialize the form elements + jQuery.each( a, function(){ + add( this.name, this.value ); + }); + + // Otherwise, assume that it's an object of key/value pairs + else + // Serialize the key/values + for ( var j in a ) + // If the value is an array then the key names need to be repeated + if ( jQuery.isArray(a[j]) ) + jQuery.each( a[j], function(){ + add( j, this ); + }); + else + add( j, jQuery.isFunction(a[j]) ? a[j]() : a[j] ); + + // Return the resulting serialization + return s.join("&").replace(/%20/g, "+"); + } + +}); +var elemdisplay = {}, + timerId, + fxAttrs = [ + // height animations + [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ], + // width animations + [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ], + // opacity animations + [ "opacity" ] + ]; + +function genFx( type, num ){ + var obj = {}; + jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function(){ + obj[ this ] = type; + }); + return obj; +} + +jQuery.fn.extend({ + show: function(speed,callback){ + if ( speed ) { + return this.animate( genFx("show", 3), speed, callback); + } else { + for ( var i = 0, l = this.length; i < l; i++ ){ + var old = jQuery.data(this[i], "olddisplay"); + + this[i].style.display = old || ""; + + if ( jQuery.css(this[i], "display") === "none" ) { + var tagName = this[i].tagName, display; + + if ( elemdisplay[ tagName ] ) { + display = elemdisplay[ tagName ]; + } else { + var elem = jQuery("<" + tagName + " />").appendTo("body"); + + display = elem.css("display"); + if ( display === "none" ) + display = "block"; + + elem.remove(); + + elemdisplay[ tagName ] = display; + } + + jQuery.data(this[i], "olddisplay", display); + } + } + + // Set the display of the elements in a second loop + // to avoid the constant reflow + for ( var i = 0, l = this.length; i < l; i++ ){ + this[i].style.display = jQuery.data(this[i], "olddisplay") || ""; + } + + return this; + } + }, + + hide: function(speed,callback){ + if ( speed ) { + return this.animate( genFx("hide", 3), speed, callback); + } else { + for ( var i = 0, l = this.length; i < l; i++ ){ + var old = jQuery.data(this[i], "olddisplay"); + if ( !old && old !== "none" ) + jQuery.data(this[i], "olddisplay", jQuery.css(this[i], "display")); + } + + // Set the display of the elements in a second loop + // to avoid the constant reflow + for ( var i = 0, l = this.length; i < l; i++ ){ + this[i].style.display = "none"; + } + + return this; + } + }, + + // Save the old toggle function + _toggle: jQuery.fn.toggle, + + toggle: function( fn, fn2 ){ + var bool = typeof fn === "boolean"; + + return jQuery.isFunction(fn) && jQuery.isFunction(fn2) ? + this._toggle.apply( this, arguments ) : + fn == null || bool ? + this.each(function(){ + var state = bool ? fn : jQuery(this).is(":hidden"); + jQuery(this)[ state ? "show" : "hide" ](); + }) : + this.animate(genFx("toggle", 3), fn, fn2); + }, + + fadeTo: function(speed,to,callback){ + return this.animate({opacity: to}, speed, callback); + }, + + animate: function( prop, speed, easing, callback ) { + var optall = jQuery.speed(speed, easing, callback); + + return this[ optall.queue === false ? "each" : "queue" ](function(){ + + var opt = jQuery.extend({}, optall), p, + hidden = this.nodeType == 1 && jQuery(this).is(":hidden"), + self = this; + + for ( p in prop ) { + if ( prop[p] == "hide" && hidden || prop[p] == "show" && !hidden ) + return opt.complete.call(this); + + if ( ( p == "height" || p == "width" ) && this.style ) { + // Store display property + opt.display = jQuery.css(this, "display"); + + // Make sure that nothing sneaks out + opt.overflow = this.style.overflow; + } + } + + if ( opt.overflow != null ) + this.style.overflow = "hidden"; + + opt.curAnim = jQuery.extend({}, prop); + + jQuery.each( prop, function(name, val){ + var e = new jQuery.fx( self, opt, name ); + + if ( /toggle|show|hide/.test(val) ) + e[ val == "toggle" ? hidden ? "show" : "hide" : val ]( prop ); + else { + var parts = val.toString().match(/^([+-]=)?([\d+-.]+)(.*)$/), + start = e.cur(true) || 0; + + if ( parts ) { + var end = parseFloat(parts[2]), + unit = parts[3] || "px"; + + // We need to compute starting value + if ( unit != "px" ) { + self.style[ name ] = (end || 1) + unit; + start = ((end || 1) / e.cur(true)) * start; + self.style[ name ] = start + unit; + } + + // If a +=/-= token was provided, we're doing a relative animation + if ( parts[1] ) + end = ((parts[1] == "-=" ? -1 : 1) * end) + start; + + e.custom( start, end, unit ); + } else + e.custom( start, val, "" ); + } + }); + + // For JS strict compliance + return true; + }); + }, + + stop: function(clearQueue, gotoEnd){ + var timers = jQuery.timers; + + if (clearQueue) + this.queue([]); + + this.each(function(){ + // go in reverse order so anything added to the queue during the loop is ignored + for ( var i = timers.length - 1; i >= 0; i-- ) + if ( timers[i].elem == this ) { + if (gotoEnd) + // force the next step to be the last + timers[i](true); + timers.splice(i, 1); + } + }); + + // start the next in the queue if the last step wasn't forced + if (!gotoEnd) + this.dequeue(); + + return this; + } + +}); + +// Generate shortcuts for custom animations +jQuery.each({ + slideDown: genFx("show", 1), + slideUp: genFx("hide", 1), + slideToggle: genFx("toggle", 1), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" } +}, function( name, props ){ + jQuery.fn[ name ] = function( speed, callback ){ + return this.animate( props, speed, callback ); + }; +}); + +jQuery.extend({ + + speed: function(speed, easing, fn) { + var opt = typeof speed === "object" ? speed : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction(easing) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + jQuery.fx.speeds[opt.duration] || jQuery.fx.speeds._default; + + // Queueing + opt.old = opt.complete; + opt.complete = function(){ + if ( opt.queue !== false ) + jQuery(this).dequeue(); + if ( jQuery.isFunction( opt.old ) ) + opt.old.call( this ); + }; + + return opt; + }, + + easing: { + linear: function( p, n, firstNum, diff ) { + return firstNum + diff * p; + }, + swing: function( p, n, firstNum, diff ) { + return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum; + } + }, + + timers: [], + + fx: function( elem, options, prop ){ + this.options = options; + this.elem = elem; + this.prop = prop; + + if ( !options.orig ) + options.orig = {}; + } + +}); + +jQuery.fx.prototype = { + + // Simple function for setting a style value + update: function(){ + if ( this.options.step ) + this.options.step.call( this.elem, this.now, this ); + + (jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this ); + + // Set display property to block for height/width animations + if ( ( this.prop == "height" || this.prop == "width" ) && this.elem.style ) + this.elem.style.display = "block"; + }, + + // Get the current size + cur: function(force){ + if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) ) + return this.elem[ this.prop ]; + + var r = parseFloat(jQuery.css(this.elem, this.prop, force)); + return r && r > -10000 ? r : parseFloat(jQuery.curCSS(this.elem, this.prop)) || 0; + }, + + // Start an animation from one number to another + custom: function(from, to, unit){ + this.startTime = now(); + this.start = from; + this.end = to; + this.unit = unit || this.unit || "px"; + this.now = this.start; + this.pos = this.state = 0; + + var self = this; + function t(gotoEnd){ + return self.step(gotoEnd); + } + + t.elem = this.elem; + + if ( t() && jQuery.timers.push(t) && !timerId ) { + timerId = setInterval(function(){ + var timers = jQuery.timers; + + for ( var i = 0; i < timers.length; i++ ) + if ( !timers[i]() ) + timers.splice(i--, 1); + + if ( !timers.length ) { + clearInterval( timerId ); + timerId = undefined; + } + }, 13); + } + }, + + // Simple 'show' function + show: function(){ + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.attr( this.elem.style, this.prop ); + this.options.show = true; + + // Begin the animation + // Make sure that we start at a small width/height to avoid any + // flash of content + this.custom(this.prop == "width" || this.prop == "height" ? 1 : 0, this.cur()); + + // Start by showing the element + jQuery(this.elem).show(); + }, + + // Simple 'hide' function + hide: function(){ + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.attr( this.elem.style, this.prop ); + this.options.hide = true; + + // Begin the animation + this.custom(this.cur(), 0); + }, + + // Each step of an animation + step: function(gotoEnd){ + var t = now(); + + if ( gotoEnd || t >= this.options.duration + this.startTime ) { + this.now = this.end; + this.pos = this.state = 1; + this.update(); + + this.options.curAnim[ this.prop ] = true; + + var done = true; + for ( var i in this.options.curAnim ) + if ( this.options.curAnim[i] !== true ) + done = false; + + if ( done ) { + if ( this.options.display != null ) { + // Reset the overflow + this.elem.style.overflow = this.options.overflow; + + // Reset the display + this.elem.style.display = this.options.display; + if ( jQuery.css(this.elem, "display") == "none" ) + this.elem.style.display = "block"; + } + + // Hide the element if the "hide" operation was done + if ( this.options.hide ) + jQuery(this.elem).hide(); + + // Reset the properties, if the item has been hidden or shown + if ( this.options.hide || this.options.show ) + for ( var p in this.options.curAnim ) + jQuery.attr(this.elem.style, p, this.options.orig[p]); + + // Execute the complete function + this.options.complete.call( this.elem ); + } + + return false; + } else { + var n = t - this.startTime; + this.state = n / this.options.duration; + + // Perform the easing function, defaults to swing + this.pos = jQuery.easing[this.options.easing || (jQuery.easing.swing ? "swing" : "linear")](this.state, n, 0, 1, this.options.duration); + this.now = this.start + ((this.end - this.start) * this.pos); + + // Perform the next step of the animation + this.update(); + } + + return true; + } + +}; + +jQuery.extend( jQuery.fx, { + speeds:{ + slow: 600, + fast: 200, + // Default speed + _default: 400 + }, + step: { + + opacity: function(fx){ + jQuery.attr(fx.elem.style, "opacity", fx.now); + }, + + _default: function(fx){ + if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) + fx.elem.style[ fx.prop ] = fx.now + fx.unit; + else + fx.elem[ fx.prop ] = fx.now; + } + } +}); +if ( document.documentElement["getBoundingClientRect"] ) + jQuery.fn.offset = function() { + if ( !this[0] ) return { top: 0, left: 0 }; + if ( this[0] === this[0].ownerDocument.body ) return jQuery.offset.bodyOffset( this[0] ); + var box = this[0].getBoundingClientRect(), doc = this[0].ownerDocument, body = doc.body, docElem = doc.documentElement, + clientTop = docElem.clientTop || body.clientTop || 0, clientLeft = docElem.clientLeft || body.clientLeft || 0, + top = box.top + (self.pageYOffset || jQuery.boxModel && docElem.scrollTop || body.scrollTop ) - clientTop, + left = box.left + (self.pageXOffset || jQuery.boxModel && docElem.scrollLeft || body.scrollLeft) - clientLeft; + return { top: top, left: left }; + }; +else + jQuery.fn.offset = function() { + if ( !this[0] ) return { top: 0, left: 0 }; + if ( this[0] === this[0].ownerDocument.body ) return jQuery.offset.bodyOffset( this[0] ); + jQuery.offset.initialized || jQuery.offset.initialize(); + + var elem = this[0], offsetParent = elem.offsetParent, prevOffsetParent = elem, + doc = elem.ownerDocument, computedStyle, docElem = doc.documentElement, + body = doc.body, defaultView = doc.defaultView, + prevComputedStyle = defaultView.getComputedStyle(elem, null), + top = elem.offsetTop, left = elem.offsetLeft; + + while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) { + computedStyle = defaultView.getComputedStyle(elem, null); + top -= elem.scrollTop, left -= elem.scrollLeft; + if ( elem === offsetParent ) { + top += elem.offsetTop, left += elem.offsetLeft; + if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && /^t(able|d|h)$/i.test(elem.tagName)) ) + top += parseInt( computedStyle.borderTopWidth, 10) || 0, + left += parseInt( computedStyle.borderLeftWidth, 10) || 0; + prevOffsetParent = offsetParent, offsetParent = elem.offsetParent; + } + if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) + top += parseInt( computedStyle.borderTopWidth, 10) || 0, + left += parseInt( computedStyle.borderLeftWidth, 10) || 0; + prevComputedStyle = computedStyle; + } + + if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) + top += body.offsetTop, + left += body.offsetLeft; + + if ( prevComputedStyle.position === "fixed" ) + top += Math.max(docElem.scrollTop, body.scrollTop), + left += Math.max(docElem.scrollLeft, body.scrollLeft); + + return { top: top, left: left }; + }; + +jQuery.offset = { + initialize: function() { + if ( this.initialized ) return; + var body = document.body, container = document.createElement('div'), innerDiv, checkDiv, table, td, rules, prop, bodyMarginTop = body.style.marginTop, + html = '<div style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;"><div></div></div><table style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;" cellpadding="0" cellspacing="0"><tr><td></td></tr></table>'; + + rules = { position: 'absolute', top: 0, left: 0, margin: 0, border: 0, width: '1px', height: '1px', visibility: 'hidden' }; + for ( prop in rules ) container.style[prop] = rules[prop]; + + container.innerHTML = html; + body.insertBefore(container, body.firstChild); + innerDiv = container.firstChild, checkDiv = innerDiv.firstChild, td = innerDiv.nextSibling.firstChild.firstChild; + + this.doesNotAddBorder = (checkDiv.offsetTop !== 5); + this.doesAddBorderForTableAndCells = (td.offsetTop === 5); + + innerDiv.style.overflow = 'hidden', innerDiv.style.position = 'relative'; + this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5); + + body.style.marginTop = '1px'; + this.doesNotIncludeMarginInBodyOffset = (body.offsetTop === 0); + body.style.marginTop = bodyMarginTop; + + body.removeChild(container); + this.initialized = true; + }, + + bodyOffset: function(body) { + jQuery.offset.initialized || jQuery.offset.initialize(); + var top = body.offsetTop, left = body.offsetLeft; + if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) + top += parseInt( jQuery.curCSS(body, 'marginTop', true), 10 ) || 0, + left += parseInt( jQuery.curCSS(body, 'marginLeft', true), 10 ) || 0; + return { top: top, left: left }; + } +}; + + +jQuery.fn.extend({ + position: function() { + var left = 0, top = 0, results; + + if ( this[0] ) { + // Get *real* offsetParent + var offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = /^body|html$/i.test(offsetParent[0].tagName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= num( this, 'marginTop' ); + offset.left -= num( this, 'marginLeft' ); + + // Add offsetParent borders + parentOffset.top += num( offsetParent, 'borderTopWidth' ); + parentOffset.left += num( offsetParent, 'borderLeftWidth' ); + + // Subtract the two offsets + results = { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + } + + return results; + }, + + offsetParent: function() { + var offsetParent = this[0].offsetParent || document.body; + while ( offsetParent && (!/^body|html$/i.test(offsetParent.tagName) && jQuery.css(offsetParent, 'position') == 'static') ) + offsetParent = offsetParent.offsetParent; + return jQuery(offsetParent); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( ['Left', 'Top'], function(i, name) { + var method = 'scroll' + name; + + jQuery.fn[ method ] = function(val) { + if (!this[0]) return null; + + return val !== undefined ? + + // Set the scroll offset + this.each(function() { + this == window || this == document ? + window.scrollTo( + !i ? val : jQuery(window).scrollLeft(), + i ? val : jQuery(window).scrollTop() + ) : + this[ method ] = val; + }) : + + // Return the scroll offset + this[0] == window || this[0] == document ? + self[ i ? 'pageYOffset' : 'pageXOffset' ] || + jQuery.boxModel && document.documentElement[ method ] || + document.body[ method ] : + this[0][ method ]; + }; +}); +// Create innerHeight, innerWidth, outerHeight and outerWidth methods +jQuery.each([ "Height", "Width" ], function(i, name){ + + var tl = i ? "Left" : "Top", // top or left + br = i ? "Right" : "Bottom", // bottom or right + lower = name.toLowerCase(); + + // innerHeight and innerWidth + jQuery.fn["inner" + name] = function(){ + return this[0] ? + jQuery.css( this[0], lower, false, "padding" ) : + null; + }; + + // outerHeight and outerWidth + jQuery.fn["outer" + name] = function(margin) { + return this[0] ? + jQuery.css( this[0], lower, false, margin ? "margin" : "border" ) : + null; + }; + + var type = name.toLowerCase(); + + jQuery.fn[ type ] = function( size ) { + // Get window width or height + return this[0] == window ? + // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode + document.compatMode == "CSS1Compat" && document.documentElement[ "client" + name ] || + document.body[ "client" + name ] : + + // Get document width or height + this[0] == document ? + // Either scroll[Width/Height] or offset[Width/Height], whichever is greater + Math.max( + document.documentElement["client" + name], + document.body["scroll" + name], document.documentElement["scroll" + name], + document.body["offset" + name], document.documentElement["offset" + name] + ) : + + // Get or set width or height on the element + size === undefined ? + // Get width or height on the element + (this.length ? jQuery.css( this[0], type ) : null) : + + // Set the width or height on the element (default to pixels if value is unitless) + this.css( type, typeof size === "string" ? size : size + "px" ); + }; + +}); +})(); diff --git a/js/jquery-1.3.2.min.js b/js/jquery-1.3.2.min.js new file mode 100755 index 0000000..b1ae21d --- /dev/null +++ b/js/jquery-1.3.2.min.js @@ -0,0 +1,19 @@ +/* + * jQuery JavaScript Library v1.3.2 + * http://jquery.com/ + * + * Copyright (c) 2009 John Resig + * Dual licensed under the MIT and GPL licenses. + * http://docs.jquery.com/License + * + * Date: 2009-02-19 17:34:21 -0500 (Thu, 19 Feb 2009) + * Revision: 6246 + */ +(function(){var l=this,g,y=l.jQuery,p=l.$,o=l.jQuery=l.$=function(E,F){return new o.fn.init(E,F)},D=/^[^<]*(<(.|\s)+>)[^>]*$|^#([\w-]+)$/,f=/^.[^:#\[\.,]*$/;o.fn=o.prototype={init:function(E,H){E=E||document;if(E.nodeType){this[0]=E;this.length=1;this.context=E;return this}if(typeof E==="string"){var G=D.exec(E);if(G&&(G[1]||!H)){if(G[1]){E=o.clean([G[1]],H)}else{var I=document.getElementById(G[3]);if(I&&I.id!=G[3]){return o().find(E)}var F=o(I||[]);F.context=document;F.selector=E;return F}}else{return o(H).find(E)}}else{if(o.isFunction(E)){return o(document).ready(E)}}if(E.selector&&E.context){this.selector=E.selector;this.context=E.context}return this.setArray(o.isArray(E)?E:o.makeArray(E))},selector:"",jquery:"1.3.2",size:function(){return this.length},get:function(E){return E===g?Array.prototype.slice.call(this):this[E]},pushStack:function(F,H,E){var G=o(F);G.prevObject=this;G.context=this.context;if(H==="find"){G.selector=this.selector+(this.selector?" ":"")+E}else{if(H){G.selector=this.selector+"."+H+"("+E+")"}}return G},setArray:function(E){this.length=0;Array.prototype.push.apply(this,E);return this},each:function(F,E){return o.each(this,F,E)},index:function(E){return o.inArray(E&&E.jquery?E[0]:E,this)},attr:function(F,H,G){var E=F;if(typeof F==="string"){if(H===g){return this[0]&&o[G||"attr"](this[0],F)}else{E={};E[F]=H}}return this.each(function(I){for(F in E){o.attr(G?this.style:this,F,o.prop(this,E[F],G,I,F))}})},css:function(E,F){if((E=="width"||E=="height")&&parseFloat(F)<0){F=g}return this.attr(E,F,"curCSS")},text:function(F){if(typeof F!=="object"&&F!=null){return this.empty().append((this[0]&&this[0].ownerDocument||document).createTextNode(F))}var E="";o.each(F||this,function(){o.each(this.childNodes,function(){if(this.nodeType!=8){E+=this.nodeType!=1?this.nodeValue:o.fn.text([this])}})});return E},wrapAll:function(E){if(this[0]){var F=o(E,this[0].ownerDocument).clone();if(this[0].parentNode){F.insertBefore(this[0])}F.map(function(){var G=this;while(G.firstChild){G=G.firstChild}return G}).append(this)}return this},wrapInner:function(E){return this.each(function(){o(this).contents().wrapAll(E)})},wrap:function(E){return this.each(function(){o(this).wrapAll(E)})},append:function(){return this.domManip(arguments,true,function(E){if(this.nodeType==1){this.appendChild(E)}})},prepend:function(){return this.domManip(arguments,true,function(E){if(this.nodeType==1){this.insertBefore(E,this.firstChild)}})},before:function(){return this.domManip(arguments,false,function(E){this.parentNode.insertBefore(E,this)})},after:function(){return this.domManip(arguments,false,function(E){this.parentNode.insertBefore(E,this.nextSibling)})},end:function(){return this.prevObject||o([])},push:[].push,sort:[].sort,splice:[].splice,find:function(E){if(this.length===1){var F=this.pushStack([],"find",E);F.length=0;o.find(E,this[0],F);return F}else{return this.pushStack(o.unique(o.map(this,function(G){return o.find(E,G)})),"find",E)}},clone:function(G){var E=this.map(function(){if(!o.support.noCloneEvent&&!o.isXMLDoc(this)){var I=this.outerHTML;if(!I){var J=this.ownerDocument.createElement("div");J.appendChild(this.cloneNode(true));I=J.innerHTML}return o.clean([I.replace(/ jQuery\d+="(?:\d+|null)"/g,"").replace(/^\s*/,"")])[0]}else{return this.cloneNode(true)}});if(G===true){var H=this.find("*").andSelf(),F=0;E.find("*").andSelf().each(function(){if(this.nodeName!==H[F].nodeName){return}var I=o.data(H[F],"events");for(var K in I){for(var J in I[K]){o.event.add(this,K,I[K][J],I[K][J].data)}}F++})}return E},filter:function(E){return this.pushStack(o.isFunction(E)&&o.grep(this,function(G,F){return E.call(G,F)})||o.multiFilter(E,o.grep(this,function(F){return F.nodeType===1})),"filter",E)},closest:function(E){var G=o.expr.match.POS.test(E)?o(E):null,F=0;return this.map(function(){var H=this;while(H&&H.ownerDocument){if(G?G.index(H)>-1:o(H).is(E)){o.data(H,"closest",F);return H}H=H.parentNode;F++}})},not:function(E){if(typeof E==="string"){if(f.test(E)){return this.pushStack(o.multiFilter(E,this,true),"not",E)}else{E=o.multiFilter(E,this)}}var F=E.length&&E[E.length-1]!==g&&!E.nodeType;return this.filter(function(){return F?o.inArray(this,E)<0:this!=E})},add:function(E){return this.pushStack(o.unique(o.merge(this.get(),typeof E==="string"?o(E):o.makeArray(E))))},is:function(E){return !!E&&o.multiFilter(E,this).length>0},hasClass:function(E){return !!E&&this.is("."+E)},val:function(K){if(K===g){var E=this[0];if(E){if(o.nodeName(E,"option")){return(E.attributes.value||{}).specified?E.value:E.text}if(o.nodeName(E,"select")){var I=E.selectedIndex,L=[],M=E.options,H=E.type=="select-one";if(I<0){return null}for(var F=H?I:0,J=H?I+1:M.length;F<J;F++){var G=M[F];if(G.selected){K=o(G).val();if(H){return K}L.push(K)}}return L}return(E.value||"").replace(/\r/g,"")}return g}if(typeof K==="number"){K+=""}return this.each(function(){if(this.nodeType!=1){return}if(o.isArray(K)&&/radio|checkbox/.test(this.type)){this.checked=(o.inArray(this.value,K)>=0||o.inArray(this.name,K)>=0)}else{if(o.nodeName(this,"select")){var N=o.makeArray(K);o("option",this).each(function(){this.selected=(o.inArray(this.value,N)>=0||o.inArray(this.text,N)>=0)});if(!N.length){this.selectedIndex=-1}}else{this.value=K}}})},html:function(E){return E===g?(this[0]?this[0].innerHTML.replace(/ jQuery\d+="(?:\d+|null)"/g,""):null):this.empty().append(E)},replaceWith:function(E){return this.after(E).remove()},eq:function(E){return this.slice(E,+E+1)},slice:function(){return this.pushStack(Array.prototype.slice.apply(this,arguments),"slice",Array.prototype.slice.call(arguments).join(","))},map:function(E){return this.pushStack(o.map(this,function(G,F){return E.call(G,F,G)}))},andSelf:function(){return this.add(this.prevObject)},domManip:function(J,M,L){if(this[0]){var I=(this[0].ownerDocument||this[0]).createDocumentFragment(),F=o.clean(J,(this[0].ownerDocument||this[0]),I),H=I.firstChild;if(H){for(var G=0,E=this.length;G<E;G++){L.call(K(this[G],H),this.length>1||G>0?I.cloneNode(true):I)}}if(F){o.each(F,z)}}return this;function K(N,O){return M&&o.nodeName(N,"table")&&o.nodeName(O,"tr")?(N.getElementsByTagName("tbody")[0]||N.appendChild(N.ownerDocument.createElement("tbody"))):N}}};o.fn.init.prototype=o.fn;function z(E,F){if(F.src){o.ajax({url:F.src,async:false,dataType:"script"})}else{o.globalEval(F.text||F.textContent||F.innerHTML||"")}if(F.parentNode){F.parentNode.removeChild(F)}}function e(){return +new Date}o.extend=o.fn.extend=function(){var J=arguments[0]||{},H=1,I=arguments.length,E=false,G;if(typeof J==="boolean"){E=J;J=arguments[1]||{};H=2}if(typeof J!=="object"&&!o.isFunction(J)){J={}}if(I==H){J=this;--H}for(;H<I;H++){if((G=arguments[H])!=null){for(var F in G){var K=J[F],L=G[F];if(J===L){continue}if(E&&L&&typeof L==="object"&&!L.nodeType){J[F]=o.extend(E,K||(L.length!=null?[]:{}),L)}else{if(L!==g){J[F]=L}}}}}return J};var b=/z-?index|font-?weight|opacity|zoom|line-?height/i,q=document.defaultView||{},s=Object.prototype.toString;o.extend({noConflict:function(E){l.$=p;if(E){l.jQuery=y}return o},isFunction:function(E){return s.call(E)==="[object Function]"},isArray:function(E){return s.call(E)==="[object Array]"},isXMLDoc:function(E){return E.nodeType===9&&E.documentElement.nodeName!=="HTML"||!!E.ownerDocument&&o.isXMLDoc(E.ownerDocument)},globalEval:function(G){if(G&&/\S/.test(G)){var F=document.getElementsByTagName("head")[0]||document.documentElement,E=document.createElement("script");E.type="text/javascript";if(o.support.scriptEval){E.appendChild(document.createTextNode(G))}else{E.text=G}F.insertBefore(E,F.firstChild);F.removeChild(E)}},nodeName:function(F,E){return F.nodeName&&F.nodeName.toUpperCase()==E.toUpperCase()},each:function(G,K,F){var E,H=0,I=G.length;if(F){if(I===g){for(E in G){if(K.apply(G[E],F)===false){break}}}else{for(;H<I;){if(K.apply(G[H++],F)===false){break}}}}else{if(I===g){for(E in G){if(K.call(G[E],E,G[E])===false){break}}}else{for(var J=G[0];H<I&&K.call(J,H,J)!==false;J=G[++H]){}}}return G},prop:function(H,I,G,F,E){if(o.isFunction(I)){I=I.call(H,F)}return typeof I==="number"&&G=="curCSS"&&!b.test(E)?I+"px":I},className:{add:function(E,F){o.each((F||"").split(/\s+/),function(G,H){if(E.nodeType==1&&!o.className.has(E.className,H)){E.className+=(E.className?" ":"")+H}})},remove:function(E,F){if(E.nodeType==1){E.className=F!==g?o.grep(E.className.split(/\s+/),function(G){return !o.className.has(F,G)}).join(" "):""}},has:function(F,E){return F&&o.inArray(E,(F.className||F).toString().split(/\s+/))>-1}},swap:function(H,G,I){var E={};for(var F in G){E[F]=H.style[F];H.style[F]=G[F]}I.call(H);for(var F in G){H.style[F]=E[F]}},css:function(H,F,J,E){if(F=="width"||F=="height"){var L,G={position:"absolute",visibility:"hidden",display:"block"},K=F=="width"?["Left","Right"]:["Top","Bottom"];function I(){L=F=="width"?H.offsetWidth:H.offsetHeight;if(E==="border"){return}o.each(K,function(){if(!E){L-=parseFloat(o.curCSS(H,"padding"+this,true))||0}if(E==="margin"){L+=parseFloat(o.curCSS(H,"margin"+this,true))||0}else{L-=parseFloat(o.curCSS(H,"border"+this+"Width",true))||0}})}if(H.offsetWidth!==0){I()}else{o.swap(H,G,I)}return Math.max(0,Math.round(L))}return o.curCSS(H,F,J)},curCSS:function(I,F,G){var L,E=I.style;if(F=="opacity"&&!o.support.opacity){L=o.attr(E,"opacity");return L==""?"1":L}if(F.match(/float/i)){F=w}if(!G&&E&&E[F]){L=E[F]}else{if(q.getComputedStyle){if(F.match(/float/i)){F="float"}F=F.replace(/([A-Z])/g,"-$1").toLowerCase();var M=q.getComputedStyle(I,null);if(M){L=M.getPropertyValue(F)}if(F=="opacity"&&L==""){L="1"}}else{if(I.currentStyle){var J=F.replace(/\-(\w)/g,function(N,O){return O.toUpperCase()});L=I.currentStyle[F]||I.currentStyle[J];if(!/^\d+(px)?$/i.test(L)&&/^\d/.test(L)){var H=E.left,K=I.runtimeStyle.left;I.runtimeStyle.left=I.currentStyle.left;E.left=L||0;L=E.pixelLeft+"px";E.left=H;I.runtimeStyle.left=K}}}}return L},clean:function(F,K,I){K=K||document;if(typeof K.createElement==="undefined"){K=K.ownerDocument||K[0]&&K[0].ownerDocument||document}if(!I&&F.length===1&&typeof F[0]==="string"){var H=/^<(\w+)\s*\/?>$/.exec(F[0]);if(H){return[K.createElement(H[1])]}}var G=[],E=[],L=K.createElement("div");o.each(F,function(P,S){if(typeof S==="number"){S+=""}if(!S){return}if(typeof S==="string"){S=S.replace(/(<(\w+)[^>]*?)\/>/g,function(U,V,T){return T.match(/^(abbr|br|col|img|input|link|meta|param|hr|area|embed)$/i)?U:V+"></"+T+">"});var O=S.replace(/^\s+/,"").substring(0,10).toLowerCase();var Q=!O.indexOf("<opt")&&[1,"<select multiple='multiple'>","</select>"]||!O.indexOf("<leg")&&[1,"<fieldset>","</fieldset>"]||O.match(/^<(thead|tbody|tfoot|colg|cap)/)&&[1,"<table>","</table>"]||!O.indexOf("<tr")&&[2,"<table><tbody>","</tbody></table>"]||(!O.indexOf("<td")||!O.indexOf("<th"))&&[3,"<table><tbody><tr>","</tr></tbody></table>"]||!O.indexOf("<col")&&[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"]||!o.support.htmlSerialize&&[1,"div<div>","</div>"]||[0,"",""];L.innerHTML=Q[1]+S+Q[2];while(Q[0]--){L=L.lastChild}if(!o.support.tbody){var R=/<tbody/i.test(S),N=!O.indexOf("<table")&&!R?L.firstChild&&L.firstChild.childNodes:Q[1]=="<table>"&&!R?L.childNodes:[];for(var M=N.length-1;M>=0;--M){if(o.nodeName(N[M],"tbody")&&!N[M].childNodes.length){N[M].parentNode.removeChild(N[M])}}}if(!o.support.leadingWhitespace&&/^\s/.test(S)){L.insertBefore(K.createTextNode(S.match(/^\s*/)[0]),L.firstChild)}S=o.makeArray(L.childNodes)}if(S.nodeType){G.push(S)}else{G=o.merge(G,S)}});if(I){for(var J=0;G[J];J++){if(o.nodeName(G[J],"script")&&(!G[J].type||G[J].type.toLowerCase()==="text/javascript")){E.push(G[J].parentNode?G[J].parentNode.removeChild(G[J]):G[J])}else{if(G[J].nodeType===1){G.splice.apply(G,[J+1,0].concat(o.makeArray(G[J].getElementsByTagName("script"))))}I.appendChild(G[J])}}return E}return G},attr:function(J,G,K){if(!J||J.nodeType==3||J.nodeType==8){return g}var H=!o.isXMLDoc(J),L=K!==g;G=H&&o.props[G]||G;if(J.tagName){var F=/href|src|style/.test(G);if(G=="selected"&&J.parentNode){J.parentNode.selectedIndex}if(G in J&&H&&!F){if(L){if(G=="type"&&o.nodeName(J,"input")&&J.parentNode){throw"type property can't be changed"}J[G]=K}if(o.nodeName(J,"form")&&J.getAttributeNode(G)){return J.getAttributeNode(G).nodeValue}if(G=="tabIndex"){var I=J.getAttributeNode("tabIndex");return I&&I.specified?I.value:J.nodeName.match(/(button|input|object|select|textarea)/i)?0:J.nodeName.match(/^(a|area)$/i)&&J.href?0:g}return J[G]}if(!o.support.style&&H&&G=="style"){return o.attr(J.style,"cssText",K)}if(L){J.setAttribute(G,""+K)}var E=!o.support.hrefNormalized&&H&&F?J.getAttribute(G,2):J.getAttribute(G);return E===null?g:E}if(!o.support.opacity&&G=="opacity"){if(L){J.zoom=1;J.filter=(J.filter||"").replace(/alpha\([^)]*\)/,"")+(parseInt(K)+""=="NaN"?"":"alpha(opacity="+K*100+")")}return J.filter&&J.filter.indexOf("opacity=")>=0?(parseFloat(J.filter.match(/opacity=([^)]*)/)[1])/100)+"":""}G=G.replace(/-([a-z])/ig,function(M,N){return N.toUpperCase()});if(L){J[G]=K}return J[G]},trim:function(E){return(E||"").replace(/^\s+|\s+$/g,"")},makeArray:function(G){var E=[];if(G!=null){var F=G.length;if(F==null||typeof G==="string"||o.isFunction(G)||G.setInterval){E[0]=G}else{while(F){E[--F]=G[F]}}}return E},inArray:function(G,H){for(var E=0,F=H.length;E<F;E++){if(H[E]===G){return E}}return -1},merge:function(H,E){var F=0,G,I=H.length;if(!o.support.getAll){while((G=E[F++])!=null){if(G.nodeType!=8){H[I++]=G}}}else{while((G=E[F++])!=null){H[I++]=G}}return H},unique:function(K){var F=[],E={};try{for(var G=0,H=K.length;G<H;G++){var J=o.data(K[G]);if(!E[J]){E[J]=true;F.push(K[G])}}}catch(I){F=K}return F},grep:function(F,J,E){var G=[];for(var H=0,I=F.length;H<I;H++){if(!E!=!J(F[H],H)){G.push(F[H])}}return G},map:function(E,J){var F=[];for(var G=0,H=E.length;G<H;G++){var I=J(E[G],G);if(I!=null){F[F.length]=I}}return F.concat.apply([],F)}});var C=navigator.userAgent.toLowerCase();o.browser={version:(C.match(/.+(?:rv|it|ra|ie)[\/: ]([\d.]+)/)||[0,"0"])[1],safari:/webkit/.test(C),opera:/opera/.test(C),msie:/msie/.test(C)&&!/opera/.test(C),mozilla:/mozilla/.test(C)&&!/(compatible|webkit)/.test(C)};o.each({parent:function(E){return E.parentNode},parents:function(E){return o.dir(E,"parentNode")},next:function(E){return o.nth(E,2,"nextSibling")},prev:function(E){return o.nth(E,2,"previousSibling")},nextAll:function(E){return o.dir(E,"nextSibling")},prevAll:function(E){return o.dir(E,"previousSibling")},siblings:function(E){return o.sibling(E.parentNode.firstChild,E)},children:function(E){return o.sibling(E.firstChild)},contents:function(E){return o.nodeName(E,"iframe")?E.contentDocument||E.contentWindow.document:o.makeArray(E.childNodes)}},function(E,F){o.fn[E]=function(G){var H=o.map(this,F);if(G&&typeof G=="string"){H=o.multiFilter(G,H)}return this.pushStack(o.unique(H),E,G)}});o.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(E,F){o.fn[E]=function(G){var J=[],L=o(G);for(var K=0,H=L.length;K<H;K++){var I=(K>0?this.clone(true):this).get();o.fn[F].apply(o(L[K]),I);J=J.concat(I)}return this.pushStack(J,E,G)}});o.each({removeAttr:function(E){o.attr(this,E,"");if(this.nodeType==1){this.removeAttribute(E)}},addClass:function(E){o.className.add(this,E)},removeClass:function(E){o.className.remove(this,E)},toggleClass:function(F,E){if(typeof E!=="boolean"){E=!o.className.has(this,F)}o.className[E?"add":"remove"](this,F)},remove:function(E){if(!E||o.filter(E,[this]).length){o("*",this).add([this]).each(function(){o.event.remove(this);o.removeData(this)});if(this.parentNode){this.parentNode.removeChild(this)}}},empty:function(){o(this).children().remove();while(this.firstChild){this.removeChild(this.firstChild)}}},function(E,F){o.fn[E]=function(){return this.each(F,arguments)}});function j(E,F){return E[0]&&parseInt(o.curCSS(E[0],F,true),10)||0}var h="jQuery"+e(),v=0,A={};o.extend({cache:{},data:function(F,E,G){F=F==l?A:F;var H=F[h];if(!H){H=F[h]=++v}if(E&&!o.cache[H]){o.cache[H]={}}if(G!==g){o.cache[H][E]=G}return E?o.cache[H][E]:H},removeData:function(F,E){F=F==l?A:F;var H=F[h];if(E){if(o.cache[H]){delete o.cache[H][E];E="";for(E in o.cache[H]){break}if(!E){o.removeData(F)}}}else{try{delete F[h]}catch(G){if(F.removeAttribute){F.removeAttribute(h)}}delete o.cache[H]}},queue:function(F,E,H){if(F){E=(E||"fx")+"queue";var G=o.data(F,E);if(!G||o.isArray(H)){G=o.data(F,E,o.makeArray(H))}else{if(H){G.push(H)}}}return G},dequeue:function(H,G){var E=o.queue(H,G),F=E.shift();if(!G||G==="fx"){F=E[0]}if(F!==g){F.call(H)}}});o.fn.extend({data:function(E,G){var H=E.split(".");H[1]=H[1]?"."+H[1]:"";if(G===g){var F=this.triggerHandler("getData"+H[1]+"!",[H[0]]);if(F===g&&this.length){F=o.data(this[0],E)}return F===g&&H[1]?this.data(H[0]):F}else{return this.trigger("setData"+H[1]+"!",[H[0],G]).each(function(){o.data(this,E,G)})}},removeData:function(E){return this.each(function(){o.removeData(this,E)})},queue:function(E,F){if(typeof E!=="string"){F=E;E="fx"}if(F===g){return o.queue(this[0],E)}return this.each(function(){var G=o.queue(this,E,F);if(E=="fx"&&G.length==1){G[0].call(this)}})},dequeue:function(E){return this.each(function(){o.dequeue(this,E)})}}); +/* + * Sizzle CSS Selector Engine - v0.9.3 + * Copyright 2009, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){var R=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?/g,L=0,H=Object.prototype.toString;var F=function(Y,U,ab,ac){ab=ab||[];U=U||document;if(U.nodeType!==1&&U.nodeType!==9){return[]}if(!Y||typeof Y!=="string"){return ab}var Z=[],W,af,ai,T,ad,V,X=true;R.lastIndex=0;while((W=R.exec(Y))!==null){Z.push(W[1]);if(W[2]){V=RegExp.rightContext;break}}if(Z.length>1&&M.exec(Y)){if(Z.length===2&&I.relative[Z[0]]){af=J(Z[0]+Z[1],U)}else{af=I.relative[Z[0]]?[U]:F(Z.shift(),U);while(Z.length){Y=Z.shift();if(I.relative[Y]){Y+=Z.shift()}af=J(Y,af)}}}else{var ae=ac?{expr:Z.pop(),set:E(ac)}:F.find(Z.pop(),Z.length===1&&U.parentNode?U.parentNode:U,Q(U));af=F.filter(ae.expr,ae.set);if(Z.length>0){ai=E(af)}else{X=false}while(Z.length){var ah=Z.pop(),ag=ah;if(!I.relative[ah]){ah=""}else{ag=Z.pop()}if(ag==null){ag=U}I.relative[ah](ai,ag,Q(U))}}if(!ai){ai=af}if(!ai){throw"Syntax error, unrecognized expression: "+(ah||Y)}if(H.call(ai)==="[object Array]"){if(!X){ab.push.apply(ab,ai)}else{if(U.nodeType===1){for(var aa=0;ai[aa]!=null;aa++){if(ai[aa]&&(ai[aa]===true||ai[aa].nodeType===1&&K(U,ai[aa]))){ab.push(af[aa])}}}else{for(var aa=0;ai[aa]!=null;aa++){if(ai[aa]&&ai[aa].nodeType===1){ab.push(af[aa])}}}}}else{E(ai,ab)}if(V){F(V,U,ab,ac);if(G){hasDuplicate=false;ab.sort(G);if(hasDuplicate){for(var aa=1;aa<ab.length;aa++){if(ab[aa]===ab[aa-1]){ab.splice(aa--,1)}}}}}return ab};F.matches=function(T,U){return F(T,null,null,U)};F.find=function(aa,T,ab){var Z,X;if(!aa){return[]}for(var W=0,V=I.order.length;W<V;W++){var Y=I.order[W],X;if((X=I.match[Y].exec(aa))){var U=RegExp.leftContext;if(U.substr(U.length-1)!=="\\"){X[1]=(X[1]||"").replace(/\\/g,"");Z=I.find[Y](X,T,ab);if(Z!=null){aa=aa.replace(I.match[Y],"");break}}}}if(!Z){Z=T.getElementsByTagName("*")}return{set:Z,expr:aa}};F.filter=function(ad,ac,ag,W){var V=ad,ai=[],aa=ac,Y,T,Z=ac&&ac[0]&&Q(ac[0]);while(ad&&ac.length){for(var ab in I.filter){if((Y=I.match[ab].exec(ad))!=null){var U=I.filter[ab],ah,af;T=false;if(aa==ai){ai=[]}if(I.preFilter[ab]){Y=I.preFilter[ab](Y,aa,ag,ai,W,Z);if(!Y){T=ah=true}else{if(Y===true){continue}}}if(Y){for(var X=0;(af=aa[X])!=null;X++){if(af){ah=U(af,Y,X,aa);var ae=W^!!ah;if(ag&&ah!=null){if(ae){T=true}else{aa[X]=false}}else{if(ae){ai.push(af);T=true}}}}}if(ah!==g){if(!ag){aa=ai}ad=ad.replace(I.match[ab],"");if(!T){return[]}break}}}if(ad==V){if(T==null){throw"Syntax error, unrecognized expression: "+ad}else{break}}V=ad}return aa};var I=F.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF_-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF_-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF_-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF_-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*_-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF_-]|\\.)+)(?:\((['"]*)((?:\([^\)]+\)|[^\2\(\)]*)+)\2\))?/},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(T){return T.getAttribute("href")}},relative:{"+":function(aa,T,Z){var X=typeof T==="string",ab=X&&!/\W/.test(T),Y=X&&!ab;if(ab&&!Z){T=T.toUpperCase()}for(var W=0,V=aa.length,U;W<V;W++){if((U=aa[W])){while((U=U.previousSibling)&&U.nodeType!==1){}aa[W]=Y||U&&U.nodeName===T?U||false:U===T}}if(Y){F.filter(T,aa,true)}},">":function(Z,U,aa){var X=typeof U==="string";if(X&&!/\W/.test(U)){U=aa?U:U.toUpperCase();for(var V=0,T=Z.length;V<T;V++){var Y=Z[V];if(Y){var W=Y.parentNode;Z[V]=W.nodeName===U?W:false}}}else{for(var V=0,T=Z.length;V<T;V++){var Y=Z[V];if(Y){Z[V]=X?Y.parentNode:Y.parentNode===U}}if(X){F.filter(U,Z,true)}}},"":function(W,U,Y){var V=L++,T=S;if(!U.match(/\W/)){var X=U=Y?U:U.toUpperCase();T=P}T("parentNode",U,V,W,X,Y)},"~":function(W,U,Y){var V=L++,T=S;if(typeof U==="string"&&!U.match(/\W/)){var X=U=Y?U:U.toUpperCase();T=P}T("previousSibling",U,V,W,X,Y)}},find:{ID:function(U,V,W){if(typeof V.getElementById!=="undefined"&&!W){var T=V.getElementById(U[1]);return T?[T]:[]}},NAME:function(V,Y,Z){if(typeof Y.getElementsByName!=="undefined"){var U=[],X=Y.getElementsByName(V[1]);for(var W=0,T=X.length;W<T;W++){if(X[W].getAttribute("name")===V[1]){U.push(X[W])}}return U.length===0?null:U}},TAG:function(T,U){return U.getElementsByTagName(T[1])}},preFilter:{CLASS:function(W,U,V,T,Z,aa){W=" "+W[1].replace(/\\/g,"")+" ";if(aa){return W}for(var X=0,Y;(Y=U[X])!=null;X++){if(Y){if(Z^(Y.className&&(" "+Y.className+" ").indexOf(W)>=0)){if(!V){T.push(Y)}}else{if(V){U[X]=false}}}}return false},ID:function(T){return T[1].replace(/\\/g,"")},TAG:function(U,T){for(var V=0;T[V]===false;V++){}return T[V]&&Q(T[V])?U[1]:U[1].toUpperCase()},CHILD:function(T){if(T[1]=="nth"){var U=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(T[2]=="even"&&"2n"||T[2]=="odd"&&"2n+1"||!/\D/.test(T[2])&&"0n+"+T[2]||T[2]);T[2]=(U[1]+(U[2]||1))-0;T[3]=U[3]-0}T[0]=L++;return T},ATTR:function(X,U,V,T,Y,Z){var W=X[1].replace(/\\/g,"");if(!Z&&I.attrMap[W]){X[1]=I.attrMap[W]}if(X[2]==="~="){X[4]=" "+X[4]+" "}return X},PSEUDO:function(X,U,V,T,Y){if(X[1]==="not"){if(X[3].match(R).length>1||/^\w/.test(X[3])){X[3]=F(X[3],null,null,U)}else{var W=F.filter(X[3],U,V,true^Y);if(!V){T.push.apply(T,W)}return false}}else{if(I.match.POS.test(X[0])||I.match.CHILD.test(X[0])){return true}}return X},POS:function(T){T.unshift(true);return T}},filters:{enabled:function(T){return T.disabled===false&&T.type!=="hidden"},disabled:function(T){return T.disabled===true},checked:function(T){return T.checked===true},selected:function(T){T.parentNode.selectedIndex;return T.selected===true},parent:function(T){return !!T.firstChild},empty:function(T){return !T.firstChild},has:function(V,U,T){return !!F(T[3],V).length},header:function(T){return/h\d/i.test(T.nodeName)},text:function(T){return"text"===T.type},radio:function(T){return"radio"===T.type},checkbox:function(T){return"checkbox"===T.type},file:function(T){return"file"===T.type},password:function(T){return"password"===T.type},submit:function(T){return"submit"===T.type},image:function(T){return"image"===T.type},reset:function(T){return"reset"===T.type},button:function(T){return"button"===T.type||T.nodeName.toUpperCase()==="BUTTON"},input:function(T){return/input|select|textarea|button/i.test(T.nodeName)}},setFilters:{first:function(U,T){return T===0},last:function(V,U,T,W){return U===W.length-1},even:function(U,T){return T%2===0},odd:function(U,T){return T%2===1},lt:function(V,U,T){return U<T[3]-0},gt:function(V,U,T){return U>T[3]-0},nth:function(V,U,T){return T[3]-0==U},eq:function(V,U,T){return T[3]-0==U}},filter:{PSEUDO:function(Z,V,W,aa){var U=V[1],X=I.filters[U];if(X){return X(Z,W,V,aa)}else{if(U==="contains"){return(Z.textContent||Z.innerText||"").indexOf(V[3])>=0}else{if(U==="not"){var Y=V[3];for(var W=0,T=Y.length;W<T;W++){if(Y[W]===Z){return false}}return true}}}},CHILD:function(T,W){var Z=W[1],U=T;switch(Z){case"only":case"first":while(U=U.previousSibling){if(U.nodeType===1){return false}}if(Z=="first"){return true}U=T;case"last":while(U=U.nextSibling){if(U.nodeType===1){return false}}return true;case"nth":var V=W[2],ac=W[3];if(V==1&&ac==0){return true}var Y=W[0],ab=T.parentNode;if(ab&&(ab.sizcache!==Y||!T.nodeIndex)){var X=0;for(U=ab.firstChild;U;U=U.nextSibling){if(U.nodeType===1){U.nodeIndex=++X}}ab.sizcache=Y}var aa=T.nodeIndex-ac;if(V==0){return aa==0}else{return(aa%V==0&&aa/V>=0)}}},ID:function(U,T){return U.nodeType===1&&U.getAttribute("id")===T},TAG:function(U,T){return(T==="*"&&U.nodeType===1)||U.nodeName===T},CLASS:function(U,T){return(" "+(U.className||U.getAttribute("class"))+" ").indexOf(T)>-1},ATTR:function(Y,W){var V=W[1],T=I.attrHandle[V]?I.attrHandle[V](Y):Y[V]!=null?Y[V]:Y.getAttribute(V),Z=T+"",X=W[2],U=W[4];return T==null?X==="!=":X==="="?Z===U:X==="*="?Z.indexOf(U)>=0:X==="~="?(" "+Z+" ").indexOf(U)>=0:!U?Z&&T!==false:X==="!="?Z!=U:X==="^="?Z.indexOf(U)===0:X==="$="?Z.substr(Z.length-U.length)===U:X==="|="?Z===U||Z.substr(0,U.length+1)===U+"-":false},POS:function(X,U,V,Y){var T=U[2],W=I.setFilters[T];if(W){return W(X,V,U,Y)}}}};var M=I.match.POS;for(var O in I.match){I.match[O]=RegExp(I.match[O].source+/(?![^\[]*\])(?![^\(]*\))/.source)}var E=function(U,T){U=Array.prototype.slice.call(U);if(T){T.push.apply(T,U);return T}return U};try{Array.prototype.slice.call(document.documentElement.childNodes)}catch(N){E=function(X,W){var U=W||[];if(H.call(X)==="[object Array]"){Array.prototype.push.apply(U,X)}else{if(typeof X.length==="number"){for(var V=0,T=X.length;V<T;V++){U.push(X[V])}}else{for(var V=0;X[V];V++){U.push(X[V])}}}return U}}var G;if(document.documentElement.compareDocumentPosition){G=function(U,T){var V=U.compareDocumentPosition(T)&4?-1:U===T?0:1;if(V===0){hasDuplicate=true}return V}}else{if("sourceIndex" in document.documentElement){G=function(U,T){var V=U.sourceIndex-T.sourceIndex;if(V===0){hasDuplicate=true}return V}}else{if(document.createRange){G=function(W,U){var V=W.ownerDocument.createRange(),T=U.ownerDocument.createRange();V.selectNode(W);V.collapse(true);T.selectNode(U);T.collapse(true);var X=V.compareBoundaryPoints(Range.START_TO_END,T);if(X===0){hasDuplicate=true}return X}}}}(function(){var U=document.createElement("form"),V="script"+(new Date).getTime();U.innerHTML="<input name='"+V+"'/>";var T=document.documentElement;T.insertBefore(U,T.firstChild);if(!!document.getElementById(V)){I.find.ID=function(X,Y,Z){if(typeof Y.getElementById!=="undefined"&&!Z){var W=Y.getElementById(X[1]);return W?W.id===X[1]||typeof W.getAttributeNode!=="undefined"&&W.getAttributeNode("id").nodeValue===X[1]?[W]:g:[]}};I.filter.ID=function(Y,W){var X=typeof Y.getAttributeNode!=="undefined"&&Y.getAttributeNode("id");return Y.nodeType===1&&X&&X.nodeValue===W}}T.removeChild(U)})();(function(){var T=document.createElement("div");T.appendChild(document.createComment(""));if(T.getElementsByTagName("*").length>0){I.find.TAG=function(U,Y){var X=Y.getElementsByTagName(U[1]);if(U[1]==="*"){var W=[];for(var V=0;X[V];V++){if(X[V].nodeType===1){W.push(X[V])}}X=W}return X}}T.innerHTML="<a href='#'></a>";if(T.firstChild&&typeof T.firstChild.getAttribute!=="undefined"&&T.firstChild.getAttribute("href")!=="#"){I.attrHandle.href=function(U){return U.getAttribute("href",2)}}})();if(document.querySelectorAll){(function(){var T=F,U=document.createElement("div");U.innerHTML="<p class='TEST'></p>";if(U.querySelectorAll&&U.querySelectorAll(".TEST").length===0){return}F=function(Y,X,V,W){X=X||document;if(!W&&X.nodeType===9&&!Q(X)){try{return E(X.querySelectorAll(Y),V)}catch(Z){}}return T(Y,X,V,W)};F.find=T.find;F.filter=T.filter;F.selectors=T.selectors;F.matches=T.matches})()}if(document.getElementsByClassName&&document.documentElement.getElementsByClassName){(function(){var T=document.createElement("div");T.innerHTML="<div class='test e'></div><div class='test'></div>";if(T.getElementsByClassName("e").length===0){return}T.lastChild.className="e";if(T.getElementsByClassName("e").length===1){return}I.order.splice(1,0,"CLASS");I.find.CLASS=function(U,V,W){if(typeof V.getElementsByClassName!=="undefined"&&!W){return V.getElementsByClassName(U[1])}}})()}function P(U,Z,Y,ad,aa,ac){var ab=U=="previousSibling"&&!ac;for(var W=0,V=ad.length;W<V;W++){var T=ad[W];if(T){if(ab&&T.nodeType===1){T.sizcache=Y;T.sizset=W}T=T[U];var X=false;while(T){if(T.sizcache===Y){X=ad[T.sizset];break}if(T.nodeType===1&&!ac){T.sizcache=Y;T.sizset=W}if(T.nodeName===Z){X=T;break}T=T[U]}ad[W]=X}}}function S(U,Z,Y,ad,aa,ac){var ab=U=="previousSibling"&&!ac;for(var W=0,V=ad.length;W<V;W++){var T=ad[W];if(T){if(ab&&T.nodeType===1){T.sizcache=Y;T.sizset=W}T=T[U];var X=false;while(T){if(T.sizcache===Y){X=ad[T.sizset];break}if(T.nodeType===1){if(!ac){T.sizcache=Y;T.sizset=W}if(typeof Z!=="string"){if(T===Z){X=true;break}}else{if(F.filter(Z,[T]).length>0){X=T;break}}}T=T[U]}ad[W]=X}}}var K=document.compareDocumentPosition?function(U,T){return U.compareDocumentPosition(T)&16}:function(U,T){return U!==T&&(U.contains?U.contains(T):true)};var Q=function(T){return T.nodeType===9&&T.documentElement.nodeName!=="HTML"||!!T.ownerDocument&&Q(T.ownerDocument)};var J=function(T,aa){var W=[],X="",Y,V=aa.nodeType?[aa]:aa;while((Y=I.match.PSEUDO.exec(T))){X+=Y[0];T=T.replace(I.match.PSEUDO,"")}T=I.relative[T]?T+"*":T;for(var Z=0,U=V.length;Z<U;Z++){F(T,V[Z],W)}return F.filter(X,W)};o.find=F;o.filter=F.filter;o.expr=F.selectors;o.expr[":"]=o.expr.filters;F.selectors.filters.hidden=function(T){return T.offsetWidth===0||T.offsetHeight===0};F.selectors.filters.visible=function(T){return T.offsetWidth>0||T.offsetHeight>0};F.selectors.filters.animated=function(T){return o.grep(o.timers,function(U){return T===U.elem}).length};o.multiFilter=function(V,T,U){if(U){V=":not("+V+")"}return F.matches(V,T)};o.dir=function(V,U){var T=[],W=V[U];while(W&&W!=document){if(W.nodeType==1){T.push(W)}W=W[U]}return T};o.nth=function(X,T,V,W){T=T||1;var U=0;for(;X;X=X[V]){if(X.nodeType==1&&++U==T){break}}return X};o.sibling=function(V,U){var T=[];for(;V;V=V.nextSibling){if(V.nodeType==1&&V!=U){T.push(V)}}return T};return;l.Sizzle=F})();o.event={add:function(I,F,H,K){if(I.nodeType==3||I.nodeType==8){return}if(I.setInterval&&I!=l){I=l}if(!H.guid){H.guid=this.guid++}if(K!==g){var G=H;H=this.proxy(G);H.data=K}var E=o.data(I,"events")||o.data(I,"events",{}),J=o.data(I,"handle")||o.data(I,"handle",function(){return typeof o!=="undefined"&&!o.event.triggered?o.event.handle.apply(arguments.callee.elem,arguments):g});J.elem=I;o.each(F.split(/\s+/),function(M,N){var O=N.split(".");N=O.shift();H.type=O.slice().sort().join(".");var L=E[N];if(o.event.specialAll[N]){o.event.specialAll[N].setup.call(I,K,O)}if(!L){L=E[N]={};if(!o.event.special[N]||o.event.special[N].setup.call(I,K,O)===false){if(I.addEventListener){I.addEventListener(N,J,false)}else{if(I.attachEvent){I.attachEvent("on"+N,J)}}}}L[H.guid]=H;o.event.global[N]=true});I=null},guid:1,global:{},remove:function(K,H,J){if(K.nodeType==3||K.nodeType==8){return}var G=o.data(K,"events"),F,E;if(G){if(H===g||(typeof H==="string"&&H.charAt(0)==".")){for(var I in G){this.remove(K,I+(H||""))}}else{if(H.type){J=H.handler;H=H.type}o.each(H.split(/\s+/),function(M,O){var Q=O.split(".");O=Q.shift();var N=RegExp("(^|\\.)"+Q.slice().sort().join(".*\\.")+"(\\.|$)");if(G[O]){if(J){delete G[O][J.guid]}else{for(var P in G[O]){if(N.test(G[O][P].type)){delete G[O][P]}}}if(o.event.specialAll[O]){o.event.specialAll[O].teardown.call(K,Q)}for(F in G[O]){break}if(!F){if(!o.event.special[O]||o.event.special[O].teardown.call(K,Q)===false){if(K.removeEventListener){K.removeEventListener(O,o.data(K,"handle"),false)}else{if(K.detachEvent){K.detachEvent("on"+O,o.data(K,"handle"))}}}F=null;delete G[O]}}})}for(F in G){break}if(!F){var L=o.data(K,"handle");if(L){L.elem=null}o.removeData(K,"events");o.removeData(K,"handle")}}},trigger:function(I,K,H,E){var G=I.type||I;if(!E){I=typeof I==="object"?I[h]?I:o.extend(o.Event(G),I):o.Event(G);if(G.indexOf("!")>=0){I.type=G=G.slice(0,-1);I.exclusive=true}if(!H){I.stopPropagation();if(this.global[G]){o.each(o.cache,function(){if(this.events&&this.events[G]){o.event.trigger(I,K,this.handle.elem)}})}}if(!H||H.nodeType==3||H.nodeType==8){return g}I.result=g;I.target=H;K=o.makeArray(K);K.unshift(I)}I.currentTarget=H;var J=o.data(H,"handle");if(J){J.apply(H,K)}if((!H[G]||(o.nodeName(H,"a")&&G=="click"))&&H["on"+G]&&H["on"+G].apply(H,K)===false){I.result=false}if(!E&&H[G]&&!I.isDefaultPrevented()&&!(o.nodeName(H,"a")&&G=="click")){this.triggered=true;try{H[G]()}catch(L){}}this.triggered=false;if(!I.isPropagationStopped()){var F=H.parentNode||H.ownerDocument;if(F){o.event.trigger(I,K,F,true)}}},handle:function(K){var J,E;K=arguments[0]=o.event.fix(K||l.event);K.currentTarget=this;var L=K.type.split(".");K.type=L.shift();J=!L.length&&!K.exclusive;var I=RegExp("(^|\\.)"+L.slice().sort().join(".*\\.")+"(\\.|$)");E=(o.data(this,"events")||{})[K.type];for(var G in E){var H=E[G];if(J||I.test(H.type)){K.handler=H;K.data=H.data;var F=H.apply(this,arguments);if(F!==g){K.result=F;if(F===false){K.preventDefault();K.stopPropagation()}}if(K.isImmediatePropagationStopped()){break}}}},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode metaKey newValue originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(H){if(H[h]){return H}var F=H;H=o.Event(F);for(var G=this.props.length,J;G;){J=this.props[--G];H[J]=F[J]}if(!H.target){H.target=H.srcElement||document}if(H.target.nodeType==3){H.target=H.target.parentNode}if(!H.relatedTarget&&H.fromElement){H.relatedTarget=H.fromElement==H.target?H.toElement:H.fromElement}if(H.pageX==null&&H.clientX!=null){var I=document.documentElement,E=document.body;H.pageX=H.clientX+(I&&I.scrollLeft||E&&E.scrollLeft||0)-(I.clientLeft||0);H.pageY=H.clientY+(I&&I.scrollTop||E&&E.scrollTop||0)-(I.clientTop||0)}if(!H.which&&((H.charCode||H.charCode===0)?H.charCode:H.keyCode)){H.which=H.charCode||H.keyCode}if(!H.metaKey&&H.ctrlKey){H.metaKey=H.ctrlKey}if(!H.which&&H.button){H.which=(H.button&1?1:(H.button&2?3:(H.button&4?2:0)))}return H},proxy:function(F,E){E=E||function(){return F.apply(this,arguments)};E.guid=F.guid=F.guid||E.guid||this.guid++;return E},special:{ready:{setup:B,teardown:function(){}}},specialAll:{live:{setup:function(E,F){o.event.add(this,F[0],c)},teardown:function(G){if(G.length){var E=0,F=RegExp("(^|\\.)"+G[0]+"(\\.|$)");o.each((o.data(this,"events").live||{}),function(){if(F.test(this.type)){E++}});if(E<1){o.event.remove(this,G[0],c)}}}}}};o.Event=function(E){if(!this.preventDefault){return new o.Event(E)}if(E&&E.type){this.originalEvent=E;this.type=E.type}else{this.type=E}this.timeStamp=e();this[h]=true};function k(){return false}function u(){return true}o.Event.prototype={preventDefault:function(){this.isDefaultPrevented=u;var E=this.originalEvent;if(!E){return}if(E.preventDefault){E.preventDefault()}E.returnValue=false},stopPropagation:function(){this.isPropagationStopped=u;var E=this.originalEvent;if(!E){return}if(E.stopPropagation){E.stopPropagation()}E.cancelBubble=true},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=u;this.stopPropagation()},isDefaultPrevented:k,isPropagationStopped:k,isImmediatePropagationStopped:k};var a=function(F){var E=F.relatedTarget;while(E&&E!=this){try{E=E.parentNode}catch(G){E=this}}if(E!=this){F.type=F.data;o.event.handle.apply(this,arguments)}};o.each({mouseover:"mouseenter",mouseout:"mouseleave"},function(F,E){o.event.special[E]={setup:function(){o.event.add(this,F,a,E)},teardown:function(){o.event.remove(this,F,a)}}});o.fn.extend({bind:function(F,G,E){return F=="unload"?this.one(F,G,E):this.each(function(){o.event.add(this,F,E||G,E&&G)})},one:function(G,H,F){var E=o.event.proxy(F||H,function(I){o(this).unbind(I,E);return(F||H).apply(this,arguments)});return this.each(function(){o.event.add(this,G,E,F&&H)})},unbind:function(F,E){return this.each(function(){o.event.remove(this,F,E)})},trigger:function(E,F){return this.each(function(){o.event.trigger(E,F,this)})},triggerHandler:function(E,G){if(this[0]){var F=o.Event(E);F.preventDefault();F.stopPropagation();o.event.trigger(F,G,this[0]);return F.result}},toggle:function(G){var E=arguments,F=1;while(F<E.length){o.event.proxy(G,E[F++])}return this.click(o.event.proxy(G,function(H){this.lastToggle=(this.lastToggle||0)%F;H.preventDefault();return E[this.lastToggle++].apply(this,arguments)||false}))},hover:function(E,F){return this.mouseenter(E).mouseleave(F)},ready:function(E){B();if(o.isReady){E.call(document,o)}else{o.readyList.push(E)}return this},live:function(G,F){var E=o.event.proxy(F);E.guid+=this.selector+G;o(document).bind(i(G,this.selector),this.selector,E);return this},die:function(F,E){o(document).unbind(i(F,this.selector),E?{guid:E.guid+this.selector+F}:null);return this}});function c(H){var E=RegExp("(^|\\.)"+H.type+"(\\.|$)"),G=true,F=[];o.each(o.data(this,"events").live||[],function(I,J){if(E.test(J.type)){var K=o(H.target).closest(J.data)[0];if(K){F.push({elem:K,fn:J})}}});F.sort(function(J,I){return o.data(J.elem,"closest")-o.data(I.elem,"closest")});o.each(F,function(){if(this.fn.call(this.elem,H,this.fn.data)===false){return(G=false)}});return G}function i(F,E){return["live",F,E.replace(/\./g,"`").replace(/ /g,"|")].join(".")}o.extend({isReady:false,readyList:[],ready:function(){if(!o.isReady){o.isReady=true;if(o.readyList){o.each(o.readyList,function(){this.call(document,o)});o.readyList=null}o(document).triggerHandler("ready")}}});var x=false;function B(){if(x){return}x=true;if(document.addEventListener){document.addEventListener("DOMContentLoaded",function(){document.removeEventListener("DOMContentLoaded",arguments.callee,false);o.ready()},false)}else{if(document.attachEvent){document.attachEvent("onreadystatechange",function(){if(document.readyState==="complete"){document.detachEvent("onreadystatechange",arguments.callee);o.ready()}});if(document.documentElement.doScroll&&l==l.top){(function(){if(o.isReady){return}try{document.documentElement.doScroll("left")}catch(E){setTimeout(arguments.callee,0);return}o.ready()})()}}}o.event.add(l,"load",o.ready)}o.each(("blur,focus,load,resize,scroll,unload,click,dblclick,mousedown,mouseup,mousemove,mouseover,mouseout,mouseenter,mouseleave,change,select,submit,keydown,keypress,keyup,error").split(","),function(F,E){o.fn[E]=function(G){return G?this.bind(E,G):this.trigger(E)}});o(l).bind("unload",function(){for(var E in o.cache){if(E!=1&&o.cache[E].handle){o.event.remove(o.cache[E].handle.elem)}}});(function(){o.support={};var F=document.documentElement,G=document.createElement("script"),K=document.createElement("div"),J="script"+(new Date).getTime();K.style.display="none";K.innerHTML=' <link/><table></table><a href="/a" style="color:red;float:left;opacity:.5;">a</a><select><option>text</option></select><object><param/></object>';var H=K.getElementsByTagName("*"),E=K.getElementsByTagName("a")[0];if(!H||!H.length||!E){return}o.support={leadingWhitespace:K.firstChild.nodeType==3,tbody:!K.getElementsByTagName("tbody").length,objectAll:!!K.getElementsByTagName("object")[0].getElementsByTagName("*").length,htmlSerialize:!!K.getElementsByTagName("link").length,style:/red/.test(E.getAttribute("style")),hrefNormalized:E.getAttribute("href")==="/a",opacity:E.style.opacity==="0.5",cssFloat:!!E.style.cssFloat,scriptEval:false,noCloneEvent:true,boxModel:null};G.type="text/javascript";try{G.appendChild(document.createTextNode("window."+J+"=1;"))}catch(I){}F.insertBefore(G,F.firstChild);if(l[J]){o.support.scriptEval=true;delete l[J]}F.removeChild(G);if(K.attachEvent&&K.fireEvent){K.attachEvent("onclick",function(){o.support.noCloneEvent=false;K.detachEvent("onclick",arguments.callee)});K.cloneNode(true).fireEvent("onclick")}o(function(){var L=document.createElement("div");L.style.width=L.style.paddingLeft="1px";document.body.appendChild(L);o.boxModel=o.support.boxModel=L.offsetWidth===2;document.body.removeChild(L).style.display="none"})})();var w=o.support.cssFloat?"cssFloat":"styleFloat";o.props={"for":"htmlFor","class":"className","float":w,cssFloat:w,styleFloat:w,readonly:"readOnly",maxlength:"maxLength",cellspacing:"cellSpacing",rowspan:"rowSpan",tabindex:"tabIndex"};o.fn.extend({_load:o.fn.load,load:function(G,J,K){if(typeof G!=="string"){return this._load(G)}var I=G.indexOf(" ");if(I>=0){var E=G.slice(I,G.length);G=G.slice(0,I)}var H="GET";if(J){if(o.isFunction(J)){K=J;J=null}else{if(typeof J==="object"){J=o.param(J);H="POST"}}}var F=this;o.ajax({url:G,type:H,dataType:"html",data:J,complete:function(M,L){if(L=="success"||L=="notmodified"){F.html(E?o("<div/>").append(M.responseText.replace(/<script(.|\s)*?\/script>/g,"")).find(E):M.responseText)}if(K){F.each(K,[M.responseText,L,M])}}});return this},serialize:function(){return o.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?o.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||/select|textarea/i.test(this.nodeName)||/text|hidden|password|search/i.test(this.type))}).map(function(E,F){var G=o(this).val();return G==null?null:o.isArray(G)?o.map(G,function(I,H){return{name:F.name,value:I}}):{name:F.name,value:G}}).get()}});o.each("ajaxStart,ajaxStop,ajaxComplete,ajaxError,ajaxSuccess,ajaxSend".split(","),function(E,F){o.fn[F]=function(G){return this.bind(F,G)}});var r=e();o.extend({get:function(E,G,H,F){if(o.isFunction(G)){H=G;G=null}return o.ajax({type:"GET",url:E,data:G,success:H,dataType:F})},getScript:function(E,F){return o.get(E,null,F,"script")},getJSON:function(E,F,G){return o.get(E,F,G,"json")},post:function(E,G,H,F){if(o.isFunction(G)){H=G;G={}}return o.ajax({type:"POST",url:E,data:G,success:H,dataType:F})},ajaxSetup:function(E){o.extend(o.ajaxSettings,E)},ajaxSettings:{url:location.href,global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,xhr:function(){return l.ActiveXObject?new ActiveXObject("Microsoft.XMLHTTP"):new XMLHttpRequest()},accepts:{xml:"application/xml, text/xml",html:"text/html",script:"text/javascript, application/javascript",json:"application/json, text/javascript",text:"text/plain",_default:"*/*"}},lastModified:{},ajax:function(M){M=o.extend(true,M,o.extend(true,{},o.ajaxSettings,M));var W,F=/=\?(&|$)/g,R,V,G=M.type.toUpperCase();if(M.data&&M.processData&&typeof M.data!=="string"){M.data=o.param(M.data)}if(M.dataType=="jsonp"){if(G=="GET"){if(!M.url.match(F)){M.url+=(M.url.match(/\?/)?"&":"?")+(M.jsonp||"callback")+"=?"}}else{if(!M.data||!M.data.match(F)){M.data=(M.data?M.data+"&":"")+(M.jsonp||"callback")+"=?"}}M.dataType="json"}if(M.dataType=="json"&&(M.data&&M.data.match(F)||M.url.match(F))){W="jsonp"+r++;if(M.data){M.data=(M.data+"").replace(F,"="+W+"$1")}M.url=M.url.replace(F,"="+W+"$1");M.dataType="script";l[W]=function(X){V=X;I();L();l[W]=g;try{delete l[W]}catch(Y){}if(H){H.removeChild(T)}}}if(M.dataType=="script"&&M.cache==null){M.cache=false}if(M.cache===false&&G=="GET"){var E=e();var U=M.url.replace(/(\?|&)_=.*?(&|$)/,"$1_="+E+"$2");M.url=U+((U==M.url)?(M.url.match(/\?/)?"&":"?")+"_="+E:"")}if(M.data&&G=="GET"){M.url+=(M.url.match(/\?/)?"&":"?")+M.data;M.data=null}if(M.global&&!o.active++){o.event.trigger("ajaxStart")}var Q=/^(\w+:)?\/\/([^\/?#]+)/.exec(M.url);if(M.dataType=="script"&&G=="GET"&&Q&&(Q[1]&&Q[1]!=location.protocol||Q[2]!=location.host)){var H=document.getElementsByTagName("head")[0];var T=document.createElement("script");T.src=M.url;if(M.scriptCharset){T.charset=M.scriptCharset}if(!W){var O=false;T.onload=T.onreadystatechange=function(){if(!O&&(!this.readyState||this.readyState=="loaded"||this.readyState=="complete")){O=true;I();L();T.onload=T.onreadystatechange=null;H.removeChild(T)}}}H.appendChild(T);return g}var K=false;var J=M.xhr();if(M.username){J.open(G,M.url,M.async,M.username,M.password)}else{J.open(G,M.url,M.async)}try{if(M.data){J.setRequestHeader("Content-Type",M.contentType)}if(M.ifModified){J.setRequestHeader("If-Modified-Since",o.lastModified[M.url]||"Thu, 01 Jan 1970 00:00:00 GMT")}J.setRequestHeader("X-Requested-With","XMLHttpRequest");J.setRequestHeader("Accept",M.dataType&&M.accepts[M.dataType]?M.accepts[M.dataType]+", */*":M.accepts._default)}catch(S){}if(M.beforeSend&&M.beforeSend(J,M)===false){if(M.global&&!--o.active){o.event.trigger("ajaxStop")}J.abort();return false}if(M.global){o.event.trigger("ajaxSend",[J,M])}var N=function(X){if(J.readyState==0){if(P){clearInterval(P);P=null;if(M.global&&!--o.active){o.event.trigger("ajaxStop")}}}else{if(!K&&J&&(J.readyState==4||X=="timeout")){K=true;if(P){clearInterval(P);P=null}R=X=="timeout"?"timeout":!o.httpSuccess(J)?"error":M.ifModified&&o.httpNotModified(J,M.url)?"notmodified":"success";if(R=="success"){try{V=o.httpData(J,M.dataType,M)}catch(Z){R="parsererror"}}if(R=="success"){var Y;try{Y=J.getResponseHeader("Last-Modified")}catch(Z){}if(M.ifModified&&Y){o.lastModified[M.url]=Y}if(!W){I()}}else{o.handleError(M,J,R)}L();if(X){J.abort()}if(M.async){J=null}}}};if(M.async){var P=setInterval(N,13);if(M.timeout>0){setTimeout(function(){if(J&&!K){N("timeout")}},M.timeout)}}try{J.send(M.data)}catch(S){o.handleError(M,J,null,S)}if(!M.async){N()}function I(){if(M.success){M.success(V,R)}if(M.global){o.event.trigger("ajaxSuccess",[J,M])}}function L(){if(M.complete){M.complete(J,R)}if(M.global){o.event.trigger("ajaxComplete",[J,M])}if(M.global&&!--o.active){o.event.trigger("ajaxStop")}}return J},handleError:function(F,H,E,G){if(F.error){F.error(H,E,G)}if(F.global){o.event.trigger("ajaxError",[H,F,G])}},active:0,httpSuccess:function(F){try{return !F.status&&location.protocol=="file:"||(F.status>=200&&F.status<300)||F.status==304||F.status==1223}catch(E){}return false},httpNotModified:function(G,E){try{var H=G.getResponseHeader("Last-Modified");return G.status==304||H==o.lastModified[E]}catch(F){}return false},httpData:function(J,H,G){var F=J.getResponseHeader("content-type"),E=H=="xml"||!H&&F&&F.indexOf("xml")>=0,I=E?J.responseXML:J.responseText;if(E&&I.documentElement.tagName=="parsererror"){throw"parsererror"}if(G&&G.dataFilter){I=G.dataFilter(I,H)}if(typeof I==="string"){if(H=="script"){o.globalEval(I)}if(H=="json"){I=l["eval"]("("+I+")")}}return I},param:function(E){var G=[];function H(I,J){G[G.length]=encodeURIComponent(I)+"="+encodeURIComponent(J)}if(o.isArray(E)||E.jquery){o.each(E,function(){H(this.name,this.value)})}else{for(var F in E){if(o.isArray(E[F])){o.each(E[F],function(){H(F,this)})}else{H(F,o.isFunction(E[F])?E[F]():E[F])}}}return G.join("&").replace(/%20/g,"+")}});var m={},n,d=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];function t(F,E){var G={};o.each(d.concat.apply([],d.slice(0,E)),function(){G[this]=F});return G}o.fn.extend({show:function(J,L){if(J){return this.animate(t("show",3),J,L)}else{for(var H=0,F=this.length;H<F;H++){var E=o.data(this[H],"olddisplay");this[H].style.display=E||"";if(o.css(this[H],"display")==="none"){var G=this[H].tagName,K;if(m[G]){K=m[G]}else{var I=o("<"+G+" />").appendTo("body");K=I.css("display");if(K==="none"){K="block"}I.remove();m[G]=K}o.data(this[H],"olddisplay",K)}}for(var H=0,F=this.length;H<F;H++){this[H].style.display=o.data(this[H],"olddisplay")||""}return this}},hide:function(H,I){if(H){return this.animate(t("hide",3),H,I)}else{for(var G=0,F=this.length;G<F;G++){var E=o.data(this[G],"olddisplay");if(!E&&E!=="none"){o.data(this[G],"olddisplay",o.css(this[G],"display"))}}for(var G=0,F=this.length;G<F;G++){this[G].style.display="none"}return this}},_toggle:o.fn.toggle,toggle:function(G,F){var E=typeof G==="boolean";return o.isFunction(G)&&o.isFunction(F)?this._toggle.apply(this,arguments):G==null||E?this.each(function(){var H=E?G:o(this).is(":hidden");o(this)[H?"show":"hide"]()}):this.animate(t("toggle",3),G,F)},fadeTo:function(E,G,F){return this.animate({opacity:G},E,F)},animate:function(I,F,H,G){var E=o.speed(F,H,G);return this[E.queue===false?"each":"queue"](function(){var K=o.extend({},E),M,L=this.nodeType==1&&o(this).is(":hidden"),J=this;for(M in I){if(I[M]=="hide"&&L||I[M]=="show"&&!L){return K.complete.call(this)}if((M=="height"||M=="width")&&this.style){K.display=o.css(this,"display");K.overflow=this.style.overflow}}if(K.overflow!=null){this.style.overflow="hidden"}K.curAnim=o.extend({},I);o.each(I,function(O,S){var R=new o.fx(J,K,O);if(/toggle|show|hide/.test(S)){R[S=="toggle"?L?"show":"hide":S](I)}else{var Q=S.toString().match(/^([+-]=)?([\d+-.]+)(.*)$/),T=R.cur(true)||0;if(Q){var N=parseFloat(Q[2]),P=Q[3]||"px";if(P!="px"){J.style[O]=(N||1)+P;T=((N||1)/R.cur(true))*T;J.style[O]=T+P}if(Q[1]){N=((Q[1]=="-="?-1:1)*N)+T}R.custom(T,N,P)}else{R.custom(T,S,"")}}});return true})},stop:function(F,E){var G=o.timers;if(F){this.queue([])}this.each(function(){for(var H=G.length-1;H>=0;H--){if(G[H].elem==this){if(E){G[H](true)}G.splice(H,1)}}});if(!E){this.dequeue()}return this}});o.each({slideDown:t("show",1),slideUp:t("hide",1),slideToggle:t("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"}},function(E,F){o.fn[E]=function(G,H){return this.animate(F,G,H)}});o.extend({speed:function(G,H,F){var E=typeof G==="object"?G:{complete:F||!F&&H||o.isFunction(G)&&G,duration:G,easing:F&&H||H&&!o.isFunction(H)&&H};E.duration=o.fx.off?0:typeof E.duration==="number"?E.duration:o.fx.speeds[E.duration]||o.fx.speeds._default;E.old=E.complete;E.complete=function(){if(E.queue!==false){o(this).dequeue()}if(o.isFunction(E.old)){E.old.call(this)}};return E},easing:{linear:function(G,H,E,F){return E+F*G},swing:function(G,H,E,F){return((-Math.cos(G*Math.PI)/2)+0.5)*F+E}},timers:[],fx:function(F,E,G){this.options=E;this.elem=F;this.prop=G;if(!E.orig){E.orig={}}}});o.fx.prototype={update:function(){if(this.options.step){this.options.step.call(this.elem,this.now,this)}(o.fx.step[this.prop]||o.fx.step._default)(this);if((this.prop=="height"||this.prop=="width")&&this.elem.style){this.elem.style.display="block"}},cur:function(F){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null)){return this.elem[this.prop]}var E=parseFloat(o.css(this.elem,this.prop,F));return E&&E>-10000?E:parseFloat(o.curCSS(this.elem,this.prop))||0},custom:function(I,H,G){this.startTime=e();this.start=I;this.end=H;this.unit=G||this.unit||"px";this.now=this.start;this.pos=this.state=0;var E=this;function F(J){return E.step(J)}F.elem=this.elem;if(F()&&o.timers.push(F)&&!n){n=setInterval(function(){var K=o.timers;for(var J=0;J<K.length;J++){if(!K[J]()){K.splice(J--,1)}}if(!K.length){clearInterval(n);n=g}},13)}},show:function(){this.options.orig[this.prop]=o.attr(this.elem.style,this.prop);this.options.show=true;this.custom(this.prop=="width"||this.prop=="height"?1:0,this.cur());o(this.elem).show()},hide:function(){this.options.orig[this.prop]=o.attr(this.elem.style,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(H){var G=e();if(H||G>=this.options.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();this.options.curAnim[this.prop]=true;var E=true;for(var F in this.options.curAnim){if(this.options.curAnim[F]!==true){E=false}}if(E){if(this.options.display!=null){this.elem.style.overflow=this.options.overflow;this.elem.style.display=this.options.display;if(o.css(this.elem,"display")=="none"){this.elem.style.display="block"}}if(this.options.hide){o(this.elem).hide()}if(this.options.hide||this.options.show){for(var I in this.options.curAnim){o.attr(this.elem.style,I,this.options.orig[I])}}this.options.complete.call(this.elem)}return false}else{var J=G-this.startTime;this.state=J/this.options.duration;this.pos=o.easing[this.options.easing||(o.easing.swing?"swing":"linear")](this.state,J,0,1,this.options.duration);this.now=this.start+((this.end-this.start)*this.pos);this.update()}return true}};o.extend(o.fx,{speeds:{slow:600,fast:200,_default:400},step:{opacity:function(E){o.attr(E.elem.style,"opacity",E.now)},_default:function(E){if(E.elem.style&&E.elem.style[E.prop]!=null){E.elem.style[E.prop]=E.now+E.unit}else{E.elem[E.prop]=E.now}}}});if(document.documentElement.getBoundingClientRect){o.fn.offset=function(){if(!this[0]){return{top:0,left:0}}if(this[0]===this[0].ownerDocument.body){return o.offset.bodyOffset(this[0])}var G=this[0].getBoundingClientRect(),J=this[0].ownerDocument,F=J.body,E=J.documentElement,L=E.clientTop||F.clientTop||0,K=E.clientLeft||F.clientLeft||0,I=G.top+(self.pageYOffset||o.boxModel&&E.scrollTop||F.scrollTop)-L,H=G.left+(self.pageXOffset||o.boxModel&&E.scrollLeft||F.scrollLeft)-K;return{top:I,left:H}}}else{o.fn.offset=function(){if(!this[0]){return{top:0,left:0}}if(this[0]===this[0].ownerDocument.body){return o.offset.bodyOffset(this[0])}o.offset.initialized||o.offset.initialize();var J=this[0],G=J.offsetParent,F=J,O=J.ownerDocument,M,H=O.documentElement,K=O.body,L=O.defaultView,E=L.getComputedStyle(J,null),N=J.offsetTop,I=J.offsetLeft;while((J=J.parentNode)&&J!==K&&J!==H){M=L.getComputedStyle(J,null);N-=J.scrollTop,I-=J.scrollLeft;if(J===G){N+=J.offsetTop,I+=J.offsetLeft;if(o.offset.doesNotAddBorder&&!(o.offset.doesAddBorderForTableAndCells&&/^t(able|d|h)$/i.test(J.tagName))){N+=parseInt(M.borderTopWidth,10)||0,I+=parseInt(M.borderLeftWidth,10)||0}F=G,G=J.offsetParent}if(o.offset.subtractsBorderForOverflowNotVisible&&M.overflow!=="visible"){N+=parseInt(M.borderTopWidth,10)||0,I+=parseInt(M.borderLeftWidth,10)||0}E=M}if(E.position==="relative"||E.position==="static"){N+=K.offsetTop,I+=K.offsetLeft}if(E.position==="fixed"){N+=Math.max(H.scrollTop,K.scrollTop),I+=Math.max(H.scrollLeft,K.scrollLeft)}return{top:N,left:I}}}o.offset={initialize:function(){if(this.initialized){return}var L=document.body,F=document.createElement("div"),H,G,N,I,M,E,J=L.style.marginTop,K='<div style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;"><div></div></div><table style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;" cellpadding="0" cellspacing="0"><tr><td></td></tr></table>';M={position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"};for(E in M){F.style[E]=M[E]}F.innerHTML=K;L.insertBefore(F,L.firstChild);H=F.firstChild,G=H.firstChild,I=H.nextSibling.firstChild.firstChild;this.doesNotAddBorder=(G.offsetTop!==5);this.doesAddBorderForTableAndCells=(I.offsetTop===5);H.style.overflow="hidden",H.style.position="relative";this.subtractsBorderForOverflowNotVisible=(G.offsetTop===-5);L.style.marginTop="1px";this.doesNotIncludeMarginInBodyOffset=(L.offsetTop===0);L.style.marginTop=J;L.removeChild(F);this.initialized=true},bodyOffset:function(E){o.offset.initialized||o.offset.initialize();var G=E.offsetTop,F=E.offsetLeft;if(o.offset.doesNotIncludeMarginInBodyOffset){G+=parseInt(o.curCSS(E,"marginTop",true),10)||0,F+=parseInt(o.curCSS(E,"marginLeft",true),10)||0}return{top:G,left:F}}};o.fn.extend({position:function(){var I=0,H=0,F;if(this[0]){var G=this.offsetParent(),J=this.offset(),E=/^body|html$/i.test(G[0].tagName)?{top:0,left:0}:G.offset();J.top-=j(this,"marginTop");J.left-=j(this,"marginLeft");E.top+=j(G,"borderTopWidth");E.left+=j(G,"borderLeftWidth");F={top:J.top-E.top,left:J.left-E.left}}return F},offsetParent:function(){var E=this[0].offsetParent||document.body;while(E&&(!/^body|html$/i.test(E.tagName)&&o.css(E,"position")=="static")){E=E.offsetParent}return o(E)}});o.each(["Left","Top"],function(F,E){var G="scroll"+E;o.fn[G]=function(H){if(!this[0]){return null}return H!==g?this.each(function(){this==l||this==document?l.scrollTo(!F?H:o(l).scrollLeft(),F?H:o(l).scrollTop()):this[G]=H}):this[0]==l||this[0]==document?self[F?"pageYOffset":"pageXOffset"]||o.boxModel&&document.documentElement[G]||document.body[G]:this[0][G]}});o.each(["Height","Width"],function(I,G){var E=I?"Left":"Top",H=I?"Right":"Bottom",F=G.toLowerCase();o.fn["inner"+G]=function(){return this[0]?o.css(this[0],F,false,"padding"):null};o.fn["outer"+G]=function(K){return this[0]?o.css(this[0],F,false,K?"margin":"border"):null};var J=G.toLowerCase();o.fn[J]=function(K){return this[0]==l?document.compatMode=="CSS1Compat"&&document.documentElement["client"+G]||document.body["client"+G]:this[0]==document?Math.max(document.documentElement["client"+G],document.body["scroll"+G],document.documentElement["scroll"+G],document.body["offset"+G],document.documentElement["offset"+G]):K===g?(this.length?o.css(this[0],J):null):this.css(J,typeof K==="string"?K:K+"px")}})})();
\ No newline at end of file diff --git a/js/jquery.i18n.js b/js/jquery.i18n.js new file mode 100644 index 0000000..ac2193d --- /dev/null +++ b/js/jquery.i18n.js @@ -0,0 +1,68 @@ +/* Copyright Bryan W Berry, 2009, + * under the MIT license http://www.opensource.org/licenses/mit-license.php + * + * this library is heavily influenced by the GNU LIBC library + * http://www.gnu.org/software/libc/manual/html_node/Locales.html + */ + +(function($){ + + $.i18n = function(string, locale){ + var lang = locale || $.i18n.lang; + if (!this.i18n[lang] || !this.i18n[lang].strings){ + return string; + } + return this.i18n[lang].strings[string]||string; + }; + + $._ = $.i18n; + + $.i18n.setLocale = function (locale){ + $.i18n.lang = locale; + }; + + $.i18n.getLocale = function (){ + return $.i18n.lang; + }; + + + /** + * Converts a number to numerals in the specified locale. Currently only + * supports devanagari numerals for Indic languages like Nepali and Hindi + * @param {Number} Number to be converted + * @param {locale} locale that number should be converted to + * @returns {String} Unicode string for localized numeral + */ + $.i18n._n = function(num, locale){ + + locale = locale || $.i18n.lang; + + if (!this.i18n[locale] || !this.i18n[locale].numBase ){ + return num; + } + + + //48 is the base for western numerals + var numBase = $.i18n[$.i18n.lang].numeralBase || 48; + var prefix = $.i18n[$.i18n.lang].numeralPrefix || "u00"; + + var convertDigit = function(digit){ + return '\\' + prefix + + (numBase + parseInt(digit)).toString(16); + }; + + var charArray = num.toString().split("").map(convertDigit); + return eval('"' + charArray.join('') + '"'); + }; + + $._n = $.i18n._n; + + /* ToDo + * implement sprintf + * conversion functions for monetary and numeric + * sorting functions (collation) for different locales + */ + + })(jQuery); + + diff --git a/js/jquery.ne.json b/js/jquery.ne.json new file mode 100644 index 0000000..fe5e97b --- /dev/null +++ b/js/jquery.ne.json @@ -0,0 +1,13 @@ +$.i18n.ne = { + numeralBase : 2406, + numeralPrefix:"u0" + /* + * additional values that could be added + * + * monetary format + * non-monetary numeric format + * date format + * time format + * yes, no for yes, no questions + */ +};
\ No newline at end of file diff --git a/js/jquery.svg.js b/js/jquery.svg.js new file mode 100755 index 0000000..3d13d94 --- /dev/null +++ b/js/jquery.svg.js @@ -0,0 +1,1325 @@ +/* http://keith-wood.name/svg.html
+ SVG for jQuery v1.4.2.
+ Written by Keith Wood (kbwood{at}iinet.com.au) August 2007.
+ Dual licensed under the GPL (http://dev.jquery.com/browser/trunk/jquery/GPL-LICENSE.txt) and
+ MIT (http://dev.jquery.com/browser/trunk/jquery/MIT-LICENSE.txt) licenses.
+ Please attribute the author if you use it. */
+
+(function($) { // Hide scope, no $ conflict
+
+/* SVG manager.
+ Use the singleton instance of this class, $.svg,
+ to interact with the SVG functionality. */
+function SVGManager() {
+ this._settings = []; // Settings to be remembered per SVG object
+ this._extensions = []; // List of SVG extensions added to SVGWrapper
+ // for each entry [0] is extension name, [1] is extension class (function)
+ // the function takes one parameter - the SVGWrapper instance
+ this.regional = []; // Localisations, indexed by language, '' for default (English)
+ this.regional[''] = {errorLoadingText: 'Error loading',
+ notSupportedText: 'This browser does not support SVG'};
+ this.local = this.regional['']; // Current localisation
+ this._uuid = new Date().getTime();
+ this._renesis = detectActiveX('RenesisX.RenesisCtrl');
+}
+
+/* Determine whether a given ActiveX control is available.
+ @param classId (string) the ID for the ActiveX control
+ @return (boolean) true if found, false if not */
+function detectActiveX(classId) {
+ try {
+ return !!(window.ActiveXObject && new ActiveXObject(classId));
+ }
+ catch (e) {
+ return false;
+ }
+}
+
+var PROP_NAME = 'svgwrapper';
+
+$.extend(SVGManager.prototype, {
+ /* Class name added to elements to indicate already configured with SVG. */
+ markerClassName: 'hasSVG',
+
+ /* SVG namespace. */
+ svgNS: 'http://www.w3.org/2000/svg',
+ /* XLink namespace. */
+ xlinkNS: 'http://www.w3.org/1999/xlink',
+
+ /* SVG wrapper class. */
+ _wrapperClass: SVGWrapper,
+
+ /* Camel-case versions of attribute names containing dashes or are reserved words. */
+ _attrNames: {class_: 'class', in_: 'in',
+ alignmentBaseline: 'alignment-baseline', baselineShift: 'baseline-shift',
+ clipPath: 'clip-path', clipRule: 'clip-rule',
+ colorInterpolation: 'color-interpolation',
+ colorInterpolationFilters: 'color-interpolation-filters',
+ colorRendering: 'color-rendering', dominantBaseline: 'dominant-baseline',
+ enableBackground: 'enable-background', fillOpacity: 'fill-opacity',
+ fillRule: 'fill-rule', floodColor: 'flood-color',
+ floodOpacity: 'flood-opacity', fontFamily: 'font-family',
+ fontSize: 'font-size', fontSizeAdjust: 'font-size-adjust',
+ fontStretch: 'font-stretch', fontStyle: 'font-style',
+ fontVariant: 'font-variant', fontWeight: 'font-weight',
+ glyphOrientationHorizontal: 'glyph-orientation-horizontal',
+ glyphOrientationVertical: 'glyph-orientation-vertical',
+ horizAdvX: 'horiz-adv-x', horizOriginX: 'horiz-origin-x',
+ imageRendering: 'image-rendering', letterSpacing: 'letter-spacing',
+ lightingColor: 'lighting-color', markerEnd: 'marker-end',
+ markerMid: 'marker-mid', markerStart: 'marker-start',
+ stopColor: 'stop-color', stopOpacity: 'stop-opacity',
+ strikethroughPosition: 'strikethrough-position',
+ strikethroughThickness: 'strikethrough-thickness',
+ strokeDashArray: 'stroke-dasharray', strokeDashOffset: 'stroke-dashoffset',
+ strokeLineCap: 'stroke-linecap', strokeLineJoin: 'stroke-linejoin',
+ strokeMiterLimit: 'stroke-miterlimit', strokeOpacity: 'stroke-opacity',
+ strokeWidth: 'stroke-width', textAnchor: 'text-anchor',
+ textDecoration: 'text-decoration', textRendering: 'text-rendering',
+ underlinePosition: 'underline-position', underlineThickness: 'underline-thickness',
+ vertAdvY: 'vert-adv-y', vertOriginY: 'vert-origin-y',
+ wordSpacing: 'word-spacing', writingMode: 'writing-mode'},
+
+ /* Add the SVG object to its container. */
+ _attachSVG: function(container, settings) {
+ if ($(container).hasClass(this.markerClassName)) {
+ return;
+ }
+ if (typeof settings == 'string') {
+ settings = {loadURL: settings};
+ }
+ else if (typeof settings == 'function') {
+ settings = {onLoad: settings};
+ }
+ $(container).addClass(this.markerClassName);
+ try {
+ var svg = document.createElementNS(this.svgNS, 'svg');
+ svg.setAttribute('version', '1.1');
+ svg.setAttribute('width', container.clientWidth);
+ svg.setAttribute('height', container.clientHeight);
+ container.appendChild(svg);
+ this._afterLoad(container, svg, settings);
+ }
+ catch (e) {
+ if ($.browser.msie) {
+ if (!container.id) {
+ container.id = 'svg' + (this._uuid++);
+ }
+ this._settings[container.id] = settings;
+ container.innerHTML = '<embed type="image/svg+xml" width="100%" ' +
+ 'height="100%" src="' + (settings.initPath || '') + 'blank.svg"/>';
+ }
+ else {
+ container.innerHTML = '<p class="svg_error">' +
+ this.local.notSupportedText + '</p>';
+ }
+ }
+ },
+
+ /* SVG callback after loading - register SVG root. */
+ _registerSVG: function() {
+ for (var i = 0; i < document.embeds.length; i++) { // Check all
+ var container = document.embeds[i].parentNode;
+ if (!$(container).hasClass($.svg.markerClassName) || // Not SVG
+ $.data(container, PROP_NAME)) { // Already done
+ continue;
+ }
+ var svg = null;
+ try {
+ svg = document.embeds[i].getSVGDocument();
+ }
+ catch(e) {
+ setTimeout($.svg._registerSVG, 250); // Renesis takes longer to load
+ return;
+ }
+ svg = (svg ? svg.documentElement : null);
+ if (svg) {
+ $.svg._afterLoad(container, svg);
+ }
+ }
+ },
+
+ /* Post-processing once loaded. */
+ _afterLoad: function(container, svg, settings) {
+ var settings = settings || this._settings[container.id];
+ this._settings[container.id] = null;
+ var wrapper = new this._wrapperClass(svg, container);
+ $.data(container, PROP_NAME, wrapper);
+ try {
+ if (settings.loadURL) { // Load URL
+ wrapper.load(settings.loadURL, settings);
+ }
+ if (settings.settings) { // Additional settings
+ wrapper.configure(settings.settings);
+ }
+ if (settings.onLoad && !settings.loadURL) { // Onload callback
+ settings.onLoad.apply(container, [wrapper]);
+ }
+ }
+ catch (e) {
+ alert(e);
+ }
+ },
+
+ /* Return the SVG wrapper created for a given container.
+ @param container (string) selector for the container or
+ (element) the container for the SVG object or
+ jQuery collection - first entry is the container
+ @return (SVGWrapper) the corresponding SVG wrapper element, or null if not attached */
+ _getSVG: function(container) {
+ container = (typeof container == 'string' ? $(container)[0] :
+ (container.jquery ? container[0] : container));
+ return $.data(container, PROP_NAME);
+ },
+
+ /* Remove the SVG functionality from a div.
+ @param container (element) the container for the SVG object */
+ _destroySVG: function(container) {
+ var $container = $(container);
+ if (!$container.hasClass(this.markerClassName)) {
+ return;
+ }
+ $container.removeClass(this.markerClassName).empty();
+ $.removeData(container, PROP_NAME);
+ },
+
+ /* Extend the SVGWrapper object with an embedded class.
+ The constructor function must take a single parameter that is
+ a reference to the owning SVG root object. This allows the
+ extension to access the basic SVG functionality.
+ @param name (string) the name of the SVGWrapper attribute to access the new class
+ @param extClass (function) the extension class constructor */
+ addExtension: function(name, extClass) {
+ this._extensions.push([name, extClass]);
+ }
+});
+
+/* The main SVG interface, which encapsulates the SVG element.
+ Obtain a reference from $().svg('get') */
+function SVGWrapper(svg, container) {
+ this._svg = svg; // The SVG root node
+ this._container = container; // The containing div
+ for (var i = 0; i < $.svg._extensions.length; i++) {
+ var extension = $.svg._extensions[i];
+ this[extension[0]] = new extension[1](this);
+ }
+}
+
+$.extend(SVGWrapper.prototype, {
+
+ /* Retrieve the width of the SVG object. */
+ _width: function() {
+ return this._container.clientWidth;
+ },
+
+ /* Retrieve the height of the SVG object. */
+ _height: function() {
+ return this._container.clientHeight;
+ },
+
+ /* Retrieve the root SVG element.
+ @return the top-level SVG element */
+ root: function() {
+ return this._svg;
+ },
+
+ /* Configure the SVG root.
+ @param settings (object) additional settings for the root
+ @param clear (boolean) true to remove existing attributes first,
+ false to add to what is already there (optional)
+ @return (SVGWrapper) this root */
+ configure: function(settings, clear) {
+ if (clear) {
+ for (var i = this._svg.attributes.length - 1; i >= 0; i--) {
+ var attr = this._svg.attributes.item(i);
+ if (!(attr.nodeName == 'onload' || attr.nodeName == 'version' ||
+ attr.nodeName.substring(0, 5) == 'xmlns')) {
+ this._svg.attributes.removeNamedItem(attr.nodeName);
+ }
+ }
+ }
+ for (var attrName in settings) {
+ this._svg.setAttribute(attrName, settings[attrName]);
+ }
+ return this;
+ },
+
+ /* Locate a specific element in the SVG document.
+ @param id (string) the element's identifier
+ @return (element) the element reference, or null if not found */
+ getElementById: function(id) {
+ return this._svg.ownerDocument.getElementById(id);
+ },
+
+ /* Change the attributes for a SVG node.
+ @param element (SVG element) the node to change
+ @param settings (object) the new settings
+ @return (SVGWrapper) this root */
+ change: function(element, settings) {
+ if (element) {
+ for (var name in settings) {
+ if (settings[name] == null) {
+ element.removeAttribute(name);
+ }
+ else {
+ element.setAttribute(name, settings[name]);
+ }
+ }
+ }
+ return this;
+ },
+
+ /* Check for parent being absent and adjust arguments accordingly. */
+ _args: function(values, names, optSettings) {
+ names.splice(0, 0, 'parent');
+ names.splice(names.length, 0, 'settings');
+ var args = {};
+ var offset = 0;
+ if (values[0] != null && (typeof values[0] != 'object' || !values[0].nodeName)) {
+ args['parent'] = null;
+ offset = 1;
+ }
+ for (var i = 0; i < values.length; i++) {
+ args[names[i + offset]] = values[i];
+ }
+ if (optSettings) {
+ $.each(optSettings, function(i, value) {
+ if (typeof args[value] == 'object') {
+ args.settings = args[value];
+ args[value] = null;
+ }
+ });
+ }
+ return args;
+ },
+
+ /* Add a title.
+ @param parent (element) the parent node for the new title (optional)
+ @param text (string) the text of the title
+ @param settings (object) additional settings for the title (optional)
+ @return (element) the new title node */
+ title: function(parent, text, settings) {
+ var args = this._args(arguments, ['text']);
+ var node = this._makeNode(args.parent, 'title', args.settings || {});
+ node.appendChild(this._svg.ownerDocument.createTextNode(args.text));
+ return node;
+ },
+
+ /* Add a description.
+ @param parent (element) the parent node for the new description (optional)
+ @param text (string) the text of the description
+ @param settings (object) additional settings for the description (optional)
+ @return (element) the new description node */
+ describe: function(parent, text, settings) {
+ var args = this._args(arguments, ['text']);
+ var node = this._makeNode(args.parent, 'desc', args.settings || {});
+ node.appendChild(this._svg.ownerDocument.createTextNode(args.text));
+ return node;
+ },
+
+ /* Add a definitions node.
+ @param parent (element) the parent node for the new definitions (optional)
+ @param id (string) the ID of this definitions (optional)
+ @param settings (object) additional settings for the definitions (optional)
+ @return (element) the new definitions node */
+ defs: function(parent, id, settings) {
+ var args = this._args(arguments, ['id'], ['id']);
+ return this._makeNode(args.parent, 'defs', $.extend(
+ (args.id ? {id: args.id} : {}), args.settings || {}));
+ },
+
+ /* Add a symbol definition.
+ @param parent (element) the parent node for the new symbol (optional)
+ @param id (string) the ID of this symbol
+ @param x1 (number) the left coordinate for this symbol
+ @param y1 (number) the top coordinate for this symbol
+ @param x2 (number) the right coordinate for this symbol
+ @param y2 (number) the bottom coordinate for this symbol
+ @param settings (object) additional settings for the symbol (optional)
+ @return (element) the new symbol node */
+ symbol: function(parent, id, x1, y1, x2, y2, settings) {
+ var args = this._args(arguments, ['id', 'x1', 'y1', 'x2', 'y2']);
+ return this._makeNode(args.parent, 'symbol', $.extend(
+ {id: args.id, viewBox: args.x1 + ' ' + args.y1 + ' ' + args.x2 + ' ' + args.y2},
+ args.settings || {}));
+ },
+
+ /* Add a marker definition.
+ @param parent (element) the parent node for the new marker (optional)
+ @param id (string) the ID of this marker
+ @param refX (number) the x-coordinate for the reference point
+ @param refY (number) the y-coordinate for the reference point
+ @param mWidth (number) the marker viewport width
+ @param mHeight (number) the marker viewport height
+ @param orient (string or int) 'auto' or angle (degrees) (optional)
+ @param settings (object) additional settings for the marker (optional)
+ @return (element) the new marker node */
+ marker: function(parent, id, refX, refY, mWidth, mHeight, orient, settings) {
+ var args = this._args(arguments, ['id', 'refX', 'refY',
+ 'mWidth', 'mHeight', 'orient'], ['orient']);
+ return this._makeNode(args.parent, 'marker', $.extend(
+ {id: args.id, refX: args.refX, refY: args.refY, markerWidth: args.mWidth,
+ markerHeight: args.mHeight, orient: args.orient || 'auto'}, args.settings || {}));
+ },
+
+ /* Add a style node.
+ @param parent (element) the parent node for the new node (optional)
+ @param styles (string) the CSS styles
+ @param settings (object) additional settings for the node (optional)
+ @return (element) the new style node */
+ style: function(parent, styles, settings) {
+ var args = this._args(arguments, ['styles']);
+ var node = this._makeNode(args.parent, 'style', $.extend(
+ {type: 'text/css'}, args.settings || {}));
+ node.appendChild(this._svg.ownerDocument.createTextNode(args.styles));
+ if ($.browser.opera) {
+ $('head').append('<style type="text/css">' + args.styles + '</style>');
+ }
+ return node;
+ },
+
+ /* Add a script node.
+ @param parent (element) the parent node for the new node (optional)
+ @param script (string) the JavaScript code
+ @param type (string) the MIME type for the code (optional, default 'text/javascript')
+ @param settings (object) additional settings for the node (optional)
+ @return (element) the new script node */
+ script: function(parent, script, type, settings) {
+ var args = this._args(arguments, ['script', 'type'], ['type']);
+ var node = this._makeNode(args.parent, 'script', $.extend(
+ {type: args.type || 'text/javascript'}, args.settings || {}));
+ node.appendChild(this._svg.ownerDocument.createTextNode(this._escapeXML(args.script)));
+ if (!$.browser.mozilla) {
+ $.globalEval(args.script);
+ }
+ return node;
+ },
+
+ /* Add a linear gradient definition.
+ Specify all of x1, y1, x2, y2 or none of them.
+ @param parent (element) the parent node for the new gradient (optional)
+ @param id (string) the ID for this gradient
+ @param stops (string[][]) the gradient stops, each entry is
+ [0] is offset (0.0-1.0 or 0%-100%), [1] is colour,
+ [2] is opacity (optional)
+ @param x1 (number) the x-coordinate of the gradient start (optional)
+ @param y1 (number) the y-coordinate of the gradient start (optional)
+ @param x2 (number) the x-coordinate of the gradient end (optional)
+ @param y2 (number) the y-coordinate of the gradient end (optional)
+ @param settings (object) additional settings for the gradient (optional)
+ @return (element) the new gradient node */
+ linearGradient: function(parent, id, stops, x1, y1, x2, y2, settings) {
+ var args = this._args(arguments,
+ ['id', 'stops', 'x1', 'y1', 'x2', 'y2'], ['x1']);
+ var sets = $.extend({id: args.id},
+ (args.x1 != null ? {x1: args.x1, y1: args.y1, x2: args.x2, y2: args.y2} : {}));
+ return this._gradient(args.parent, 'linearGradient',
+ $.extend(sets, args.settings || {}), args.stops);
+ },
+
+ /* Add a radial gradient definition.
+ Specify all of cx, cy, r, fx, fy or none of them.
+ @param parent (element) the parent node for the new gradient (optional)
+ @param id (string) the ID for this gradient
+ @param stops (string[][]) the gradient stops, each entry
+ [0] is offset, [1] is colour, [2] is opacity (optional)
+ @param cx (number) the x-coordinate of the largest circle centre (optional)
+ @param cy (number) the y-coordinate of the largest circle centre (optional)
+ @param r (number) the radius of the largest circle (optional)
+ @param fx (number) the x-coordinate of the gradient focus (optional)
+ @param fy (number) the y-coordinate of the gradient focus (optional)
+ @param settings (object) additional settings for the gradient (optional)
+ @return (element) the new gradient node */
+ radialGradient: function(parent, id, stops, cx, cy, r, fx, fy, settings) {
+ var args = this._args(arguments,
+ ['id', 'stops', 'cx', 'cy', 'r', 'fx', 'fy'], ['cx']);
+ var sets = $.extend({id: args.id}, (args.cx != null ?
+ {cx: args.cx, cy: args.cy, r: args.r, fx: args.fx, fy: args.fy} : {}));
+ return this._gradient(args.parent, 'radialGradient',
+ $.extend(sets, args.settings || {}), args.stops);
+ },
+
+ /* Add a gradient node. */
+ _gradient: function(parent, name, settings, stops) {
+ var node = this._makeNode(parent, name, settings);
+ for (var i = 0; i < stops.length; i++) {
+ var stop = stops[i];
+ this._makeNode(node, 'stop', $.extend(
+ {offset: stop[0], stopColor: stop[1]},
+ (stop[2] != null ? {stopOpacity: stop[2]} : {})));
+ }
+ return node;
+ },
+
+ /* Add a pattern definition.
+ Specify all of vx, vy, xwidth, vheight or none of them.
+ @param parent (element) the parent node for the new pattern (optional)
+ @param id (string) the ID for this pattern
+ @param x (number) the x-coordinate for the left edge of the pattern
+ @param y (number) the y-coordinate for the top edge of the pattern
+ @param width (number) the width of the pattern
+ @param height (number) the height of the pattern
+ @param vx (number) the minimum x-coordinate for view box (optional)
+ @param vy (number) the minimum y-coordinate for the view box (optional)
+ @param vwidth (number) the width of the view box (optional)
+ @param vheight (number) the height of the view box (optional)
+ @param settings (object) additional settings for the pattern (optional)
+ @return (element) the new pattern node */
+ pattern: function(parent, id, x, y, width, height, vx, vy, vwidth, vheight, settings) {
+ var args = this._args(arguments, ['id', 'x', 'y', 'width', 'height',
+ 'vx', 'vy', 'vwidth', 'vheight'], ['vx']);
+ var sets = $.extend({id: args.id, x: args.x, y: args.y,
+ width: args.width, height: args.height}, (args.vx != null ?
+ {viewBox: args.vx + ' ' + args.vy + ' ' + args.vwidth + ' ' + args.vheight} : {}));
+ return this._makeNode(args.parent, 'pattern', $.extend(sets, args.settings || {}));
+ },
+
+ /* Add a mask definition.
+ @param parent (element) the parent node for the new mask (optional)
+ @param id (string) the ID for this mask
+ @param x (number) the x-coordinate for the left edge of the mask
+ @param y (number) the y-coordinate for the top edge of the mask
+ @param width (number) the width of the mask
+ @param height (number) the height of the mask
+ @param settings (object) additional settings for the mask (optional)
+ @return (element) the new mask node */
+ mask: function(parent, id, x, y, width, height, settings) {
+ var args = this._args(arguments, ['id', 'x', 'y', 'width', 'height']);
+ return this._makeNode(args.parent, 'mask', $.extend(
+ {id: args.id, x: args.x, y: args.y, width: args.width, height: args.height},
+ args.settings || {}));
+ },
+
+ /* Create a new path object.
+ @return (SVGPath) a new path object */
+ createPath: function() {
+ return new SVGPath();
+ },
+
+ /* Create a new text object.
+ @return (SVGText) a new text object */
+ createText: function() {
+ return new SVGText();
+ },
+
+ /* Add an embedded SVG element.
+ Specify all of vx, vy, vwidth, vheight or none of them.
+ @param parent (element) the parent node for the new node (optional)
+ @param x (number) the x-coordinate for the left edge of the node
+ @param y (number) the y-coordinate for the top edge of the node
+ @param width (number) the width of the node
+ @param height (number) the height of the node
+ @param vx (number) the minimum x-coordinate for view box (optional)
+ @param vy (number) the minimum y-coordinate for the view box (optional)
+ @param vwidth (number) the width of the view box (optional)
+ @param vheight (number) the height of the view box (optional)
+ @param settings (object) additional settings for the node (optional)
+ @return (element) the new node */
+ svg: function(parent, x, y, width, height, vx, vy, vwidth, vheight, settings) {
+ var args = this._args(arguments, ['x', 'y', 'width', 'height',
+ 'vx', 'vy', 'vwidth', 'vheight'], ['vx']);
+ var sets = $.extend({x: args.x, y: args.y, width: args.width, height: args.height},
+ (args.vx != null ? {viewBox: args.vx + ' ' + args.vy + ' ' +
+ args.vwidth + ' ' + args.vheight} : {}));
+ return this._makeNode(args.parent, 'svg', $.extend(sets, args.settings || {}));
+ },
+
+ /* Create a group.
+ @param parent (element) the parent node for the new group (optional)
+ @param id (string) the ID of this group (optional)
+ @param settings (object) additional settings for the group (optional)
+ @return (element) the new group node */
+ group: function(parent, id, settings) {
+ var args = this._args(arguments, ['id'], ['id']);
+ return this._makeNode(args.parent, 'g', $.extend({id: args.id}, args.settings || {}));
+ },
+
+ /* Add a usage reference.
+ Specify all of x, y, width, height or none of them.
+ @param parent (element) the parent node for the new node (optional)
+ @param x (number) the x-coordinate for the left edge of the node (optional)
+ @param y (number) the y-coordinate for the top edge of the node (optional)
+ @param width (number) the width of the node (optional)
+ @param height (number) the height of the node (optional)
+ @param ref (string) the ID of the definition node
+ @param settings (object) additional settings for the node (optional)
+ @return (element) the new node */
+ use: function(parent, x, y, width, height, ref, settings) {
+ var args = this._args(arguments, ['x', 'y', 'width', 'height', 'ref']);
+ if (typeof args.x == 'string') {
+ args.ref = args.x;
+ args.settings = args.y;
+ args.x = args.y = args.width = args.height = null;
+ }
+ var node = this._makeNode(args.parent, 'use', $.extend(
+ {x: args.x, y: args.y, width: args.width, height: args.height},
+ args.settings || {}));
+ node.setAttributeNS($.svg.xlinkNS, 'href', args.ref);
+ return node;
+ },
+
+ /* Add a link, which applies to all child elements.
+ @param parent (element) the parent node for the new link (optional)
+ @param ref (string) the target URL
+ @param settings (object) additional settings for the link (optional)
+ @return (element) the new link node */
+ link: function(parent, ref, settings) {
+ var args = this._args(arguments, ['ref']);
+ var node = this._makeNode(args.parent, 'a', args.settings);
+ node.setAttributeNS($.svg.xlinkNS, 'href', args.ref);
+ return node;
+ },
+
+ /* Add an image.
+ @param parent (element) the parent node for the new image (optional)
+ @param x (number) the x-coordinate for the left edge of the image
+ @param y (number) the y-coordinate for the top edge of the image
+ @param width (number) the width of the image
+ @param height (number) the height of the image
+ @param ref (string) the path to the image
+ @param settings (object) additional settings for the image (optional)
+ @return (element) the new image node */
+ image: function(parent, x, y, width, height, ref, settings) {
+ var args = this._args(arguments, ['x', 'y', 'width', 'height', 'ref']);
+ var node = this._makeNode(args.parent, 'image', $.extend(
+ {x: args.x, y: args.y, width: args.width, height: args.height},
+ args.settings || {}));
+ node.setAttributeNS($.svg.xlinkNS, 'href', args.ref);
+ return node;
+ },
+
+ /* Draw a path.
+ @param parent (element) the parent node for the new shape (optional)
+ @param path (string or SVGPath) the path to draw
+ @param settings (object) additional settings for the shape (optional)
+ @return (element) the new shape node */
+ path: function(parent, path, settings) {
+ var args = this._args(arguments, ['path']);
+ return this._makeNode(args.parent, 'path', $.extend(
+ {d: (args.path.path ? args.path.path() : args.path)}, args.settings || {}));
+ },
+
+ /* Draw a rectangle.
+ Specify both of rx and ry or neither.
+ @param parent (element) the parent node for the new shape (optional)
+ @param x (number) the x-coordinate for the left edge of the rectangle
+ @param y (number) the y-coordinate for the top edge of the rectangle
+ @param width (number) the width of the rectangle
+ @param height (number) the height of the rectangle
+ @param rx (number) the x-radius of the ellipse for the rounded corners (optional)
+ @param ry (number) the y-radius of the ellipse for the rounded corners (optional)
+ @param settings (object) additional settings for the shape (optional)
+ @return (element) the new shape node */
+ rect: function(parent, x, y, width, height, rx, ry, settings) {
+ var args = this._args(arguments, ['x', 'y', 'width', 'height', 'rx', 'ry'], ['rx']);
+ return this._makeNode(args.parent, 'rect', $.extend(
+ {x: args.x, y: args.y, width: args.width, height: args.height},
+ (args.rx ? {rx: args.rx, ry: args.ry} : {}), args.settings || {}));
+ },
+
+ /* Draw a circle.
+ @param parent (element) the parent node for the new shape (optional)
+ @param cx (number) the x-coordinate for the centre of the circle
+ @param cy (number) the y-coordinate for the centre of the circle
+ @param r (number) the radius of the circle
+ @param settings (object) additional settings for the shape (optional)
+ @return (element) the new shape node */
+ circle: function(parent, cx, cy, r, settings) {
+ var args = this._args(arguments, ['cx', 'cy', 'r']);
+ return this._makeNode(args.parent, 'circle', $.extend(
+ {cx: args.cx, cy: args.cy, r: args.r}, args.settings || {}));
+ },
+
+ /* Draw an ellipse.
+ @param parent (element) the parent node for the new shape (optional)
+ @param cx (number) the x-coordinate for the centre of the ellipse
+ @param cy (number) the y-coordinate for the centre of the ellipse
+ @param rx (number) the x-radius of the ellipse
+ @param ry (number) the y-radius of the ellipse
+ @param settings (object) additional settings for the shape (optional)
+ @return (element) the new shape node */
+ ellipse: function(parent, cx, cy, rx, ry, settings) {
+ var args = this._args(arguments, ['cx', 'cy', 'rx', 'ry']);
+ return this._makeNode(args.parent, 'ellipse', $.extend(
+ {cx: args.cx, cy: args.cy, rx: args.rx, ry: args.ry}, args.settings || {}));
+ },
+
+ /* Draw a line.
+ @param parent (element) the parent node for the new shape (optional)
+ @param x1 (number) the x-coordinate for the start of the line
+ @param y1 (number) the y-coordinate for the start of the line
+ @param x2 (number) the x-coordinate for the end of the line
+ @param y2 (number) the y-coordinate for the end of the line
+ @param settings (object) additional settings for the shape (optional)
+ @return (element) the new shape node */
+ line: function(parent, x1, y1, x2, y2, settings) {
+ var args = this._args(arguments, ['x1', 'y1', 'x2', 'y2']);
+ return this._makeNode(args.parent, 'line', $.extend(
+ {x1: args.x1, y1: args.y1, x2: args.x2, y2: args.y2}, args.settings || {}));
+ },
+
+ /* Draw a polygonal line.
+ @param parent (element) the parent node for the new shape (optional)
+ @param points (number[][]) the x-/y-coordinates for the points on the line
+ @param settings (object) additional settings for the shape (optional)
+ @return (element) the new shape node */
+ polyline: function(parent, points, settings) {
+ var args = this._args(arguments, ['points']);
+ return this._poly(args.parent, 'polyline', args.points, args.settings);
+ },
+
+ /* Draw a polygonal shape.
+ @param parent (element) the parent node for the new shape (optional)
+ @param points (number[][]) the x-/y-coordinates for the points on the shape
+ @param settings (object) additional settings for the shape (optional)
+ @return (element) the new shape node */
+ polygon: function(parent, points, settings) {
+ var args = this._args(arguments, ['points']);
+ return this._poly(args.parent, 'polygon', args.points, args.settings);
+ },
+
+ /* Draw a polygonal line or shape. */
+ _poly: function(parent, name, points, settings) {
+ var ps = '';
+ for (var i = 0; i < points.length; i++) {
+ ps += points[i].join() + ' ';
+ }
+ return this._makeNode(parent, name, $.extend(
+ {points: $.trim(ps)}, settings || {}));
+ },
+
+ /* Draw text.
+ Specify both of x and y or neither of them.
+ @param parent (element) the parent node for the text (optional)
+ @param x (number or number[]) the x-coordinate(s) for the text (optional)
+ @param y (number or number[]) the y-coordinate(s) for the text (optional)
+ @param value (string) the text content or
+ (SVGText) text with spans and references
+ @param settings (object) additional settings for the text (optional)
+ @return (element) the new text node */
+ text: function(parent, x, y, value, settings) {
+ var args = this._args(arguments, ['x', 'y', 'value']);
+ if (typeof args.x == 'string' && arguments.length < 4) {
+ args.value = args.x;
+ args.settings = args.y;
+ args.x = args.y = null;
+ }
+ return this._text(args.parent, 'text', args.value, $.extend(
+ {x: (args.x && isArray(args.x) ? args.x.join(' ') : args.x),
+ y: (args.y && isArray(args.y) ? args.y.join(' ') : args.y)},
+ args.settings || {}));
+ },
+
+ /* Draw text along a path.
+ @param parent (element) the parent node for the text (optional)
+ @param path (string) the ID of the path
+ @param value (string) the text content or
+ (SVGText) text with spans and references
+ @param settings (object) additional settings for the text (optional)
+ @return (element) the new text node */
+ textpath: function(parent, path, value, settings) {
+ var args = this._args(arguments, ['path', 'value']);
+ var node = this._text(args.parent, 'textPath', args.value, args.settings || {});
+ node.setAttributeNS($.svg.xlinkNS, 'href', args.path);
+ return node;
+ },
+
+ /* Draw text. */
+ _text: function(parent, name, value, settings) {
+ var node = this._makeNode(parent, name, settings);
+ if (typeof value == 'string') {
+ node.appendChild(node.ownerDocument.createTextNode(value));
+ }
+ else {
+ for (var i = 0; i < value._parts.length; i++) {
+ var part = value._parts[i];
+ if (part[0] == 'tspan') {
+ var child = this._makeNode(node, part[0], part[2]);
+ child.appendChild(node.ownerDocument.createTextNode(part[1]));
+ node.appendChild(child);
+ }
+ else if (part[0] == 'tref') {
+ var child = this._makeNode(node, part[0], part[2]);
+ child.setAttributeNS($.svg.xlinkNS, 'href', part[1]);
+ node.appendChild(child);
+ }
+ else if (part[0] == 'textpath') {
+ var set = $.extend({}, part[2]);
+ set.href = null;
+ var child = this._makeNode(node, part[0], set);
+ child.setAttributeNS($.svg.xlinkNS, 'href', part[2].href);
+ child.appendChild(node.ownerDocument.createTextNode(part[1]));
+ node.appendChild(child);
+ }
+ else { // straight text
+ node.appendChild(node.ownerDocument.createTextNode(part[1]));
+ }
+ }
+ }
+ return node;
+ },
+
+ /* Add a custom SVG element.
+ @param parent (element) the parent node for the new element (optional)
+ @param name (string) the name of the element
+ @param settings (object) additional settings for the element (optional)
+ @return (element) the new title node */
+ other: function(parent, name, settings) {
+ var args = this._args(arguments, ['name']);
+ return this._makeNode(args.parent, args.name, args.settings || {});
+ },
+
+ /* Create a shape node with the given settings. */
+ _makeNode: function(parent, name, settings) {
+ parent = parent || this._svg;
+ var node = this._svg.ownerDocument.createElementNS($.svg.svgNS, name);
+ for (var name in settings) {
+ var value = settings[name];
+ if (value != null && value != null &&
+ (typeof value != 'string' || value != '')) {
+ node.setAttribute($.svg._attrNames[name] || name, value);
+ }
+ }
+ parent.appendChild(node);
+ return node;
+ },
+
+ /* Add an existing SVG node to the diagram.
+ @param parent (element) the parent node for the new node (optional)
+ @param node (element) the new node to add or
+ (string) the jQuery selector for the node or
+ (jQuery collection) set of nodes to add
+ @return (SVGWrapper) this wrapper */
+ add: function(parent, node) {
+ var args = this._args(arguments, ['node']);
+ var svg = this;
+ args.parent = args.parent || this._svg;
+ try {
+ if ($.svg._renesis) {
+ throw 'Force traversal';
+ }
+ args.parent.appendChild(args.node.cloneNode(true));
+ }
+ catch (e) {
+ args.node = (args.node.jquery ? args.node : $(args.node));
+ args.node.each(function() {
+ var child = svg._cloneAsSVG(this);
+ if (child) {
+ args.parent.appendChild(child);
+ }
+ });
+ }
+ return this;
+ },
+
+ /* SVG nodes must belong to the SVG namespace, so clone and ensure this is so. */
+ _cloneAsSVG: function(node) {
+ var newNode = null;
+ if (node.nodeType == 1) { // element
+ newNode = this._svg.ownerDocument.createElementNS(
+ $.svg.svgNS, this._checkName(node.nodeName));
+ for (var i = 0; i < node.attributes.length; i++) {
+ var attr = node.attributes.item(i);
+ if (attr.nodeName != 'xmlns' && attr.nodeValue) {
+ if (attr.prefix == 'xlink') {
+ newNode.setAttributeNS($.svg.xlinkNS, attr.localName, attr.nodeValue);
+ }
+ else {
+ newNode.setAttribute(this._checkName(attr.nodeName), attr.nodeValue);
+ }
+ }
+ }
+ for (var i = 0; i < node.childNodes.length; i++) {
+ var child = this._cloneAsSVG(node.childNodes[i]);
+ if (child) {
+ newNode.appendChild(child);
+ }
+ }
+ }
+ else if (node.nodeType == 3) { // text
+ if ($.trim(node.nodeValue)) {
+ newNode = this._svg.ownerDocument.createTextNode(node.nodeValue);
+ }
+ }
+ else if (node.nodeType == 4) { // CDATA
+ if ($.trim(node.nodeValue)) {
+ try {
+ newNode = this._svg.ownerDocument.createCDATASection(node.nodeValue);
+ }
+ catch (e) {
+ newNode = this._svg.ownerDocument.createTextNode(
+ node.nodeValue.replace(/&/g, '&').
+ replace(/</g, '<').replace(/>/g, '>'));
+ }
+ }
+ }
+ return newNode;
+ },
+
+ /* Node names must be lower case and without SVG namespace prefix. */
+ _checkName: function(name) {
+ name = (name.substring(0, 1) >= 'A' && name.substring(0, 1) <= 'Z' ?
+ name.toLowerCase() : name);
+ return (name.substring(0, 4) == 'svg:' ? name.substring(4) : name);
+ },
+
+ /* Load an external SVG document.
+ @param url (string) the location of the SVG document or
+ the actual SVG content
+ @param settings (boolean) see addTo below or
+ (function) see onLoad below or
+ (object) additional settings for the load with attributes below:
+ addTo (boolean) true to add to what's already there,
+ or false to clear the canvas first
+ changeSize (boolean) true to allow the canvas size to change,
+ or false to retain the original
+ onLoad (function) callback after the document has loaded,
+ 'this' is the container, receives SVG object and
+ optional error message as a parameter
+ @return (SVGWrapper) this root */
+ load: function(url, settings) {
+ settings = (typeof settings == 'boolean'? {addTo: settings} :
+ (typeof settings == 'function'? {onLoad: settings} : settings || {}));
+ if (!settings.addTo) {
+ this.clear(false);
+ }
+ var size = [this._svg.getAttribute('width'), this._svg.getAttribute('height')];
+ var wrapper = this;
+ // Report a problem with the load
+ var reportError = function(message) {
+ message = $.svg.local.errorLoadingText + ': ' + message;
+ if (settings.onLoad) {
+ settings.onLoad.apply(wrapper._container, [wrapper, message]);
+ }
+ else {
+ wrapper.text(null, 10, 20, message);
+ }
+ };
+ // Create a DOM from SVG content
+ var loadXML4IE = function(data) {
+ var xml = new ActiveXObject('Microsoft.XMLDOM');
+ xml.validateOnParse = false;
+ xml.resolveExternals = false;
+ xml.async = false;
+ xml.loadXML(data);
+ if (xml.parseError.errorCode != 0) {
+ reportError(xml.parseError.reason);
+ return null;
+ }
+ return xml;
+ };
+ // Load the SVG DOM
+ var loadSVG = function(data) {
+ if (!data) {
+ return;
+ }
+ if (data.documentElement.nodeName != 'svg') {
+ var errors = data.getElementsByTagName('parsererror');
+ var messages = (errors.length ? errors[0].getElementsByTagName('div') : []); // Safari
+ reportError(!errors.length ? '???' :
+ (messages.length ? messages[0] : errors[0]).firstChild.nodeValue);
+ return;
+ }
+ var attrs = {};
+ for (var i = 0; i < data.documentElement.attributes.length; i++) {
+ var attr = data.documentElement.attributes.item(i);
+ if (!(attr.nodeName == 'version' || attr.nodeName.substring(0, 5) == 'xmlns')) {
+ attrs[attr.nodeName] = attr.nodeValue;
+ }
+ }
+ wrapper.configure(attrs, true);
+ var nodes = data.documentElement.childNodes;
+ for (var i = 0; i < nodes.length; i++) {
+ try {
+ if ($.svg._renesis) {
+ throw 'Force traversal';
+ }
+ wrapper._svg.appendChild(nodes[i].cloneNode(true));
+ }
+ catch (e) {
+ wrapper.add(null, nodes[i]);
+ }
+ }
+ if (!settings.changeSize) {
+ wrapper.configure({width: size[0], height: size[1]});
+ }
+ if (settings.onLoad) {
+ settings.onLoad.apply(wrapper._container, [wrapper]);
+ }
+ };
+ if (url.match('<svg')) { // Inline SVG
+ loadSVG($.browser.msie ? loadXML4IE(url) :
+ new DOMParser().parseFromString(url, 'text/xml'));
+ }
+ else { // Remote SVG
+ $.ajax({url: url, dataType: ($.browser.msie ? 'text' : 'xml'),
+ success: function(xml) {
+ loadSVG($.browser.msie ? loadXML4IE(xml) : xml);
+ }, error: function(http, message, exc) {
+ reportError(message + (exc ? ' ' + exc.message : ''));
+ }});
+ }
+ return this;
+ },
+
+ /* Delete a specified node.
+ @param node (element) the drawing node to remove
+ @return (SVGWrapper) this root */
+ remove: function(node) {
+ node.parentNode.removeChild(node);
+ return this;
+ },
+
+ /* Delete everything in the current document.
+ @param attrsToo (boolean) true to clear any root attributes as well,
+ false to leave them (optional)
+ @return (SVGWrapper) this root */
+ clear: function(attrsToo) {
+ if (attrsToo) {
+ this.configure({}, true);
+ }
+ while (this._svg.firstChild) {
+ this._svg.removeChild(this._svg.firstChild);
+ }
+ return this;
+ },
+
+ /* Serialise the current diagram into an SVG text document.
+ @param node (SVG element) the starting node (optional)
+ @return (string) the SVG as text */
+ toSVG: function(node) {
+ node = node || this._svg;
+ return (typeof XMLSerializer == 'undefined' ? this._toSVG(node) :
+ new XMLSerializer().serializeToString(node));
+ },
+
+ /* Serialise one node in the SVG hierarchy. */
+ _toSVG: function(node) {
+ var svgDoc = '';
+ if (!node) {
+ return svgDoc;
+ }
+ if (node.nodeType == 3) { // Text
+ svgDoc = node.nodeValue;
+ }
+ else if (node.nodeType == 4) { // CDATA
+ svgDoc = '<![CDATA[' + node.nodeValue + ']]>';
+ }
+ else { // Element
+ svgDoc = '<' + node.nodeName;
+ if (node.attributes) {
+ for (var i = 0; i < node.attributes.length; i++) {
+ var attr = node.attributes.item(i);
+ if (!($.trim(attr.nodeValue) == '' || attr.nodeValue.match(/^\[object/) ||
+ attr.nodeValue.match(/^function/))) {
+ svgDoc += ' ' + (attr.namespaceURI == $.svg.xlinkNS ? 'xlink:' : '') +
+ attr.nodeName + '="' + attr.nodeValue + '"';
+ }
+ }
+ }
+ if (node.firstChild) {
+ svgDoc += '>';
+ var child = node.firstChild;
+ while (child) {
+ svgDoc += this._toSVG(child);
+ child = child.nextSibling;
+ }
+ svgDoc += '</' + node.nodeName + '>';
+ }
+ else {
+ svgDoc += '/>';
+ }
+ }
+ return svgDoc;
+ },
+
+ /* Escape reserved characters in XML. */
+ _escapeXML: function(text) {
+ text = text.replace(/&/g, '&');
+ text = text.replace(/</g, '<');
+ text = text.replace(/>/g, '>');
+ return text;
+ }
+});
+
+/* Helper to generate an SVG path.
+ Obtain an instance from the SVGWrapper object.
+ String calls together to generate the path and use its value:
+ var path = root.createPath();
+ root.path(null, path.move(100, 100).line(300, 100).line(200, 300).close(), {fill: 'red'});
+ or
+ root.path(null, path.move(100, 100).line([[300, 100], [200, 300]]).close(), {fill: 'red'}); */
+function SVGPath() {
+ this._path = '';
+}
+
+$.extend(SVGPath.prototype, {
+ /* Prepare to create a new path.
+ @return (SVGPath) this path */
+ reset: function() {
+ this._path = '';
+ return this;
+ },
+
+ /* Move the pointer to a position.
+ @param x (number) x-coordinate to move to or
+ (number[][]) x-/y-coordinates to move to
+ @param y (number) y-coordinate to move to (omitted if x is array)
+ @param relative (boolean) true for coordinates relative to the current point,
+ false for coordinates being absolute
+ @return (SVGPath) this path */
+ move: function(x, y, relative) {
+ relative = (isArray(x) ? y : relative);
+ return this._coords((relative ? 'm' : 'M'), x, y);
+ },
+
+ /* Draw a line to a position.
+ @param x (number) x-coordinate to move to or
+ (number[][]) x-/y-coordinates to move to
+ @param y (number) y-coordinate to move to (omitted if x is array)
+ @param relative (boolean) true for coordinates relative to the current point,
+ false for coordinates being absolute
+ @return (SVGPath) this path */
+ line: function(x, y, relative) {
+ relative = (isArray(x) ? y : relative);
+ return this._coords((relative ? 'l' : 'L'), x, y);
+ },
+
+ /* Draw a horizontal line to a position.
+ @param x (number) x-coordinate to draw to or
+ (number[]) x-coordinates to draw to
+ @param relative (boolean) true for coordinates relative to the current point,
+ false for coordinates being absolute
+ @return (SVGPath) this path */
+ horiz: function(x, relative) {
+ this._path += (relative ? 'h' : 'H') + (isArray(x) ? x.join(' ') : x);
+ return this;
+ },
+
+ /* Draw a vertical line to a position.
+ @param y (number) y-coordinate to draw to or
+ (number[]) y-coordinates to draw to
+ @param relative (boolean) true for coordinates relative to the current point,
+ false for coordinates being absolute
+ @return (SVGPath) this path */
+ vert: function(y, relative) {
+ this._path += (relative ? 'v' : 'V') + (isArray(y) ? y.join(' ') : y);
+ return this;
+ },
+
+ /* Draw a cubic Bzier curve.
+ @param x1 (number) x-coordinate of beginning control point or
+ (number[][]) x-/y-coordinates of control and end points to draw to
+ @param y1 (number) y-coordinate of beginning control point (omitted if x1 is array)
+ @param x2 (number) x-coordinate of ending control point (omitted if x1 is array)
+ @param y2 (number) y-coordinate of ending control point (omitted if x1 is array)
+ @param x (number) x-coordinate of curve end (omitted if x1 is array)
+ @param y (number) y-coordinate of curve end (omitted if x1 is array)
+ @param relative (boolean) true for coordinates relative to the current point,
+ false for coordinates being absolute
+ @return (SVGPath) this path */
+ curveC: function(x1, y1, x2, y2, x, y, relative) {
+ relative = (isArray(x1) ? y1 : relative);
+ return this._coords((relative ? 'c' : 'C'), x1, y1, x2, y2, x, y);
+ },
+
+ /* Continue a cubic Bzier curve.
+ Starting control point is the reflection of the previous end control point.
+ @param x2 (number) x-coordinate of ending control point or
+ (number[][]) x-/y-coordinates of control and end points to draw to
+ @param y2 (number) y-coordinate of ending control point (omitted if x2 is array)
+ @param x (number) x-coordinate of curve end (omitted if x2 is array)
+ @param y (number) y-coordinate of curve end (omitted if x2 is array)
+ @param relative (boolean) true for coordinates relative to the current point,
+ false for coordinates being absolute
+ @return (SVGPath) this path */
+ smoothC: function(x2, y2, x, y, relative) {
+ relative = (isArray(x2) ? y2 : relative);
+ return this._coords((relative ? 's' : 'S'), x2, y2, x, y);
+ },
+
+ /* Draw a quadratic Bzier curve.
+ @param x1 (number) x-coordinate of control point or
+ (number[][]) x-/y-coordinates of control and end points to draw to
+ @param y1 (number) y-coordinate of control point (omitted if x1 is array)
+ @param x (number) x-coordinate of curve end (omitted if x1 is array)
+ @param y (number) y-coordinate of curve end (omitted if x1 is array)
+ @param relative (boolean) true for coordinates relative to the current point,
+ false for coordinates being absolute
+ @return (SVGPath) this path */
+ curveQ: function(x1, y1, x, y, relative) {
+ relative = (isArray(x1) ? y1 : relative);
+ return this._coords((relative ? 'q' : 'Q'), x1, y1, x, y);
+ },
+
+ /* Continue a quadratic Bzier curve.
+ Control point is the reflection of the previous control point.
+ @param x (number) x-coordinate of curve end or
+ (number[][]) x-/y-coordinates of points to draw to
+ @param y (number) y-coordinate of curve end (omitted if x is array)
+ @param relative (boolean) true for coordinates relative to the current point,
+ false for coordinates being absolute
+ @return (SVGPath) this path */
+ smoothQ: function(x, y, relative) {
+ relative = (isArray(x) ? y : relative);
+ return this._coords((relative ? 't' : 'T'), x, y);
+ },
+
+ /* Generate a path command with (a list of) coordinates. */
+ _coords: function(cmd, x1, y1, x2, y2, x3, y3) {
+ if (isArray(x1)) {
+ for (var i = 0; i < x1.length; i++) {
+ var cs = x1[i];
+ this._path += (i == 0 ? cmd : ' ') + cs[0] + ',' + cs[1] +
+ (cs.length < 4 ? '' : ' ' + cs[2] + ',' + cs[3] +
+ (cs.length < 6 ? '': ' ' + cs[4] + ',' + cs[5]));
+ }
+ }
+ else {
+ this._path += cmd + x1 + ',' + y1 +
+ (x2 == null ? '' : ' ' + x2 + ',' + y2 +
+ (x3 == null ? '' : ' ' + x3 + ',' + y3));
+ }
+ return this;
+ },
+
+ /* Draw an arc to a position.
+ @param rx (number) x-radius of arc or
+ (number/boolean[][]) x-/y-coordinates and flags for points to draw to
+ @param ry (number) y-radius of arc (omitted if rx is array)
+ @param xRotate (number) x-axis rotation (degrees, clockwise) (omitted if rx is array)
+ @param large (boolean) true to draw the large part of the arc,
+ false to draw the small part (omitted if rx is array)
+ @param clockwise (boolean) true to draw the clockwise arc,
+ false to draw the anti-clockwise arc (omitted if rx is array)
+ @param x (number) x-coordinate of arc end (omitted if rx is array)
+ @param y (number) y-coordinate of arc end (omitted if rx is array)
+ @param relative (boolean) true for coordinates relative to the current point,
+ false for coordinates being absolute
+ @return (SVGPath) this path */
+ arc: function(rx, ry, xRotate, large, clockwise, x, y, relative) {
+ relative = (isArray(rx) ? ry : relative);
+ this._path += (relative ? 'a' : 'A');
+ if (isArray(rx)) {
+ for (var i = 0; i < rx.length; i++) {
+ var cs = rx[i];
+ this._path += (i == 0 ? '' : ' ') + cs[0] + ',' + cs[1] + ' ' +
+ cs[2] + ' ' + (cs[3] ? '1' : '0') + ',' +
+ (cs[4] ? '1' : '0') + ' ' + cs[5] + ',' + cs[6];
+ }
+ }
+ else {
+ this._path += rx + ',' + ry + ' ' + xRotate + ' ' +
+ (large ? '1' : '0') + ',' + (clockwise ? '1' : '0') + ' ' + x + ',' + y;
+ }
+ return this;
+ },
+
+ /* Close the current path.
+ @return (SVGPath) this path */
+ close: function() {
+ this._path += 'z';
+ return this;
+ },
+
+ /* Return the string rendering of the specified path.
+ @return (string) stringified path */
+ path: function() {
+ return this._path;
+ }
+});
+
+SVGPath.prototype.moveTo = SVGPath.prototype.move;
+SVGPath.prototype.lineTo = SVGPath.prototype.line;
+SVGPath.prototype.horizTo = SVGPath.prototype.horiz;
+SVGPath.prototype.vertTo = SVGPath.prototype.vert;
+SVGPath.prototype.curveCTo = SVGPath.prototype.curveC;
+SVGPath.prototype.smoothCTo = SVGPath.prototype.smoothC;
+SVGPath.prototype.curveQTo = SVGPath.prototype.curveQ;
+SVGPath.prototype.smoothQTo = SVGPath.prototype.smoothQ;
+SVGPath.prototype.arcTo = SVGPath.prototype.arc;
+
+/* Helper to generate an SVG text object.
+ Obtain an instance from the SVGWrapper object.
+ String calls together to generate the text and use its value:
+ var text = root.createText();
+ root.text(null, x, y, text.string('This is ').
+ span('red', {fill: 'red'}).string('!'), {fill: 'blue'}); */
+function SVGText() {
+ this._parts = []; // The components of the text object
+}
+
+$.extend(SVGText.prototype, {
+ /* Prepare to create a new text object.
+ @return (SVGText) this text */
+ reset: function() {
+ this._parts = [];
+ return this;
+ },
+
+ /* Add a straight string value.
+ @param value (string) the actual text
+ @return (SVGText) this text object */
+ string: function(value) {
+ this._parts[this._parts.length] = ['text', value];
+ return this;
+ },
+
+ /* Add a separate text span that has its own settings.
+ @param value (string) the actual text
+ @param settings (object) the settings for this text
+ @return (SVGText) this text object */
+ span: function(value, settings) {
+ this._parts[this._parts.length] = ['tspan', value, settings];
+ return this;
+ },
+
+ /* Add a reference to a previously defined text string.
+ @param id (string) the ID of the actual text
+ @param settings (object) the settings for this text
+ @return (SVGText) this text object */
+ ref: function(id, settings) {
+ this._parts[this._parts.length] = ['tref', id, settings];
+ return this;
+ },
+
+ /* Add text drawn along a path.
+ @param id (string) the ID of the path
+ @param value (string) the actual text
+ @param settings (object) the settings for this text
+ @return (SVGText) this text object */
+ path: function(id, value, settings) {
+ this._parts[this._parts.length] = ['textpath', value,
+ $.extend({href: id}, settings || {})];
+ return this;
+ }
+});
+
+/* Attach the SVG functionality to a jQuery selection.
+ @param command (string) the command to run (optional, default 'attach')
+ @param options (object) the new settings to use for these SVG instances
+ @return jQuery (object) for chaining further calls */
+$.fn.svg = function(options) {
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ if (typeof options == 'string' && options == 'get') {
+ return $.svg['_' + options + 'SVG'].apply($.svg, [this[0]].concat(otherArgs));
+ }
+ return this.each(function() {
+ if (typeof options == 'string') {
+ $.svg['_' + options + 'SVG'].apply($.svg, [this].concat(otherArgs));
+ }
+ else {
+ $.svg._attachSVG(this, options || {});
+ }
+ });
+};
+
+/* Determine whether an object is an array. */
+function isArray(a) {
+ return (a && a.constructor == Array);
+}
+
+// Singleton primary SVG interface
+$.svg = new SVGManager();
+
+})(jQuery);
diff --git a/js/jquery.svganim.min.js b/js/jquery.svganim.min.js new file mode 100755 index 0000000..09c432b --- /dev/null +++ b/js/jquery.svganim.min.js @@ -0,0 +1,7 @@ +/* http://keith-wood.name/svg.html
+ SVG attribute animations for jQuery v1.4.2.
+ Written by Keith Wood (kbwood{at}iinet.com.au) June 2008.
+ Dual licensed under the GPL (http://dev.jquery.com/browser/trunk/jquery/GPL-LICENSE.txt) and
+ MIT (http://dev.jquery.com/browser/trunk/jquery/MIT-LICENSE.txt) licenses.
+ Please attribute the author if you use it. */
+(function($){$.each(['x','y','width','height','rx','ry','cx','cy','r','x1','y1','x2','y2','stroke-width','strokeWidth','opacity','fill-opacity','fillOpacity','stroke-opacity','strokeOpacity','font-size','fontSize'],function(i,f){var g=f.charAt(0).toUpperCase()+f.substr(1);$.fx.step['svg'+g]=$.fx.step['svg-'+f]=function(a){var b=$.svg._attrNames[f]||f;var c=a.elem.attributes.getNamedItem(b);if(!a.set){a.start=(c?parseFloat(c.nodeValue):0);var d=a.options.curAnim['svg-'+f]||a.options.curAnim['svg'+g];if(/^[+-]=/.exec(d)){a.end=a.start+parseFloat(d.replace(/=/,''))}a.set=true}var e=(a.pos*(a.end-a.start)+a.start)+(a.unit=='%'?'%':'');(c?c.nodeValue=e:a.elem.setAttribute(b,e))}});$.fx.step['svgViewBox']=$.fx.step['svg-viewBox']=function(a){var b=a.elem.attributes.getNamedItem('viewBox');if(!a.set){a.start=parseViewBox(b?b.nodeValue:'');var c=a.options.curAnim['svg-viewBox']||a.options.curAnim['svgViewBox'];a.end=parseViewBox(c);if(/^[+-]=/.exec(c)){c=c.split(' ');while(c.length<4){c.push('0')}for(var i=0;i<4;i++){if(/^[+-]=/.exec(c[i])){a.end[i]=a.start[i]+parseFloat(c[i].replace(/=/,''))}}}a.set=true}var d=$.map(a.start,function(n,i){return(a.pos*(a.end[i]-n)+n)}).join(' ');(b?b.nodeValue=d:a.elem.setAttribute('viewBox',d))};function parseViewBox(a){var b=a.split(' ');for(var i=0;i<b.length;i++){b[i]=parseFloat(b[i]);if(isNaN(b[i])){b[i]=0}}while(b.length<4){b.push(0)}return b}$.fx.step['svgTransform']=$.fx.step['svg-transform']=function(a){var b=a.elem.attributes.getNamedItem('transform');if(!a.set){a.start=parseTransform(b?b.nodeValue:'');a.end=parseTransform(a.end,a.start);a.set=true}var c='';for(var i=0;i<a.end.order.length;i++){switch(a.end.order.charAt(i)){case't':c+=(a.start.translateX!=a.end.translateX||a.start.translateY!=a.end.translateY?' translate('+(a.pos*(a.end.translateX-a.start.translateX)+a.start.translateX)+','+(a.pos*(a.end.translateY-a.start.translateY)+a.start.translateY)+')':'');break;case's':c+=(a.start.scaleX!=a.end.scaleX||a.start.scaleY!=a.end.scaleY?' scale('+(a.pos*(a.end.scaleX-a.start.scaleX)+a.start.scaleX)+','+(a.pos*(a.end.scaleY-a.start.scaleY)+a.start.scaleY)+')':'');break;case'r':c+=(a.start.rotateA!=a.end.rotateA||a.start.rotateX!=a.end.rotateX||a.start.rotateY!=a.end.rotateY?' rotate('+(a.pos*(a.end.rotateA-a.start.rotateA)+a.start.rotateA)+','+(a.pos*(a.end.rotateX-a.start.rotateX)+a.start.rotateX)+','+(a.pos*(a.end.rotateY-a.start.rotateY)+a.start.rotateY)+')':'');break;case'x':c+=(a.start.skewX!=a.end.skewX?' skewX('+(a.pos*(a.end.skewX-a.start.skewX)+a.start.skewX)+')':'');case'y':c+=(a.start.skewY!=a.end.skewY?' skewY('+(a.pos*(a.end.skewY-a.start.skewY)+a.start.skewY)+')':'');break;case'm':var d='';for(var j=0;j<6;j++){d+=','+(a.pos*(a.end.matrix[j]-a.start.matrix[j])+a.start.matrix[j])}c+=' matrix('+d.substr(1)+')';break}}(b?b.nodeValue=c:a.elem.setAttribute('transform',c))};function parseTransform(a,b){a=a||'';if(typeof a=='object'){a=a.nodeValue}var c=$.extend({translateX:0,translateY:0,scaleX:0,scaleY:0,rotateA:0,rotateX:0,rotateY:0,skewX:0,skewY:0,matrix:[0,0,0,0,0,0]},b||{});c.order='';var d=/([a-zA-Z]+)\(\s*([+-]?[\d\.]+)\s*(?:[\s,]\s*([+-]?[\d\.]+)\s*(?:[\s,]\s*([+-]?[\d\.]+)\s*(?:[\s,]\s*([+-]?[\d\.]+)\s*[\s,]\s*([+-]?[\d\.]+)\s*[\s,]\s*([+-]?[\d\.]+)\s*)?)?)?\)/g;var e=d.exec(a);while(e){switch(e[1]){case'translate':c.order+='t';c.translateX=parseFloat(e[2]);c.translateY=(e[3]?parseFloat(e[3]):0);break;case'scale':c.order+='s';c.scaleX=parseFloat(e[2]);c.scaleY=(e[3]?parseFloat(e[3]):c.scaleX);break;case'rotate':c.order+='r';c.rotateA=parseFloat(e[2]);c.rotateX=(e[3]?parseFloat(e[3]):0);c.rotateY=(e[4]?parseFloat(e[4]):0);break;case'skewX':c.order+='x';c.skewX=parseFloat(e[2]);break;case'skewY':c.order+='y';c.skewY=parseFloat(e[2]);break;case'matrix':c.order+='m';c.matrix=[parseFloat(e[2]),parseFloat(e[3]),parseFloat(e[4]),parseFloat(e[5]),parseFloat(e[6]),parseFloat(e[7])];break}e=d.exec(a)}return c}$.each(['fill','stroke'],function(i,e){var f=e.charAt(0).toUpperCase()+e.substr(1);$.fx.step['svg'+f]=$.fx.step['svg-'+e]=function(a){if(!a.set){a.start=getColour(a.elem,e);var b=(a.end=='none');a.end=(b?getColour(a.elem.parentNode,e):getRGB(a.end));a.end[3]=b;a.set=true}var c=a.elem.attributes.getNamedItem(e);var d='rgb('+[Math.min(Math.max(parseInt((a.pos*(a.end[0]-a.start[0]))+a.start[0],10),0),255),Math.min(Math.max(parseInt((a.pos*(a.end[1]-a.start[1]))+a.start[1],10),0),255),Math.min(Math.max(parseInt((a.pos*(a.end[2]-a.start[2]))+a.start[2],10),0),255)].join(',')+')';d=(a.end[3]&&a.state==1?'none':d);(c?c.nodeValue=d:a.elem.setAttribute(e,d))}});function getColour(a,b){var c;do{c=(a.attributes&&a.attributes.getNamedItem(b)?a.attributes.getNamedItem(b).nodeValue:'');if((c!=''&&c!='none')||$(a).hasClass('hasSVG')){break}}while(a=a.parentNode);return getRGB(c)}function getRGB(a){var b;if(a&&a.constructor==Array&&(a.length==3||a.length==4)){return a}if(b=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(a)){return[parseInt(b[1],10),parseInt(b[2],10),parseInt(b[3],10)]}if(b=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(a)){return[parseFloat(b[1])*2.55,parseFloat(b[2])*2.55,parseFloat(b[3])*2.55]}if(b=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(a)){return[parseInt(b[1],16),parseInt(b[2],16),parseInt(b[3],16)]}if(b=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(a)){return[parseInt(b[1]+b[1],16),parseInt(b[2]+b[2],16),parseInt(b[3]+b[3],16)]}return h[$.trim(a).toLowerCase()]||h['none']}var h={'':[255,255,255,1],none:[255,255,255,1],aliceblue:[240,248,255],antiquewhite:[250,235,215],aqua:[0,255,255],aquamarine:[127,255,212],azure:[240,255,255],beige:[245,245,220],bisque:[255,228,196],black:[0,0,0],blanchedalmond:[255,235,205],blue:[0,0,255],blueviolet:[138,43,226],brown:[165,42,42],burlywood:[222,184,135],cadetblue:[95,158,160],chartreuse:[127,255,0],chocolate:[210,105,30],coral:[255,127,80],cornflowerblue:[100,149,237],cornsilk:[255,248,220],crimson:[220,20,60],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgoldenrod:[184,134,11],darkgray:[169,169,169],darkgreen:[0,100,0],darkgrey:[169,169,169],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkseagreen:[143,188,143],darkslateblue:[72,61,139],darkslategray:[47,79,79],darkslategrey:[47,79,79],darkturquoise:[0,206,209],darkviolet:[148,0,211],deeppink:[255,20,147],deepskyblue:[0,191,255],dimgray:[105,105,105],dimgrey:[105,105,105],dodgerblue:[30,144,255],firebrick:[178,34,34],floralwhite:[255,250,240],forestgreen:[34,139,34],fuchsia:[255,0,255],gainsboro:[220,220,220],ghostwhite:[248,248,255],gold:[255,215,0],goldenrod:[218,165,32],gray:[128,128,128],grey:[128,128,128],green:[0,128,0],greenyellow:[173,255,47],honeydew:[240,255,240],hotpink:[255,105,180],indianred:[205,92,92],indigo:[75,0,130],ivory:[255,255,240],khaki:[240,230,140],lavender:[230,230,250],lavenderblush:[255,240,245],lawngreen:[124,252,0],lemonchiffon:[255,250,205],lightblue:[173,216,230],lightcoral:[240,128,128],lightcyan:[224,255,255],lightgoldenrodyellow:[250,250,210],lightgray:[211,211,211],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightsalmon:[255,160,122],lightseagreen:[32,178,170],lightskyblue:[135,206,250],lightslategray:[119,136,153],lightslategrey:[119,136,153],lightsteelblue:[176,196,222],lightyellow:[255,255,224],lime:[0,255,0],limegreen:[50,205,50],linen:[250,240,230],magenta:[255,0,255],maroon:[128,0,0],mediumaquamarine:[102,205,170],mediumblue:[0,0,205],mediumorchid:[186,85,211],mediumpurple:[147,112,219],mediumseagreen:[60,179,113],mediumslateblue:[123,104,238],mediumspringgreen:[0,250,154],mediumturquoise:[72,209,204],mediumvioletred:[199,21,133],midnightblue:[25,25,112],mintcream:[245,255,250],mistyrose:[255,228,225],moccasin:[255,228,181],navajowhite:[255,222,173],navy:[0,0,128],oldlace:[253,245,230],olive:[128,128,0],olivedrab:[107,142,35],orange:[255,165,0],orangered:[255,69,0],orchid:[218,112,214],palegoldenrod:[238,232,170],palegreen:[152,251,152],paleturquoise:[175,238,238],palevioletred:[219,112,147],papayawhip:[255,239,213],peachpuff:[255,218,185],peru:[205,133,63],pink:[255,192,203],plum:[221,160,221],powderblue:[176,224,230],purple:[128,0,128],red:[255,0,0],rosybrown:[188,143,143],royalblue:[65,105,225],saddlebrown:[139,69,19],salmon:[250,128,114],sandybrown:[244,164,96],seagreen:[46,139,87],seashell:[255,245,238],sienna:[160,82,45],silver:[192,192,192],skyblue:[135,206,235],slateblue:[106,90,205],slategray:[112,128,144],slategrey:[112,128,144],snow:[255,250,250],springgreen:[0,255,127],steelblue:[70,130,180],tan:[210,180,140],teal:[0,128,128],thistle:[216,191,216],tomato:[255,99,71],turquoise:[64,224,208],violet:[238,130,238],wheat:[245,222,179],white:[255,255,255],whitesmoke:[245,245,245],yellow:[255,255,0],yellowgreen:[154,205,50]}})(jQuery);
\ No newline at end of file diff --git a/js/jquery.svgdom.js b/js/jquery.svgdom.js new file mode 100755 index 0000000..be0cf4a --- /dev/null +++ b/js/jquery.svgdom.js @@ -0,0 +1,355 @@ +/* http://keith-wood.name/svg.html
+ SVG/jQuery DOM compatibility for jQuery v1.4.2.
+ Written by Keith Wood (kbwood{at}iinet.com.au) April 2009.
+ Dual licensed under the GPL (http://dev.jquery.com/browser/trunk/jquery/GPL-LICENSE.txt) and
+ MIT (http://dev.jquery.com/browser/trunk/jquery/MIT-LICENSE.txt) licenses.
+ Please attribute the author if you use it. */
+
+(function($) { // Hide scope, no $ conflict
+
+/* Support adding class names to SVG nodes. */
+var origAddClass = $.fn.addClass;
+
+$.fn.addClass = function(classNames) {
+ classNames = classNames || '';
+ return this.each(function() {
+ if (isSVGElem(this)) {
+ var node = this;
+ $.each(classNames.split(/\s+/), function(i, className) {
+ var classes = (node.className ? node.className.baseVal : node.getAttribute('class'));
+ if ($.inArray(className, classes.split(/\s+/)) == -1) {
+ classes += (classes ? ' ' : '') + className;
+ (node.className ? node.className.baseVal = classes :
+ node.setAttribute('class', classes));
+ }
+ });
+ }
+ else {
+ origAddClass.apply($(this), [classNames]);
+ }
+ });
+};
+
+/* Support removing class names from SVG nodes. */
+var origRemoveClass = $.fn.removeClass;
+
+$.fn.removeClass = function(classNames) {
+ classNames = classNames || '';
+ return this.each(function() {
+ if (isSVGElem(this)) {
+ var node = this;
+ $.each(classNames.split(/\s+/), function(i, className) {
+ var classes = (node.className ? node.className.baseVal : node.getAttribute('class'));
+ classes = $.grep(classes.split(/\s+/), function(n, i) { return n != className; }).
+ join(' ');
+ (node.className ? node.className.baseVal = classes :
+ node.setAttribute('class', classes));
+ });
+ }
+ else {
+ origRemoveClass.apply($(this), [classNames]);
+ }
+ });
+};
+
+/* Support toggling class names on SVG nodes. */
+var origToggleClass = $.fn.toggleClass;
+
+$.fn.toggleClass = function(className, state) {
+ return this.each(function() {
+ if (isSVGElem(this)) {
+ if (typeof state !== 'boolean') {
+ state = !$(this).hasClass(className);
+ }
+ $(this)[(state ? 'add' : 'remove') + 'Class'](className);
+ }
+ else {
+ origToggleClass.apply($(this), [className, state]);
+ }
+ });
+};
+
+/* Support checking class names on SVG nodes. */
+var origHasClass = $.fn.hasClass;
+
+$.fn.hasClass = function(className) {
+ className = className || '';
+ var found = false;
+ this.each(function() {
+ if (isSVGElem(this)) {
+ var classes = (this.className ? this.className.baseVal :
+ this.getAttribute('class')).split(/\s+/);
+ found = ($.inArray(className, classes) > -1);
+ }
+ else {
+ found = (origHasClass.apply($(this), [className]));
+ }
+ return !found;
+ });
+ return found;
+};
+
+/* Support attributes on SVG nodes. */
+var origAttr = $.fn.attr;
+
+//BWB: is this what i need to do for css?
+$.fn.attr = function(name, value, type) {
+ if (typeof name === 'string' && value === undefined) {
+ var val = origAttr.apply(this, [name, value, type]);
+ return (val && val.baseVal ? val.baseVal.valueAsString : val);
+ }
+ var options = name;
+ if (typeof name === 'string') {
+ options = {};
+ options[name] = value;
+ }
+ return this.each(function() {
+ if (isSVGElem(this)) {
+ for (var n in options) {
+ this.setAttribute(n,
+ (typeof options[n] == 'function' ? options[n]() : options[n]));
+ }
+ }
+ else {
+ origAttr.apply($(this), [name, value, type]);
+ }
+ });
+};
+
+// BWB attempting to patch css manipulation of SVG
+//support manipulation of css styles
+var origCss = $.fn.css;
+
+$.fn.css = function(name, value, type) {
+ var revAttrName = function(name){
+ for (var jsName in $.svg._attrNames){
+ if ($.svg._attrNames[jsName] === name){
+ return jsName;
+ }
+ }
+ return name;
+ };
+
+ if (typeof name === 'string' && value === undefined) {
+ var val = origCss.apply(this, [name, value, type]);
+ return (val && val.baseVal ? val.baseVal.valueAsString : val);
+ }
+ var options = name;
+ if (typeof name === 'string') {
+ options = {};
+ options[name] = value;
+ }
+ return this.each(function() {
+ if (isSVGElem(this)) {
+ for (var n in options) {
+ //if Firefox
+ if (this.style.MozBinding === "") {
+ var jsName = revAttrName(n);
+ this.style[jsName] = options[n];
+ (typeof options[n] === 'function' ? options[n]() : options[n]);
+ } else {
+ this.style.setProperty(n,
+ typeof options[n] == 'function' ? options[n]() : options[n]);
+ }
+ }
+ }
+ else {
+ origCss.apply($(this), [name, value, type]);
+ }
+ });
+};
+
+
+/* Support removing attributes on SVG nodes. */
+var origRemoveAttr = $.fn.removeAttr;
+
+$.fn.removeAttr = function(name) {
+ return this.each(function() {
+ if (isSVGElem(this)) {
+ (this[name] && this[name].baseVal ? this[name].baseVal.value = '' :
+ this.setAttribute(name, ''));
+ }
+ else {
+ origRemoveAttr.apply($(this), [name]);
+ }
+ });
+};
+
+/* Update Sizzle selectors. */
+var origRelativeNext = $.expr.relative['+'];
+var origRelativeChild = $.expr.relative['>'];
+var origRelativeDescendant = $.expr.relative[''];
+var origRelativeSiblings = $.expr.relative['~'];
+var origFindId = $.expr.find.ID;
+var origFindTag = $.expr.find.TAG;
+var origPreFilterClass = $.expr.preFilter.CLASS;
+var origFilterClass = $.expr.filter.CLASS;
+var origFilterAttr = $.expr.filter.ATTR;
+
+/* Determine if any nodes are SVG nodes. */
+function anySVG(checkSet) {
+ for (var i = 0; i < checkSet.length; i++) {
+ if (checkSet[i].nodeType == 1 && checkSet[i].namespaceURI == $.svg.svgNS) {
+ return true;
+ }
+ }
+ return false;
+}
+
+$.expr.relative['+'] = function(checkSet, part, isXML) {
+ origRelativeNext(checkSet, part, isXML || anySVG(checkSet));
+};
+
+$.expr.relative['>'] = function(checkSet, part, isXML) {
+ origRelativeChild(checkSet, part, isXML || anySVG(checkSet));
+};
+
+$.expr.relative[''] = function(checkSet, part, isXML) {
+ origRelativeDescendant(checkSet, part, isXML || anySVG(checkSet));
+};
+
+$.expr.relative['~'] = function(checkSet, part, isXML) {
+ origRelativeSiblings(checkSet, part, isXML || anySVG(checkSet));
+};
+
+$.expr.find.ID = function(match, context, isXML) {
+ return (isSVGElem(context) ?
+ [context.ownerDocument.getElementById(match[1])] :
+ origFindId(match, context, isXML));
+};
+
+var div = document.createElement('div');
+div.appendChild(document.createComment(''));
+if (div.getElementsByTagName('*').length > 0) { // Make sure no comments are found
+ $.expr.find.TAG = function(match, context) {
+ var results = context.getElementsByTagName(match[1]);
+ if (match[1] === '*') { // Filter out possible comments
+ var tmp = [];
+ for (var i = 0; results[i] || results.item(i); i++) {
+ if ((results[i] || results.item(i)).nodeType === 1) {
+ tmp.push(results[i] || results.item(i));
+ }
+ }
+ results = tmp;
+ }
+ return results;
+ };
+}
+
+$.expr.preFilter.CLASS = function(match, curLoop, inplace, result, not, isXML) {
+ match = ' ' + match[1].replace(/\\/g, '') + ' ';
+ if (isXML) {
+ return match;
+ }
+ for (var i = 0, elem = {}; elem != null; i++) {
+ elem = curLoop[i];
+ if (!elem) {
+ try {
+ elem = curLoop.item(i);
+ }
+ catch (e) {
+ // Ignore
+ }
+ }
+ if (elem) {
+ var className = (!isSVGElem(elem) ? elem.className :
+ (elem.className ? elem.className.baseVal : '') || elem.getAttribute('class'));
+ if (not ^ (className && (' ' + className + ' ').indexOf(match) > -1)) {
+ if (!inplace)
+ result.push(elem);
+ }
+ else if (inplace) {
+ curLoop[i] = false;
+ }
+ }
+ }
+ return false;
+};
+
+$.expr.filter.CLASS = function(elem, match) {
+ var className = (!isSVGElem(elem) ? elem.className :
+ (elem.className ? elem.className.baseVal : elem.getAttribute('class')));
+ return (' ' + className + ' ').indexOf(match) > -1;
+};
+
+$.expr.filter.ATTR = function(elem, match) {
+ var handler = null;
+ if (isSVGElem(elem)) {
+ handler = match[1];
+ $.expr.attrHandle[handler] = function(elem){
+ var attr = elem.getAttribute(handler);
+ return attr && attr.baseVal || attr;
+ };
+ }
+ var filter = origFilterAttr(elem, match);
+ if (handler) {
+ $.expr.attrHandle[handler] = null;
+ }
+ return filter;
+};
+
+/*
+ Change Sizzle initialisation (line 1425) in jQuery v1.3.2 base code...
+
+ if ( toString.call(checkSet) === "[object Array]" ) {
+ if ( !prune ) {
+ results.push.apply( results, checkSet );
+ } else if ( context.nodeType === 1 ) {
+ for ( var i = 0; checkSet[i] != null; i++ ) {
+ if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && contains(context, checkSet[i])) ) {
+ results.push( set[i] || set.item(i) ); // Here
+ }
+ }
+ } else {
+ for ( var i = 0; checkSet[i] != null; i++ ) {
+ if ( checkSet[i] && checkSet[i].nodeType === 1 ) {
+ results.push( set[i] || set.item(i) ); // Here
+ }
+ }
+ }
+ }
+
+ Change fallback makeArray (line 2076) implementation in jQuery Sizzle...
+
+ if ( typeof array.length === "number" ) {
+ for ( var i = 0, l = array.length; i < l; i++ ) {
+ ret.push( array[i] || array.item(i) ); // Here
+ }
+ }
+*/
+
+/*
+ Events management requires changes to jQuery v1.3.2 base code...
+
+ In $.event.add (line 2437)...
+
+ if ( !jQuery.event.special[type] || jQuery.event.special[type].setup.call(elem, data, namespaces) === false ) {
+ // Bind the global event handler to the element
+ try { // Here
+ elem.addEventListener(type, handle, false);
+ }
+ catch(e) {
+ if (elem.attachEvent)
+ elem.attachEvent("on" + type, handle);
+ }
+ }
+
+ In $.event.remove (line 2521)...
+
+ if ( !jQuery.event.special[type] || jQuery.event.special[type].teardown.call(elem, namespaces) === false ) {
+ try { // Here
+ elem.removeEventListener(type, jQuery.data(elem, "handle"), false);
+ }
+ catch (e) {
+ if (elem.detachEvent)
+ elem.detachEvent("on" + type, jQuery.data(elem, "handle"));
+ }
+ }
+*/
+
+/* Does this node belong to SVG? */
+function isSVGElem(node) {
+ return (node.nodeType == 1 && node.namespaceURI == $.svg.svgNS);
+}
+
+})(jQuery);
diff --git a/js/kDoc.js b/js/kDoc.js new file mode 100755 index 0000000..cf14bc2 --- /dev/null +++ b/js/kDoc.js @@ -0,0 +1,24 @@ +$(document).ready( + function(){ + + var back = 'index.html'; + + var parseUrlParams = function(){ + var doc = ''; + var params = window.location.search.slice(1).split('&'); + if (params){ + back = params[0].split('=')[1]; + doc = params[1].split('=')[1]; + } + + $('#iframeLessonPlan').attr('src', "" + doc + ".html"); + }; + + var $kHeader = $('#kHeader').kHeader({title:"Lesson Plan", zoom: true}); + + + $('#kHeaderBackBtn').click(function(){ window.location = back; }); + + parseUrlParams(); + Karma.scaleToViewport(); +});
\ No newline at end of file diff --git a/js/karma.js b/js/karma.js new file mode 100755 index 0000000..3d29073 --- /dev/null +++ b/js/karma.js @@ -0,0 +1,1758 @@ +/* Documentation Note: + * Public methods and properties are commented with /** some text *\/ + * and private methods and properties are commented with // + * + * Please leave it that way to keep this documentation sane + */ + + +/* +* Karma Framework +* http://karmaeducation.org +* +* Copyright (c) 2009 +* Bryan W Berry bryan@olenepal.org +* Felipe López Toledo zer.subzero@gmail.com +* +* Under MIT License: +* Permission is hereby granted, free of charge, to any person +* obtaining a copy of this software and associated documentation +* files (the "Software"), to deal in the Software without +* restriction, including without limitation the rights to use, +* copy, modify, merge, publish, distribute, sublicense, and/or sell +* copies of the Software, and to permit persons to whom the +* Software is furnished to do so, subject to the following +* conditions: +* +* The above copyright notice and this permission notice shall be +* included in all copies or substantial portions of the Software. +* +* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +* OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +* NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +* HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +* WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +* FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +* OTHER DEALINGS IN THE SOFTWARE. +*/ + +/** +* @fileOverview Contains karma library +* @author Bryan Berry <bryan@olenepal.org> +* @author Felipe Lopez Toledo <zer.subzero@gmail.com> +*/ + + +//common.js modules use exports object +if(!this.exports) { + exports = {}; +} + + + +/** Karma is the namespace for the Karma library and Karma() is the constructor + * function for the Karma library object Karma. + * Karma() checks if the current document type is set to HTML 5, throws + * an error if not. Otherwise, initializes the karma object and returns + * a reference to that object. + * @namespace Global namespace for Karma library + * @constructor + * @param {Object} [options={}] options for intializing Karma library + * @param {String} [options.locale=''] sets current locale Not Yet Implemented + * @param {Array} [options.image=[]] array of images to be converted into a collection + * @param {Array} [options.audio=[]] array of audio to be converted into a collection + * @param {Array} [options.video=[]] NYI array of videos to be converted into a collection + * @param {Array} [options.svg=[]] array of SVG elements to be + * converted into a collection. Each SVG element must already exist in the html document + * @param {Array} [options.canvas=[]] array of canvas elements + * to be converted into a collection. Each canvas element must already exist in the + * html document and width and height of each element must be set as attributes + * @throws {Error} if the document type declaration is not set to HTML 5, e.g. + * <!DOCTYPE html> + * @throws {Error} If any of the initialization parameters are invalid values + * @returns {Object} Karma -- reference to the initialized Karma library + * @example + * + * var k = Karma({ + * image: [ + * {name: "ninja", file: "ninja.png"}, + * {name: "cowboy", file: "cowboy.png"} + * ], + * audio: [ + * {name: "woosh", file: "woosh.ogg"}, + * {name: "yeehaw", file: "yeehaw.ogg"} + * ], + * video: [ //Not Yet Implemented + * {name: "attack", file: "attack.ogv"}, + * {name: "ride", file: "ride.ogv"} + * ] + * canvas: [ + * {name: "ninja", domId: "ninjaCanvas"}, + * {name: "cowboy", domId: "cowboyCanvas"} + * ], + * svg: [ + * {name: "ninja", domId: "ninjaSvg"}, + * {name: "cowboy", domId: "cowboySvg"} + * ], + * }); + * Next, call the ready function with a callback to your program code + * + * k.ready(function () { ... your application code . . . } + * + * after that you can access each asset like so + * k.image.ninja; + * k.svg.cowboy; + * k.audio.yeehaw.play(); + * k.canvas.ninja.drawImage(k.image.ninja, 0, 0); + * + */ +var Karma = exports.Karma = function (options) { + Karma._isHtml5(document.doctype.nodeName); + + if ( Karma._initialized === true ) { + return Karma; + } else { + return Karma._init(options); + } +}; + + +//helper functions + +/**This emulates the Object.create method in ecmascript 5 spec + * This isn't a full implementation as it doesn't support an all of Object.create's features + * This has the same functionality as Crockford's beget method + * and this primary building block for prototypal inheritance in + * this library + * @param {Object} parent that the new object's prototype should point to + * @returns {Object} a new object whose prototype is parent + * @example + * + * var ninja = { weapon : "sword" }; + * var ninja1 = Karma.create(ninja); + * ninja1.weapon === "sword" + */ +Karma.create = function (parent){ + function F () {}; + F.prototype = parent; + return new F(); +}; + +/** Returns a shallow copy of the passed in object + * @param {Object} target to be copied + * @returns {Object} a shallow copy of target + */ +Karma.clone = function (target){ + var copy = {}; + for ( var i in target ) { + if(target.hasOwnProperty(i)){ + copy[i] = target[i]; + } + } + return copy; +}; + +/** Extends properties of the target object with those of + * the source object + * @param {Object} target object to be extended + * @param {Object} source whose properties will extend target + * @returns {Object} target extended by source + */ +Karma.objectPlus = function (target, source){ + for ( var i in source){ + if (source.hasOwnProperty(i)){ + target[i] = source[i]; + } + } + return target; +}; + +Karma.extend = Karma.objectPlus; + +/** Creates a new object that is a prototype of the first argument + * then extends it with the properties of the second argument + * @param {Object} parent1 will be prototype of returned object + * @param {Object} parent2 will extend properties of returned object + * @returns {Object} object that whose prototype is parent1 and has + * been extended with properties of parent2 + */ +Karma.copyObjectPlus = function (parent1, parent2){ + function F () {}; + F.prototype = parent1; + var G = new F(); + return Karma.objectPlus(G, parent2); +}; + + +//Throws big ugly error if doctype isn't html5 +Karma._isHtml5 = function (doctype){ + var regex = new RegExp('^html$', 'i'); + if(!regex.test(doctype)){ + var errorMsg = "ERROR: The doctype must be set to <!DOCTYPE html> " + + "in order to use Karma. Karma require you use html5"; + var errorElem = document.createElement('div'); + errorElem.setAttribute('id', 'errorDoctype'); + errorElem.innerText = errorMsg; + document.body.appendChild(errorElem); + throw new Error(errorMsg); + } +}; + +/** + * Shuffles an array of items randomly + * @param {Array} oldList of choices to be shuffled + * @returns {Array} newlist of choices randomly reordered + */ +Karma.shuffle = function (oldList) { + var newList = oldList.slice(0); + for (var i = newList.length - 1; i > 0; i -= 1) { + var j = Karma.rand(0, i); + var t = newList[i]; + newList[i] = newList[j]; + newList[j] = t; + } + return newList; +}; + + +/** + * Converts a number to numerals in the specified locale. Currently only + * supports Nepali + * @param {Number} Number to be converted + * @param {locale} locale that number should be converted to + * @returns {String} Unicode string for localized numeral + */ +Karma.convertNumToLocale = function(num, locale){ + locale = locale || Karma.locale; + //48 is the base for western numerals + var convertDigit = function(digit){ + + var numBase = 48; + var prefix = "u00"; + + if (locale === "ne"){ + prefix = "u0"; + numBase = 2406; + } + + return '\\' + prefix + + (numBase + parseInt(digit)).toString(16); + }; + + var charArray = num.toString().split("").map(convertDigit); + return eval('"' + charArray.join('') + '"'); +}; + +/** + * @name Karma._n + * @function + * @public + * Alias for Karma.convertNumToLocale. Converts a number to numerals to + * Karma.locale or to specified locale. Currently only supports Nepali + * @param {Number} Number to be converted + * @param {locale} locale that number should be converted to + * @returns {String} Unicode string for localized numeral + */ +Karma._n = Karma.convertNumToLocale; + +/* Scales the dimensions of document.body to the innerHeight and innerWidth + * of the viewport, i.e. browser window, with a minor offset to the height to + * make sure the scrollbars do not appear + */ +Karma.scaleToViewport = function(){ + var width = window.innerWidth; + var height = window.innerHeight; + + //hack to ensure scrollbars don't appear + if (height === 900){ + height = "" + 900 + "px"; + } else { + height = "" + (height - 13) + "px"; + } + + document.body.style.width = "" + width + "px"; + document.body.style.height = height; +}; + +Karma.scaleWindow = function(){ + var width = "1200px"; + var height = "900px"; + var viewportHeight = "760px"; + var $body = $('body'); + var $kMain = $('#kMain'); + + if (window.innerWidth < 1150){ + width = "950px"; + height = "600px"; + viewportHeight = "460px"; + $body.css('border', '2px solid black'); + + // 460/760 * 16 = 9.6 + $kMain.css('font-size', '9.6px'); + } + + $body.css({border: '2px solid black', width: width, height: height}); + $kMain.css({width: width, height: viewportHeight}); + + +}; + + // Below are geometry and math helper methods + +/** + * Converts a value from degrees to radians. + * @param {Number} angle The angle in degrees + * @returns {Number} The angle in radians + */ +Karma.radians = function( angle ){ + return ( angle / 180 ) * Math.PI; +}; + +/** + * Gets the square of the Euclidian (ordinary) distance between 2 points. + * @param {Object} Point No. 0 + * @param {Number} Point0.x + * @param {Number} Point0.y + * @param {Object} Point No. 1 + * @param {Number} Point1.x + * @param {Number} Point1.y + * @returns {Number} The square of the Euclidian distance + * @example + * + * p0 = {x:0, y:1}; + * p1 = {x:50, y:70}; + * var d = distance2(p0, p1); + * + */ +Karma.distance2 = function ( p0, p1 ) { + return (p1.x - p0.x) * (p1.x - p0.x) + (p1.y - p1.y) * (p1.y - p1.y); +}; + +/** + * Gets the Euclidian (ordinary) distance between 2 points.<br> + * <b>Warning:</b> It's slower than distance2 function + * @param {Object} Point No. 0 + * @param {Number} Point0.x + * @param {Number} Point0.y + * @param {Object} Point No. 1 + * @param {Number} Point1.x + * @param {Number} Point1.y + * @returns {Number} The Euclidian distance + * @example + * + * p0 = {x:0, y:1}; + * p1 = {x:50, y:70}; + * var d = distance2(p0, p1); + * + */ +Karma.distance = function ( p0, p1 ) { + return Math.sqrt( this.distance2( p0, p1 ) ); +}; + +/** Returns a random number within the range provided + * @param {Number} lower limit of the range, lowest number that can be returned + * @param {Number} upper limit of the range, highest number that can be returned + * @returns {Number} number that is >= lower and <= upper + * @example + * + * var num = rand(0, 10); + * + * //num could be 0, 1, 2, 3 ... or 10 + * + */ +Karma.rand = function ( lower, upper ){ + return Math.floor(Math.random() * (upper - lower + 1) + lower); +}; + + +Karma.extend(Karma, { + /** This is the global locale as passed to Karma(), + * such as "en", "es_SP" + * @fieldOf Karma + * @property {string} locale This is the global locale as passed to Karma() + * @default 'en' + */ + locale : 'en', + /** Collection of images with special helper + * methods added to each reference + * @fieldOf Karma + * @type object + * @default empty object + */ + image : {}, + /** Collection of audio files with special helper + * methods added to each reference + * @fieldOf Karma + * @type object + * @default empty object + */ + audio : {}, + /** Collection of html 5 canvases with special helper + * methods added to each reference + * @fieldOf Karma + * @type object + * @default empty object + */ + canvas : {}, + /** Collection of svgs with special helper + * methods added to each reference + * @fieldOf Karma + * @type object + * @default empty object + */ + svg : {}, + /** Collection of videos with special helper + * methods added to each reference + * @fieldOf Karma + * @type object + * @default empty object + */ + video : {}, + _localized : false, + _assetPath : "assets/", + _localePath : "", + _initialized : false, + _statusDiv: undefined, + _loaderDiv : undefined, + _counters : { total : 0, errors : 0, loaded : 0}, + + //This constructs the Karma object per values provided by the user + _init: function(options) { + this._initialized = true; + + //set up message that show count of assets loaded + //and has an ordered list to append error messages to + var _statusDiv = this._statusDiv = document.createElement('div'); + this._loaderDiv = this._loaderDiv = document.createElement('div'); + var errorList = document.createElement('ol'); + + _statusDiv.setAttribute('id', 'karma-status'); + _statusDiv.setAttribute('style', 'position:absolute;'); + _statusDiv.innerHTML = 'Karma is loading ...'; + this._loaderDiv.setAttribute('id', 'karma-loader'); + this._loaderDiv.setAttribute('class', 'status'); + errorList.setAttribute('id', 'errorList'); + + _statusDiv.appendChild(this._loaderDiv); + this._statusDiv.appendChild(errorList); + document.body.appendChild(_statusDiv); + + //regular expression that matches the name of aprivate property + // the karma object + var regexPrivate = new RegExp('^_.*'); + + for ( var option in options ) { + if (options.hasOwnProperty(option)){ + if (option === "image" || option === "audio" || option === + "svg" || option === "video" || option === "canvas"){ + + if(!(options[option] instanceof Array)){ + throw new Error("" + option + " must be an array"); + } else if (options[option].length === 0){ + continue; + } + } else if (regexPrivate.test(option)){ + //don't overwrite a private property of karma object + continue; + } + + switch (option){ + case "locale": + + if (this._isValidLocale(options[option])){ + this.locale = this._normalizeLocale(options[option]); + this._localized = true; + this._localePath = Karma._computeLocalePath(this.locale); + } else { + throw new Error("locale provided to karma._init() is invalid"); + } + + break; + case "image": + options[option]._type = 'image'; + Karma._makeCollection(options[option], 'image'); + break; + case "audio": + options[option]._type = 'audio'; + Karma._makeCollection(options[option], 'audio'); + break; + case "video": + options[option]._type = 'video'; + Karma._makeCollection(options[option], 'video'); + break; + case "svg": + options[option]._type = 'svg'; + Karma._makeCollection(options[option], 'svg'); + break; + case "canvas": + options[option]._type = 'canvas'; + Karma._makeCollection(options[option], 'canvas'); + break; + } + } + } + + + + return this; + }, + + /** Waits until all assets loaded(ready), then calls callback cb + * @memberOf Karma + * @param {Function} [cb] callback function + * @returns this + * @throws {Error} if Karma is not initialized with the + * Karma({ options }) function + * @example + * + * var k = Karma({ . . . your assets here . . . }); + * k.ready(function(){ .. your code here . . .}); + * + * your code will not be called until all assets have been loaded + * into collections + * + */ + ready : function( cb ) { + var that = this; + if (Karma._initialized !== true){ + throw new Error("Karma not initialized"); + } + + if (this._counters.loaded !== this._counters.total){ + setTimeout(function(){ that.ready(cb);}, 5); + } else if (cb) { + //hide the "Karma is loading..." message + this._statusDiv.setAttribute('style', 'display:none;'); + + cb(); + } else if (!cb) { + //hide the "Karma is loading..." message + this._statusDiv.setAttribute('style', 'display:none;'); + + //if no options passed, show it works message + this._showStarterMessage(); + } + + + + + return this; + }, + + //Display Apache-like "It works" message if no options + _showStarterMessage : function (){ + var starterMsg = document.createElement('div'); + starterMsg.setAttribute('id', 'starterMsg'); + starterMsg.innerHTML = "<h1>It Works</h1>"; + document.body.appendChild(starterMsg); + }, + + //Updates visible counter of how many assets are loaded + _updateStatus : function (errorMsg) { + var loaded = this._counters.loaded; + var total = this._counters.total; + var errors = this._counters.errors; + this._loaderDiv.innerHTML = "Loaded " + loaded + " / " + total + + "" + (errors > 0 ? " Errors [ " + errors +" ]" : ''); + if (errorMsg) { + var liError = document.createElement('li'); + liError.innerHTML = errorMsg; + var errorList = document.getElementById('errorList'); + errorList.appendChild(liError); + } + }, + + //matches 2 letter country code then optionally + //a dash or underscore followed by a country or language identifier + //i currently only allow a language identifier 2-3 chars long + _isValidLocale : function (locale) { + var localeRegex = new RegExp('^[a-zA-Z][a-zA-Z]([-_][a-zA-z]{2,3})?$'); + return localeRegex.test(locale); + }, + + _normalizeLocale : function(locale) { + var lang = ""; + var country = ""; + var divider = ""; + + lang = locale.slice(0, 2).toLowerCase(); + divider = "_"; + country = locale.slice(3, 6).toUpperCase(); + + return locale.length > 2 ? "" + lang + divider + country : lang; + }, + + + +}); + +//Helper functions for creating assets +Karma._isLocalized = function (boolLocalized) { + if (typeof boolLocalized === "boolean" ) { + if(boolLocalized === true && + Karma.locale === undefined){ + throw new Error("You cannot localize a media asset" + + " if the global locale for Karma isn't set"); + } else { + return boolLocalized; + } + } else if (typeof boolLocalized === undefined){ + return false; + } else{ + throw new Error("This is not a valid value for the localized option"); + } +}; + +Karma._computeLocalePath = function(locale) { + return Karma._assetPath + locale + "/"; +}; + + + + +Karma._makeCollection = function (configs, type){ + var makeAsset = function (config){ + var asset = undefined; + var target = undefined; + switch(type){ + case "image": + target = Karma.kImage; + break; + case "audio": + target = Karma.kAudio; + break; + case "video": + target = Karma.kVideo; + break; + case "svg": + target = Karma.kSvg; + break; + case "canvas": + target = Karma.kCanvas; + break; + } + + asset = Karma.create(target)._init(config); + Karma[type][config.name] = asset; + }; + + configs.forEach(function(config){ makeAsset(config);}); +}; + + + + + +//Prototype objects for assets + + +/** Prototype object for images + * @class This object is the prototype for images submitted to Karma in the + * Karma() method + * @ throws {Error} if the image asset is set to be localized but + * the global locale is not set on the Karma object + * @ throws {Error} if the name and file properties are not supplied + * @example + * kImage is the prototype object for images. This 'media' asset is loaded + * in a distinctly different way from the canvas or svg assets. + * + */ +Karma.kImage = + { + /** file location of image + * @type String + * @default "" + */ + file : "", + /** media object + * @type Image + * @default undefined + */ + media : undefined, + //actual path to the file + _path : "", + //if using localized version of this image + _localized : false, + _type : "image", + //initializes kImage instance with values provided by user + _init : function (image) { + image._localized = image._localized || false; + Karma._counters.total++; + + if (image.name === undefined || image.file === undefined){ + throw new Error("properties name and file have to be defined"); + } else { + this.name = image.name; + this.file = image.file; + } + + this.media = new Image(); + + if(Karma._isLocalized(image._localized)){ + this._localized = image._localized; + this._path = Karma._localePath + "image/"; + } else { + this._path = Karma._assetPath + "image/"; + } + + //IMPORTANT: This one magic line loads the file + this.media.src = this.src = this._path + this.file; + + //add event handlers + this._addEventHandlers(); + + + return this; + }, + //Adds event handlers to update the counters when + //the image is successfully or unsuccessfully loaded + _addEventHandlers : function () { + var that = this; + + that.media.addEventListener( + "load", + function (e) { + Karma._counters.loaded++; + Karma._updateStatus(); + that.status = "loaded";}, false); + + that.media.addEventListener( + "error", + function (e) { + Karma._counters.errors++; + that.status = "error"; + var errorMsg = "Error: " + that._type.toUpperCase() + + " " + that.name + " cannot be loaded."; + Karma._updateStatus(errorMsg); + }, + false); + that.media.addEventListener( + "abort", + function (e) { + Karma._counters.total++; + that.status = "aborted"; + var errorMsg = "ABORT: " + that._type.toUpperCase() + + " " + that.name + " loading was aborted."; + Karma._updateStatus(errorMsg); + + }, false); + } + +}; + +/** Prototype object for audio files + * @class This object is the prototype for audio files submitted to Karma in the + * Karma() method + * @ throws {Error} if the individual audio asset is set to be localized but + * the globale locale is not set on the Karma object + * @ throws {Error} if the name and file properties are not supplied + * @example + * kAudio is the prototype object for audio + * The audio assets are loaded in a distinctly different way + * from the canvas or svg assets. They also have distinctly different + * helper methods + * + * You initialize the kAudio assets by passing an array of objects + */ +Karma.kAudio = { + /** file location of asset + * @type String + * @default "" + */ + file : "", + /** Media object. You can access the src, autobuffer, autoplay, loop, and + * controls attributes + * via the media property of kAudio. Read more about the properties of the <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/video.html#media-element-attributes">HTML 5 media element</a> + * @type Audio + * @default undefined + */ + media : undefined, + //actual path to the file + _path : "", + //if using localized version of this asset + _localized : false, + _type : "audio", + //initializes kAudio instance with values provided by user + _init : function (audio) { + audio._localized = audio._localized || false; + Karma._counters.total++; + + if (audio.name === undefined || audio.file === undefined){ + throw new Error("properties name and file have to be defined"); + } else { + this.name = audio.name; + this.file = audio.file; + } + + this.media = new Audio(); + + if(Karma._isLocalized(audio._localized)){ + this._localized = audio._localized; + this._path = Karma._localePath + "audio/"; + } else { + this._path = Karma._assetPath + "audio/"; + } + + + //IMPORTANT: This one magic line loads the file + this.media.src = this.src = this._path + this.file; + + //add event handlers + this._addEventHandlers(); + + this.media.autobuffer = true; + this.media.load(); + + + return this; + }, + //Adds event handlers to update the counters when + //the asset is successfully or unsuccessfully loaded + _addEventHandlers : function () { + var that = this; + //'canplaythrough' event is a Browser Hack recommended by chromium devs + //http://code.google.com/p/chromium/issues/detail?id=20251&q=loading%20audio&colspec=ID%20Stars%20Pri%20Area%20Type%20Status%20Summary%20Modified%20Owner%20Mstone%20OS#c4 + + that.media.addEventListener( + "canplaythrough", + function (e) { + Karma._counters.loaded++; + Karma._updateStatus(); + that.status = "loaded";}, false); + + that.media.addEventListener( + "error", + function (e) { + Karma._counters.errors++; + that.status = "error"; + var errorMsg = "Error: " + that._type.toUpperCase() + + " " + that.name + " cannot be loaded."; + Karma._updateStatus(errorMsg); + }, + false); + that.media.addEventListener( + "abort", + function (e) { + Karma._counters.total++; + that.status = "aborted"; + var errorMsg = "ABORT: " + that._type.toUpperCase() + + " " + that.name + " loading was aborted."; + Karma._updateStatus(errorMsg); + + }, false); + + }, + /** Plays the audio file */ + play : function () { + this.media.play(); + } + +}; + +/** NYI:Prototype object for Video files + * @class Not Yet Implemented:This object is the prototype for video files submitted + * to Karma in the Karma() method + * @ throws {Error} if the individual video asset is set to be localized but + * the globale locale is not set on the Karma object + * @ throws {Error} if the name and file properties are not supplied + */ +Karma.kVideo = { + /** file location of asset + * @type String + * @default "" + */ + file : "", + /** media object + * @type Video + * @default undefined + */ + media : undefined, + //actual path to the file + _path : "", + //if using localized version of this asset + _localized : false, + _type : "video", + //initializes kVideo instance with values provided by user + _init : function (video) { + //Not Yet Implemented + Karma._counters.errors++; + throw new Error("Video is not Yet Implemented"); + + video._localized = video._localized || false; + Karma._counters.total++; + + if (video.name === undefined || video.file === undefined){ + throw new Error("properties name and file have to be defined"); + } else { + this.name = video.name; + this.file = video.file; + } + + this.media = new Video(); + + if(Karma._isLocalized(video._localized)){ + this._localized = video._localized; + this._path = Karma._localePath + "video/"; + } else { + this._path = Karma._assetPath + "video/"; + } + + + //IMPORTANT: This one magic line loads the file + this.media.src = this.src = this._path + this.file; + + //add event handlers + this._addEventHandlers(); + + return this; + }, + //Adds event handlers to update the counters when + //the asset is successfully or unsuccessfully loaded + _addEventHandlers : function () { + var that = this; + //'canplaythrough' event is a Browser Hack recommended by chromium devs + //http://code.google.com/p/chromium/issues/detail?id=20251&q=loading%20audio&colspec=ID%20Stars%20Pri%20Area%20Type%20Status%20Summary%20Modified%20Owner%20Mstone%20OS#c4 + + that.media.addEventListener( + "canplaythrough", + function (e) { + Karma._counters.loaded++; + Karma._updateStatus(); + that.status = "loaded";}, false); + + that.media.addEventListener( + "error", + function (e) { + Karma._counters.errors++; + that.status = "error"; + var errorMsg = "Error: " + that._type.toUpperCase() + + " " + that.name + " cannot be loaded."; + Karma._updateStatus(errorMsg); + }, + false); + that.media.addEventListener( + "abort", + function (e) { + Karma._counters.total++; + that.status = "aborted"; + var errorMsg = "ABORT: " + that._type.toUpperCase() + + " " + that.name + " loading was aborted."; + Karma._updateStatus(errorMsg); + + }, false); + + } + +}; + + + +/** Prototype object for each canvas element submitted to Karma in the + * Karma() method + * @throws {Error} if the name and domId for the canvas element are not specified + * @thows {Error} if the supplied domId does not match an element in the DOM + * @class This object is the prototype for each canvas element submitted to Karma in the + * Karma() method + */ +Karma.kCanvas = { + /** Name of the canvas, used internally by karma.js + * @type String + * @default '' + */ + name : '', + /** Width of canvas element + * @type Number + * @default 0 + */ + width: 0, + /** Height of canvas element + * @type Number + * @default 0 + */ + height: 0, + /** Whether canvas is visible + * @type boolean + * @default true + */ + visible: true, + /** Element ID for canvas element in html document. This value is read-only + * @type String + * @default undefined + */ + domId: undefined, + /** Reference to the DOM element + * @type DOMElement + * @default undefined + * @example + * //You can access all properties and methods of the underlying DOM element + * //using the 'node' property + * Karma.canvas.someCanvas.node.dispatchEvent( ... some event ...); + * var stuff = Karma.canvas.someCanvas.node.innerHTML; + * + */ + node: undefined, + /** The 2 Dimensional Rendering context property for this canvas + * @type 2DRenderingContext + * @default undefined + * @example + * //Almost all of the context attributes and methods are wrapped in helper functions + * //but you can also access them directly using the ctx property + * Karma.canvas.someCanvas.ctx.drawImage(someImage, x, y); + * Karma.canvas.someCanvas.ctx.fillStyle = "#ffffff"; + */ + ctx: undefined, + + //initializes object with values provides by user + _init: function (config) { + for (var option in config){ + if (config.hasOwnProperty(option)){ + switch (option){ + case "name": + this.name = config[option]; + break; + case "domId": + this.domId = config[option]; + break; + case "width": + if(!this.height){ + throw new Error("If you specify a width you must also" + + "specify a height"); + } + this.width = config[option]; + break; + case "height": + if(!this.width){ + throw new Error("If you specify a height you must also" + + "specify a width"); + } + this.height = parseInt(config.option, 10); + break; + case "fps": + this.fps = parseInt(config.option, 10); + break; + } + } + } + + if(this.domId && document.getElementById(this.domId)){ + this.node = document.getElementById(this.domId); + this.ctx = this.node.getContext('2d'); + } else { + throw new Error('you must specify a valid domId that' + + 'is in your html page'); + } + + if(!config.height && !config.width){ + this.width = parseInt(this.node.getAttribute('width'), 10); + this.height = parseInt(this.node.getAttribute('height'), 10); + } + + return this; + }, + /** Clear area of canvas element specified by parameters, if no + * parameters supplied, clears entire canvas + * @param {Number} [x=0] x coordinate, defaults to zero if left blank + * @param {Number} [y=0] y coordinate, defaults to zero if left blank + * @param {Number} [width=0] width of area to be cleared, defaults + * entire width of canvas + * @param {Number} [height=0] height of area to be cleared, defaults + * entire height of canvas + * @returns this + * @example + * + * k.canvas.ninja.clear(); + * // clears the entire ninja canvas + * + * k.canvas.ninja.clear(0, 10, 20, 30); + * //clears a specific portion of the ninja canvas + * + */ + clear : function ( x, y, width, height ) { + var that = this; + that.ctx.clearRect( + x || 0, + y || 0, + width || that.width, + height || that.height + ); + return that; + }, + + /** The globalAlpha attribute gives an alpha value that is applied to shapes + * and images before they are composited onto the canvas + * @param {Number} number in the range from 0.0 to 1.0 + * @returns this + */ + globalAlpha : function (attribute){ + var name = 'globalAlpha'; + this.ctx[name] = attribute; + return this; + }, + + /** Sets the globalCompositeOperation attribute, which sets how shapes and images + * are drawn onto the existing bitmap, once they have had globalAlpha and the + * current transformation matrix applied. + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param {String} globalCompositeOperation source-atop, + * source-in, source-out, + * source-over, destination-atop, destination-in, destination-out, destination-over, + * lighter + * @returns this + */ + globalCompositeOperation: function (attribute){ + var name = ' globalCompositeOperation'; + this.ctx[name] = attribute; + return this; + }, + + /** Sets the lineWidth attribute which gives the width of lines, in coordinate space + * units. + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param {Number} lineWidth + * @returns this + */ + lineWidth: function (attribute){ + var name = 'lineWidth'; + this.ctx[name] = attribute; + return this; + }, + /** The lineCap attribute defines the type of endings that UAs will place on + * the end of lines. + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param {String} type butt, round, square + * @returns this + */ + lineCap: function (attribute){ + var name = 'lineCap'; + this.ctx[name] = attribute; + return this; + }, + /** The lineJoin attribute defines the type of corners that UAs will place + * where two lines meet. The three valid values are bevel, round, and miter. + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param {String} type + * @returns this + */ + lineJoin: function (attribute){ + var name = 'lineJoin'; + this.ctx[name] = attribute; + return this; + }, + + /** Sets the miter limit + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param {Number} number + * @returns this + */ + miterLimit: function (attribute){ + var name = 'miterLimit'; + this.ctx[name] = attribute; + return this; + }, + /** Sets the font property and takes the same syntax as setting the font property + * in CSS + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param {String} + * @returns this + */ + font: function (attribute){ + var name = 'font'; + this.ctx[name] = attribute; + return this; + }, + + /** Changes the text alignment. The possible values are start, end, left, right, + * and center. The default is start. Other values are ignored. + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param {string} alignment + * @returns this + */ + textAlign: function (attribute){ + var name = 'textAlign'; + this.ctx[name] = attribute; + return this; + }, + + /** Changes the baseline alignment. If the value is one of top, hanging, middle, + * alphabetic, ideographic, or bottom, then the value must be changed to the new value. + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param {String} alignment + * @returns this + */ + textBaseline: function (attribute){ + var name = 'textBaseline'; + this.ctx[name] = attribute; + return this; + }, + + /** Save the current state of the context + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + save : function ( ){ + var name = 'save'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** Restore the saved context + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + restore : function ( ){ + var name = 'restore'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** Perform a scale transformation + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + scale : function ( ){ + var name = 'scale'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** Perform a rotation transformation + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + rotate : function ( ){ + var name = 'rotate'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** Performa a translation transformation + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + translate : function ( ){ + var name = 'translate'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + + /** Transform the identity matrix + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + transform : function ( ){ + var name = 'transform'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** Set the transform + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + setTransform : function ( ){ + var name = 'setTransform'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** Clear a rectangular area + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + clearRect : function ( ){ + var name = 'clearRect'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** Fill a rectangular area + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + fillRect : function ( ){ + var name = 'fillRect'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + + /** Draw the outline of the rectangle + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + strokeRect : function ( ){ + var name = 'strokeRect'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** Begin a path + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + beginPath : function ( ){ + var name = 'beginPath'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** End a path + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + closePath : function ( ){ + var name = 'closePath'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** Move to specified coordinates + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + moveTo : function ( ){ + var name = 'moveTo'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + + + /** Draw a line to the given coordinates + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + lineTo : function ( ){ + var name = 'lineTo'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + + /** Draw a quadratic curve to given coordinates + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + quadraticCurveTo : function ( ){ + var name = 'quadraticCurveTo'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** Draw a bezier curve to given coordinates + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + bezierCurveTo : function ( ){ + var name = 'bezierCurveTo'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** Draw an arc to the given points + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + arcTo : function ( ){ + var name = 'arcTo'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** Create an arc + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + arc : function ( ){ + var name = 'arc'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + + /** Create a rectangle + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + rect : function ( ){ + var name = 'rect'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** fill in the current subpaths with the current fillstyle + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + fill : function ( ){ + var name = 'fill'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** Stroke the subpaths + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + stroke : function ( ){ + var name = 'stroke'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + + /** description + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + clip : function ( ){ + var name = 'clip'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** description + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + fillText : function ( ){ + var name = 'fillText'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** description + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + strokeText : function ( ){ + var name = 'strokeText'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** description + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + measureText : function ( ){ + var name = 'measureText'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** description + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + isPointInPath : function ( ){ + var name = 'isPointInPath'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + + /** Sets the stroke style + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + strokeStyle: function (attribute){ + var name = 'strokeStyle'; + this.ctx[name] = attribute; + return this; + }, + + /** Sets the fill style + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + fillStyle: function (attribute){ + var name = 'fillStyle'; + this.ctx[name] = attribute; + return this; + }, + /** description + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + createLinearGradient : function ( ){ + var name = 'createLinearGradient'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** description + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + createRadialGradient : function ( ){ + var name = 'createRadialGradient'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** description + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + createPattern : function ( ){ + var name = 'createPattern'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** description + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + shadowOffsetX: function (attribute){ + var name = 'shadowOffsetX'; + this.ctx[name] = attribute; + return this; + }, + /** description + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + shadowOffsetY: function (attribute){ + var name = 'shadowOffsetY'; + this.ctx[name] = attribute; + return this; + }, + /** description + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + shadowBlur: function (attribute){ + var name = 'shadowBlur'; + this.ctx[name] = attribute; + return this; + }, + /** description + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + shadowColor: function (attribute){ + var name = 'shadowColor'; + this.ctx[name] = attribute; + return this; + }, + /** description + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + drawImage : function ( ){ + var name = 'drawImage'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** description + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + getImageData : function ( ){ + var name = 'getImageData'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** description + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + putImageData : function ( ){ + var name = 'putImageData'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** description + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + createImageData : function ( ){ + var name = 'createImageData'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + /** description + * For full details see <a href="http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-globalcompositeoperation">W3C docs</a> + * @param + * @returns this + */ + drawWindow : function ( ){ + var name = 'drawWindow'; + this.ctx[name].apply(this.ctx, arguments); + return this; + }, + + + + +}; + + +/** Prototype object for each svg element submitted to Karma in the + * Karma() method + * @throws {Error} if the name and domId for the svg element are not specified + * @thows {Error} if the supplied domId does not match an element in the DOM + * @class This object is the prototype for each svg element submitted to Karma in the + * Karma() method + */ +Karma.kSvg = { + /** name of instance, used internally + * @typeof string + * @default "" + */ + name : "", + /** width of element + * @type number + * @default 0 + */ + width: 0, + /** height of element + * @type number + * @default 0 + */ + height: 0, + /** Status of element, either "loaded" or "error" + * @type string + * @default "" + */ + status: "", + /** Whether canvas is visible. This value is read-only + * @type boolean + * @default true + */ + visible: true, + /** Element ID for canvas element in html document. + * @type String + * @default undefined + */ + domId: undefined, + /** Reference to the DOM element. + * @type DOMElement + * @default undefined + * @example + * //You can access all properties and methods of the underlying DOM element + * //using the 'node' property + * Karma.svg.someSvg.node.dispatchEvent; + * Karma.svg.someSvg.node.addEvenListener(...); + */ + node: undefined, + /** Reference to the SVGDocument. You can use the this.doc to manipulate + * the SVG document + * @type SVGDocument + * @default undefined + * @example + * var myElem = Karma.svg.someSvg.doc.getElementById('foobar'); + * Karma.svg.someSvg.doc.createElement(...); + * Karma.svg.someSvg.doc.removeChild(someNode); + * + */ + doc: undefined, + /** Reference to the root element of the SVG Document + * @type DocumentElement + * @default undefined + * @example + * // The root element is equivalent to "document" in a regular html document + * // The root attribute is used frequently with the jQuery SVG plugin for CSS selectors + * $('#someId', Karma.svg.someSvg.root).css(.. manipulate css attributes ...); + */ + root: undefined, + _localized : undefined, + _init: function (config) { + Karma._counters.total++; + + for (var option in config){ + if (config.hasOwnProperty(option)){ + switch (option){ + case "name": + this.name = config[option]; + break; + case "domId": + this.domId = config[option]; + break; + case "width": + if(!this.height){ + throw new Error("If you specify a width you must also" + + "specify a height"); + } + this.width = parseInt(config[option], 10); + break; + case "height": + if(!this.width){ + throw new Error("If you specify a height you must also" + + "specify a width"); + } + this.height = config[option]; + break; + } + } + } + + if(this.domId && document.getElementById(this.domId)){ + this.node = document.getElementById(this.domId); + } else { + throw new Error('you must specify a valid domId that' + + 'is in your html page'); + } + + if(!config.height && !config.width){ + this.width = parseInt(this.node.getAttribute('width'), 10); + this.height = parseInt(this.node.getAttribute('height'), 10); + } + + var that = this; + that._addEventHandlers(); + + return this; + + + }, + _addEventHandlers : function () { + var that = this; + that.doc = that.node.getSVGDocument(); + that.node.addEventListener( + "load", + function (e) { + that.doc = that.node.getSVGDocument(); + that.root = that.doc.documentElement; + Karma._counters.loaded++; + Karma._updateStatus(); + that.status = "loaded"; + }, false); + + that.node.addEventListener( + "error", + function (e) { + Karma._counters.loaded--; + Karma._counters.errors++; + that.status = "error"; + var errorMsg = "Error: " + that._type.toUpperCase() + + " " + that.name + " cannot be loaded."; + Karma._updateStatus(errorMsg); + }, + false); + that.node.addEventListener( + "abort", + function (e) { + that.status = "aborted"; + var errorMsg = "ABORT: " + that._type.toUpperCase() + + " " + that.name + " loading was aborted."; + Karma._updateStatus(errorMsg); + + }, false); + + } +}; diff --git a/js/lesson.js b/js/lesson.js new file mode 100755 index 0000000..4d60c7d --- /dev/null +++ b/js/lesson.js @@ -0,0 +1,191 @@ +$(document).ready( + function(){ + + var k = Karma({ + audio: [{'name':'correct','file':'correct.ogg'}, + {'name':'incorrect','file':'incorrect.ogg'} + ]}); + + k.scaleWindow(); + $.i18n.setLocale('ne'); + + k.ready( + function(){ + + var flag, i ,j; + var object_counter = 1; + var imgNameRand = []; + var optPosition = []; + var optOtherPos = []; + var imageObject = []; + var imgNames = ["Bear", "Cow", "Elephant", "Horse", "Tiger", "Goat"]; + var correctPosition; + var selectedOption; + var score = 0; + var wrong_selected = 0; //wrong option selected so don't score up + var pos; + var t; + var current_image; + + var $help = $('#kHelpText').dialog({ + position:[ "right", "top"], modal:'true',autoOpen:false + }); + + var $feedback = $('#feedback').feedback(); + + $('#kHeaderHelpBtn').click(function(){ $help.dialog('open');}); + + + $('#kHeader').kHeader({'title': 'English Animal Identification', + lessonPlan: true, teachersNote: true}); + + var kFooter = $('#kFooter').kFooter({'winningScore': 6}); + kFooter.bind('kFooterWinGame', + function(){ + $('.optImg').hide(); + $('.imageBox').hide(); + $('#gameOver').show(); + }); + kFooter.bind('kFooterRestart', + function() { + object_counter = 1; + imgNameRand = []; + optPosition = []; + optOtherPos = []; + imageObject = []; + score = 0; + wrong_selected = 0; //wrong option selected so don't score up + + load_images(); + game(); + + } + ); + + load_images(); //load the image numbers for random display + game(); //let the game begin + + + function checkDisplay(){ //Displays the correct and incorrect info + if(wrong_selected == 1){ + $feedback.feedback('incorrect'); + } + else if (object_counter === 7 ){ + $feedback.feedback('win'); + } else{ + $feedback.feedback('correct'); + } + } + + $("#anchorPlayAgain").click(function(){ + $('#gameOver').hide(); + $('.optImg').show(); + $('.imageBox').show(); + load_images(); + score = 0; + object_counter = 1; + wrong_selected = 0; + //display_score(); + kFooter.kFooter('reset'); + game(); + + }); + $("#anchorOpt0").click(function(){ + selected_Option_Process('0'); + }); + $("#anchorOpt1").click(function(){ + selected_Option_Process('1'); + }); + $("#anchorOpt2").click(function(){ + selected_Option_Process('2'); + }); + $("#anchorOpt3").click(function(){ + selected_Option_Process('3'); + }); + + + function load_images(){ + imageObject = k.shuffle([1, 2, 3, 4, 5, 6]); + } + + function selected_Option_Process(selectedOption){ + + if(selectedOption == correctPosition){ + object_counter++; + wrong_selected = 0; + score++; + kFooter.kFooter('inc'); + kFooter.kFooter('incTotal'); + checkDisplay(); + game(); + } + else { + wrong_selected = 1; + kFooter.kFooter('incTotal'); + checkDisplay(); + } + + } + + function game(){ + + wrong_selected = 0; + current_image = object_counter%6; + document.getElementById("imgObject").src = "assets/image/" + + imageObject[current_image] + ".png"; + + //find correct answer and apply it to the position + var currentImage = imageObject[current_image]; + imgNameRand[0] = currentImage; + //generate choices + + for(i=1; i<4; i++){ + do{ + flag = 0; + imgNameRand[i] = k.rand(1, 6); + for(j=0; j<i; j++){ + if(imgNameRand[i]===imgNameRand[j]){ + flag++; + } + } + }while(flag != 0 ); //end of do while loop + } + + + correctPosition = k.rand(0, 3); + + optOtherPos[0] = correctPosition; + + for(i=1; i<4; i++){ + do{ + flag = 0; + optOtherPos[i] = k.rand(0, 3); + for(j=0; j<i; j++){ //chek repeat within optOtherPos array + if(optOtherPos[i] === optOtherPos[j]){ + flag++; + } + } + + }while(flag != 0); + + } + + for(i=0; i<4; i++){ + pos = optOtherPos[i]; + optPosition[pos] = imgNameRand[i]; + //optPosition[pos] = imgNames[i]; + } + + + + //random positions are stored in optOtherPos array. Great + + + for(i=0; i<4; i++){ + document.getElementById("option"+i+"").src = "assets/image/image_name/"+optPosition[i]+".png"; + } + + + } //no change + }); //end of games +}); //end of DOM
\ No newline at end of file diff --git a/js/ui.core-draggable-resizable-dialog.js b/js/ui.core-draggable-resizable-dialog.js new file mode 100755 index 0000000..af96b59 --- /dev/null +++ b/js/ui.core-draggable-resizable-dialog.js @@ -0,0 +1,2756 @@ +/* + * jQuery UI 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI + */ +;jQuery.ui || (function($) { + +var _remove = $.fn.remove, + isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9); + +//Helper functions and ui object +$.ui = { + version: "1.7.2", + + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function(module, option, set) { + var proto = $.ui[module].prototype; + for(var i in set) { + proto.plugins[i] = proto.plugins[i] || []; + proto.plugins[i].push([option, set[i]]); + } + }, + call: function(instance, name, args) { + var set = instance.plugins[name]; + if(!set || !instance.element[0].parentNode) { return; } + + for (var i = 0; i < set.length; i++) { + if (instance.options[set[i][0]]) { + set[i][1].apply(instance.element, args); + } + } + } + }, + + contains: function(a, b) { + return document.compareDocumentPosition + ? a.compareDocumentPosition(b) & 16 + : a !== b && a.contains(b); + }, + + hasScroll: function(el, a) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ($(el).css('overflow') == 'hidden') { return false; } + + var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop', + has = false; + + if (el[scroll] > 0) { return true; } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[scroll] = 1; + has = (el[scroll] > 0); + el[scroll] = 0; + return has; + }, + + isOverAxis: function(x, reference, size) { + //Determines when x coordinate is over "b" element axis + return (x > reference) && (x < (reference + size)); + }, + + isOver: function(y, x, top, left, height, width) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width); + }, + + keyCode: { + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38 + } +}; + +// WAI-ARIA normalization +if (isFF2) { + var attr = $.attr, + removeAttr = $.fn.removeAttr, + ariaNS = "http://www.w3.org/2005/07/aaa", + ariaState = /^aria-/, + ariaRole = /^wairole:/; + + $.attr = function(elem, name, value) { + var set = value !== undefined; + + return (name == 'role' + ? (set + ? attr.call(this, elem, name, "wairole:" + value) + : (attr.apply(this, arguments) || "").replace(ariaRole, "")) + : (ariaState.test(name) + ? (set + ? elem.setAttributeNS(ariaNS, + name.replace(ariaState, "aaa:"), value) + : attr.call(this, elem, name.replace(ariaState, "aaa:"))) + : attr.apply(this, arguments))); + }; + + $.fn.removeAttr = function(name) { + return (ariaState.test(name) + ? this.each(function() { + this.removeAttributeNS(ariaNS, name.replace(ariaState, "")); + }) : removeAttr.call(this, name)); + }; +} + +//jQuery plugins +$.fn.extend({ + remove: function() { + // Safari has a native remove event which actually removes DOM elements, + // so we have to use triggerHandler instead of trigger (#3037). + $("*", this).add(this).each(function() { + $(this).triggerHandler("remove"); + }); + return _remove.apply(this, arguments ); + }, + + enableSelection: function() { + return this + .attr('unselectable', 'off') + .css('MozUserSelect', '') + .unbind('selectstart.ui'); + }, + + disableSelection: function() { + return this + .attr('unselectable', 'on') + .css('MozUserSelect', 'none') + .bind('selectstart.ui', function() { return false; }); + }, + + scrollParent: function() { + var scrollParent; + if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + } +}); + + +//Additional selectors +$.extend($.expr[':'], { + data: function(elem, i, match) { + return !!$.data(elem, match[3]); + }, + + focusable: function(element) { + var nodeName = element.nodeName.toLowerCase(), + tabIndex = $.attr(element, 'tabindex'); + return (/input|select|textarea|button|object/.test(nodeName) + ? !element.disabled + : 'a' == nodeName || 'area' == nodeName + ? element.href || !isNaN(tabIndex) + : !isNaN(tabIndex)) + // the element and all of its ancestors must be visible + // the browser may report that the area is hidden + && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length; + }, + + tabbable: function(element) { + var tabIndex = $.attr(element, 'tabindex'); + return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable'); + } +}); + + +// $.widget is a factory to create jQuery plugins +// taking some boilerplate code out of the plugin code +function getter(namespace, plugin, method, args) { + function getMethods(type) { + var methods = $[namespace][plugin][type] || []; + return (typeof methods == 'string' ? methods.split(/,?\s+/) : methods); + } + + var methods = getMethods('getter'); + if (args.length == 1 && typeof args[0] == 'string') { + methods = methods.concat(getMethods('getterSetter')); + } + return ($.inArray(method, methods) != -1); +} + +$.widget = function(name, prototype) { + var namespace = name.split(".")[0]; + name = name.split(".")[1]; + + // create plugin method + $.fn[name] = function(options) { + var isMethodCall = (typeof options == 'string'), + args = Array.prototype.slice.call(arguments, 1); + + // prevent calls to internal methods + if (isMethodCall && options.substring(0, 1) == '_') { + return this; + } + + // handle getter methods + if (isMethodCall && getter(namespace, name, options, args)) { + var instance = $.data(this[0], name); + return (instance ? instance[options].apply(instance, args) + : undefined); + } + + // handle initialization and non-getter methods + return this.each(function() { + var instance = $.data(this, name); + + // constructor + (!instance && !isMethodCall && + $.data(this, name, new $[namespace][name](this, options))._init()); + + // method call + (instance && isMethodCall && $.isFunction(instance[options]) && + instance[options].apply(instance, args)); + }); + }; + + // create widget constructor + $[namespace] = $[namespace] || {}; + $[namespace][name] = function(element, options) { + var self = this; + + this.namespace = namespace; + this.widgetName = name; + this.widgetEventPrefix = $[namespace][name].eventPrefix || name; + this.widgetBaseClass = namespace + '-' + name; + + this.options = $.extend({}, + $.widget.defaults, + $[namespace][name].defaults, + $.metadata && $.metadata.get(element)[name], + options); + + this.element = $(element) + .bind('setData.' + name, function(event, key, value) { + if (event.target == element) { + return self._setData(key, value); + } + }) + .bind('getData.' + name, function(event, key) { + if (event.target == element) { + return self._getData(key); + } + }) + .bind('remove', function() { + return self.destroy(); + }); + }; + + // add widget prototype + $[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype); + + // TODO: merge getter and getterSetter properties from widget prototype + // and plugin prototype + $[namespace][name].getterSetter = 'option'; +}; + +$.widget.prototype = { + _init: function() {}, + destroy: function() { + this.element.removeData(this.widgetName) + .removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled') + .removeAttr('aria-disabled'); + }, + + option: function(key, value) { + var options = key, + self = this; + + if (typeof key == "string") { + if (value === undefined) { + return this._getData(key); + } + options = {}; + options[key] = value; + } + + $.each(options, function(key, value) { + self._setData(key, value); + }); + }, + _getData: function(key) { + return this.options[key]; + }, + _setData: function(key, value) { + this.options[key] = value; + + if (key == 'disabled') { + this.element + [value ? 'addClass' : 'removeClass']( + this.widgetBaseClass + '-disabled' + ' ' + + this.namespace + '-state-disabled') + .attr("aria-disabled", value); + } + }, + + enable: function() { + this._setData('disabled', false); + }, + disable: function() { + this._setData('disabled', true); + }, + + _trigger: function(type, event, data) { + var callback = this.options[type], + eventName = (type == this.widgetEventPrefix + ? type : this.widgetEventPrefix + type); + + event = $.Event(event); + event.type = eventName; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if (event.originalEvent) { + for (var i = $.event.props.length, prop; i;) { + prop = $.event.props[--i]; + event[prop] = event.originalEvent[prop]; + } + } + + this.element.trigger(event, data); + + return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false + || event.isDefaultPrevented()); + } +}; + +$.widget.defaults = { + disabled: false +}; + + +/** Mouse Interaction Plugin **/ + +$.ui.mouse = { + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if(self._preventClickEvent) { + self._preventClickEvent = false; + event.stopImmediatePropagation(); + return false; + } + }); + + // Prevent text selection in IE + if ($.browser.msie) { + this._mouseUnselectable = this.element.attr('unselectable'); + this.element.attr('unselectable', 'on'); + } + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + + // Restore text selection in IE + ($.browser.msie + && this.element.attr('unselectable', this._mouseUnselectable)); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + // TODO: figure out why we have to use originalEvent + event.originalEvent = event.originalEvent || {}; + if (event.originalEvent.mouseHandled) { return; } + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + // preventDefault() is used to prevent the selection of text here - + // however, in Safari, this causes select boxes not to be selectable + // anymore, so this fix is needed + ($.browser.safari || event.preventDefault()); + + event.originalEvent.mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + this._preventClickEvent = (event.target == this._mouseDownEvent.target); + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}; + +$.ui.mouse.defaults = { + cancel: null, + distance: 1, + delay: 0 +}; + +})(jQuery); +/* + * jQuery UI Draggable 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.draggable", $.extend({}, $.ui.mouse, { + + _init: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + }, + + _mouseCapture: function(event) { + + var o = this.options; + + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + if(o.cursorAt) + this._adjustOffsetFromHelper(o.cursorAt); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Call plugins and callbacks + this._trigger("start", event); + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + this._trigger('drag', event, ui); + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + self._trigger("stop", event); + self._clear(); + }); + } else { + this._trigger("stop", event); + this._clear(); + } + + return false; + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left; + if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top; + if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var ce = $(o.containment)[0]; if(!ce) return; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + absolutePosition: this.positionAbs, //deprecated + offset: this.positionAbs + }; + } + +})); + +$.extend($.ui.draggable, { + version: "1.7.2", + eventPrefix: "drag", + defaults: { + addClasses: true, + appendTo: "parent", + axis: false, + cancel: ":input,option", + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + delay: 0, + distance: 1, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + } +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "iframeFix", { + start: function(event, ui) { + var o = $(this).data('draggable').options; + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + }, + stop: function(event, ui) { + $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack.group)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min); + }); + + $(group).each(function(i) { + this.style.zIndex = o.stack.min + i; + }); + + this[0].style.zIndex = o.stack.min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); +/* + * jQuery UI Resizable 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.resizable", $.extend({}, $.ui.mouse, { + + _init: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Opera fix for relative positioning + if (/relative/.test(this.element.css('position')) && $.browser.opera) + this.element.css({ position: 'relative', top: 'auto', left: 'auto' }); + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>'); + + // increase zIndex of sw, se, ne, nw axis + //TODO : this modifies original option + if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.parent().append( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).end().remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + }, + + _mouseCapture: function(event) { + + var handle = false; + for(var i in this.handles) { + if($(this.handles[i])[0] == event.target) handle = true; + } + + return this.options.disabled || !!handle; + + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + //Opera fixing relative position + if ($.browser.opera && (/relative/).test(el.css('position'))) + el.css({ position: 'relative', top: 'auto', left: 'auto' }); + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (data.height) data.width = (csize.height * this.aspectRatio); + else if (data.width) data.height = (csize.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('<div style="overflow:hidden;"></div>'); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +})); + +$.extend($.ui.resizable, { + version: "1.7.2", + eventPrefix: "resize", + defaults: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + cancel: ":input,option", + containment: false, + delay: 0, + distance: 1, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + } +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options; + + _store = function(exp) { + $(exp).each(function() { + $(this).data("resizable-alsoresize", { + width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10), + left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10) + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function(exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left']; + + $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + //Opera fixing relative position + if (/relative/.test(el.css('position')) && $.browser.opera) { + self._revertToRelativePosition = true; + el.css({ position: 'absolute', top: 'auto', left: 'auto' }); + } + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"); + + //Opera fixing relative position + if (self._revertToRelativePosition && $.browser.opera) { + self._revertToRelativePosition = false; + el.css({ position: 'relative' }); + } + + $(this).removeData("resizable-alsoresize-start"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / o.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * o.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); +/* + * jQuery UI Dialog 1.7.2 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * ui.core.js + * ui.draggable.js + * ui.resizable.js + */ +(function($) { + +var setDataSwitch = { + dragStart: "start.draggable", + drag: "drag.draggable", + dragStop: "stop.draggable", + maxHeight: "maxHeight.resizable", + minHeight: "minHeight.resizable", + maxWidth: "maxWidth.resizable", + minWidth: "minWidth.resizable", + resizeStart: "start.resizable", + resize: "drag.resizable", + resizeStop: "stop.resizable" + }, + + uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all '; + +$.widget("ui.dialog", { + + _init: function() { + this.originalTitle = this.element.attr('title'); + + var self = this, + options = this.options, + + title = options.title || this.originalTitle || ' ', + titleId = $.ui.dialog.getTitleId(this.element), + + uiDialog = (this.uiDialog = $('<div/>')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + position: 'absolute', + overflow: 'hidden', + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + (options.closeOnEscape && event.keyCode + && event.keyCode == $.ui.keyCode.ESCAPE && self.close(event)); + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = this.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (this.uiDialogTitlebar = $('<div></div>')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('<a href="#"/>') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .mousedown(function(ev) { + ev.stopPropagation(); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('<span/>')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('<span/>') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + (options.draggable && $.fn.draggable && this._makeDraggable()); + (options.resizable && $.fn.resizable && this._makeResizable()); + + this._createButtons(options.buttons); + this._isOpen = false; + + (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe()); + (options.autoOpen && this.open()); + + }, + + destroy: function() { + (this.overlay && this.overlay.destroy()); + this.uiDialog.hide(); + this.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + this.uiDialog.remove(); + + (this.originalTitle && this.element.attr('title', this.originalTitle)); + }, + + close: function(event) { + var self = this; + + if (false === self._trigger('beforeclose', event)) { + return; + } + + (self.overlay && self.overlay.destroy()); + self.uiDialog.unbind('keypress.ui-dialog'); + + (self.options.hide + ? self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }) + : self.uiDialog.hide() && self._trigger('close', event)); + + $.ui.dialog.overlay.resize(); + + self._isOpen = false; + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + var maxZ = 0; + $('.ui-dialog').each(function() { + if (this != self.uiDialog[0]) { + maxZ = Math.max(maxZ, $(this).css('z-index')); + } + }); + $.ui.dialog.maxZ = maxZ; + } + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + + if ((this.options.modal && !force) + || (!this.options.stack && !this.options.modal)) { + return this._trigger('focus', event); + } + + if (this.options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = this.options.zIndex; + } + (this.overlay && this.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = ++$.ui.dialog.maxZ)); + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') }; + this.uiDialog.css('z-index', ++$.ui.dialog.maxZ); + this.element.attr(saveScroll); + this._trigger('focus', event); + }, + + open: function() { + if (this._isOpen) { return; } + + var options = this.options, + uiDialog = this.uiDialog; + + this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null; + (uiDialog.next().length && uiDialog.appendTo('body')); + this._size(); + this._position(options.position); + uiDialog.show(options.show); + this.moveToTop(true); + + // prevent tabbing out of modal dialogs + (options.modal && uiDialog.bind('keypress.ui-dialog', function(event) { + if (event.keyCode != $.ui.keyCode.TAB) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first')[0], + last = tabbables.filter(':last')[0]; + + if (event.target == last && !event.shiftKey) { + setTimeout(function() { + first.focus(); + }, 1); + } else if (event.target == first && event.shiftKey) { + setTimeout(function() { + last.focus(); + }, 1); + } + })); + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $([]) + .add(uiDialog.find('.ui-dialog-content :tabbable:first')) + .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first')) + .add(uiDialog) + .filter(':first') + .focus(); + + this._trigger('open'); + this._isOpen = true; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('<div></div>') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ); + + // if we already have a button pane, remove it + this.uiDialog.find('.ui-dialog-buttonpane').remove(); + + (typeof buttons == 'object' && buttons !== null && + $.each(buttons, function() { return !(hasButtons = true); })); + if (hasButtons) { + $.each(buttons, function(name, fn) { + $('<button type="button"></button>') + .addClass( + 'ui-state-default ' + + 'ui-corner-all' + ) + .text(name) + .click(function() { fn.apply(self.element[0], arguments); }) + .hover( + function() { + $(this).addClass('ui-state-hover'); + }, + function() { + $(this).removeClass('ui-state-hover'); + } + ) + .focus(function() { + $(this).addClass('ui-state-focus'); + }) + .blur(function() { + $(this).removeClass('ui-state-focus'); + }) + .appendTo(uiDialogButtonPane); + }); + uiDialogButtonPane.appendTo(this.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = this.options, + heightBeforeDrag; + + this.uiDialog.draggable({ + cancel: '.ui-dialog-content', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function() { + heightBeforeDrag = options.height; + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + (options.dragStart && options.dragStart.apply(self.element[0], arguments)); + }, + drag: function() { + (options.drag && options.drag.apply(self.element[0], arguments)); + }, + stop: function() { + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + (options.dragStop && options.dragStop.apply(self.element[0], arguments)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = this.options, + resizeHandles = typeof handles == 'string' + ? handles + : 'n,e,s,w,se,sw,ne,nw'; + + this.uiDialog.resizable({ + cancel: '.ui-dialog-content', + alsoResize: this.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: options.minHeight, + start: function() { + $(this).addClass("ui-dialog-resizing"); + (options.resizeStart && options.resizeStart.apply(self.element[0], arguments)); + }, + resize: function() { + (options.resize && options.resize.apply(self.element[0], arguments)); + }, + handles: resizeHandles, + stop: function() { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + (options.resizeStop && options.resizeStop.apply(self.element[0], arguments)); + $.ui.dialog.overlay.resize(); + } + }) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _position: function(pos) { + var wnd = $(window), doc = $(document), + pTop = doc.scrollTop(), pLeft = doc.scrollLeft(), + minTop = pTop; + + if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) { + pos = [ + pos == 'right' || pos == 'left' ? pos : 'center', + pos == 'top' || pos == 'bottom' ? pos : 'middle' + ]; + } + if (pos.constructor != Array) { + pos = ['center', 'middle']; + } + if (pos[0].constructor == Number) { + pLeft += pos[0]; + } else { + switch (pos[0]) { + case 'left': + pLeft += 0; + break; + case 'right': + pLeft += wnd.width() - this.uiDialog.outerWidth(); + break; + default: + case 'center': + pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2; + } + } + if (pos[1].constructor == Number) { + pTop += pos[1]; + } else { + switch (pos[1]) { + case 'top': + pTop += 0; + break; + case 'bottom': + pTop += wnd.height() - this.uiDialog.outerHeight(); + break; + default: + case 'middle': + pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2; + } + } + + // prevent the dialog from being too high (make sure the titlebar + // is accessible) + pTop = Math.max(pTop, minTop); + this.uiDialog.css({top: pTop, left: pLeft}); + }, + + _setData: function(key, value){ + (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value)); + switch (key) { + case "buttons": + this._createButtons(value); + break; + case "closeText": + this.uiDialogTitlebarCloseText.text(value); + break; + case "dialogClass": + this.uiDialog + .removeClass(this.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "draggable": + (value + ? this._makeDraggable() + : this.uiDialog.draggable('destroy')); + break; + case "height": + this.uiDialog.height(value); + break; + case "position": + this._position(value); + break; + case "resizable": + var uiDialog = this.uiDialog, + isResizable = this.uiDialog.is(':data(resizable)'); + + // currently resizable, becoming non-resizable + (isResizable && !value && uiDialog.resizable('destroy')); + + // currently resizable, changing handles + (isResizable && typeof value == 'string' && + uiDialog.resizable('option', 'handles', value)); + + // currently non-resizable, becoming resizable + (isResizable || this._makeResizable(value)); + break; + case "title": + $(".ui-dialog-title", this.uiDialogTitlebar).html(value || ' '); + break; + case "width": + this.uiDialog.width(value); + break; + } + + $.widget.prototype._setData.apply(this, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options; + + // reset content sizing + this.element.css({ + height: 0, + minHeight: 0, + width: 'auto' + }); + + // reset wrapper sizing + // determine the height of all the non-content elements + var nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + + this.element + .css({ + minHeight: Math.max(options.minHeight - nonContentHeight, 0), + height: options.height == 'auto' + ? 'auto' + : Math.max(options.height - nonContentHeight, 0) + }); + } +}); + +$.extend($.ui.dialog, { + version: "1.7.2", + defaults: { + autoOpen: true, + bgiframe: false, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: 'center', + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + getter: 'isOpen', + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid); + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + var dialogZ = $(event.target).parents('.ui-dialog').css('zIndex') || 0; + return (dialogZ > $.ui.dialog.overlay.maxZ); + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + (dialog.options.closeOnEscape && event.keyCode + && event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event)); + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = $('<div></div>').appendTo(document.body) + .addClass('ui-widget-overlay').css({ + width: this.width(), + height: this.height() + }); + + (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe()); + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + this.instances.splice($.inArray(this.instances, $el), 1); + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + var scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + var offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + var scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + var offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +})(jQuery); diff --git a/js/ui.feedback.js b/js/ui.feedback.js new file mode 100755 index 0000000..f9304c5 --- /dev/null +++ b/js/ui.feedback.js @@ -0,0 +1,131 @@ +/** +* @fileOverview a scoreboard widget +* @author Bryan Berry <bryan@olenepal.org> +* uses MIT License +*/ + + + +(function($){ + + // This is a dummy function, just here as placeholder to + // to make the jsdoc tool happy + /** @name $.ui.feedback + * @namespace Feedback widget + */ + $.ui.feedback = function(){}; + + $.widget('ui.feedback', + /** @lends $.ui.feedback.prototype */ + { + /** Displays the correct icon in the center of the screen + * and plays the sound "correct" if loaded + */ + correct: function(){ + var $correct = this.$correct.css('display','block'); + setTimeout ( function() { + $correct.fadeOut(500); + }, 500); + if (Karma && Karma.audio && Karma.audio.correct){ + Karma.audio.correct.play(); + } + + }, + /** Displays the incorrect icon in the center of the screen + * and plays the sound "incorrect" if loaded + */ + incorrect: function(){ + + var $incorrect = this.$incorrect.css('display','block'); + setTimeout ( function() { + $incorrect.fadeOut(500); + }, 500); + + //this.$incorrect.css('display','block').fadeOut(3000); + if (Karma && Karma.audio && Karma.audio.incorrect){ + Karma.audio.incorrect.play(); + } + + }, + win: function(){ + this.$win.show(); + this.$overlay.show(); + }, + lose: function(){ + this.$lose.show(); + this.$overlay.show(); + }, + _init : function(){ + var self = this; + + this.element + .addClass('ui-feedback') + .css({position:'absolute', + top: '40%', left: '40%'}); + + this.$correct = $('<div></div>') + .addClass('ui-feedback-correct') + .appendTo(this.element); + + this.$incorrect = $('<div></div>') + .addClass('ui-feedback-incorrect') + .appendTo(this.element); + + this.$win = $("<div class='ui-feedback-over'>" + + "<div class='ui-feedback-win'></div>" + + "<div class='ui-feedback-txt'>You win!" + + "</div></div>") + .click( + function(){ + self.$win.hide(); + self.$overlay.hide(); + } + ) + .appendTo(this.element); + + this.$lose = $("<div class='ui-feedback-over'>" + + "<div class='ui-feedback-lose'></div>" + + "<div class='ui-feedback-txt'>You lose!" + + "</div></div>") + .click( + function(){ + self.$lose.hide(); + self.$overlay.hide(); + } + ) + .appendTo(this.element); + + this.$overlay = $('<div></div>') + .addClass('ui-feedback-overlay') + .appendTo($('body')); + + + + $('body') + .bind('feedbackCorrect', function(){ + self.correct(); + }) + .bind('feedbackIncorrect', function(){ + self.incorrect(); + }); + + }, + /** Removes the feedback widget and all related data from the DOM */ + destroy : function(){ + this.element.remove(); + $.widget.prototype.destroy.apply(this, arguments); + } + + + }); + + $.ui.feedback.getter = []; + + /** Default settings for the feedback widget + * @namespace Default settings for the feedback widget + * @extends $.ui.feedback + */ + $.ui.feedback.defaults = { + }; + + })(jQuery);
\ No newline at end of file diff --git a/js/ui.kFooter.js b/js/ui.kFooter.js new file mode 100755 index 0000000..02d7937 --- /dev/null +++ b/js/ui.kFooter.js @@ -0,0 +1,362 @@ +/** +* @fileOverview a footer widget +* @author Bryan Berry <bryan@olenepal.org> +* uses MIT License +*/ + + + +(function($){ + + // This is a dummy function, just here as placeholder to + // to make the jsdoc tool happy + /** @name $.ui.kFooter + * @namespace kFooter widget + * @example Emits the event kFooterWinGame when the maxScore is reached <br /> + * Emits the event kFooterRestart when game restarted <br /> + * Start button emits kFooterStart event when clicked <br /> + * Restart button emits kFooterRestart event when clicked <br /> + * Pause button emits the kFooterPause event when clicked <br /> + */ + $.ui.kFooter = function(){}; + + $.widget('ui.kFooter', + /** @lends $.ui.kFooter.prototype */ + { + /** Gets the current score + * @returns {Number} current score + */ + getScore : function(){ + return this._getData('score'); + }, + /** Sets the current score + * @param {Number} newScore new score + */ + setScore : function(newScore){ + this._setData('score', parseInt(newScore)); + this._refresh(); + }, + /** Gets the current total + * @returns {Number} current total + */ + getTotal : function(){ + return this._getData('total'); + }, + /** Sets the current total + * @param {Number} newTotal new total + */ + setTotal : function(newTotal){ + this._setData('total', parseInt(newTotal)); + this._refresh(); + }, + /** + * Resets the score and total to initial values and triggers + * the "kFooterRestart" event + */ + restart : function(){ + this.element.trigger('kFooterRestart'); + this._setData('score', this._getData('initialScore')); + this._setData('total', this._getData('initialTotal')); + this._refresh(); + }, + /** Increments the score by 1 or by the supplied numeric argument + * @param {Number} [val] increment value + */ + inc : function(val){ + var incVal = parseInt(val) || 1; + this._setData('score', this._getData('score') + incVal); + this._refresh(); + if(this._getData('winScore') === this._getData('score')){ + this.element.trigger('kFooterWinGame'); + } + }, + /** Increments the total by 1 or by the supplied numeric argument + * @param {Number} [val] increment value + */ + incTotal : function(val){ + var incVal = parseInt(val) || 1; + this._setData('total', this._getData('total') + incVal); + this._refresh(); + }, + /** Decrements the score by 1 or by the supplied numeric argument + * @param {Number} [val] decrement value + */ + dec : function(val){ + var decVal = parseInt(val) || 1; + this._setData('score', this._getData('score') - decVal); + this._refresh(); + }, + /** Decrements the total by 1 or by the supplied numeric argument + * @param {Number} [val] decrement value + */ + decTotal : function(val){ + var decVal = parseInt(val) || 1; + this._setData('total', this._getData('total') - decVal); + this._refresh(); + }, + /** Start the timer, defaults to 0:00 if no arguments supplied + * @param {Number} [minutes] value for minutes, default to 0 + * @param {Number} [seconds] value for seconds, default to 0 + */ + startTimer : function(minutes, seconds){ + var timerRunning = this._getData('timerRunning')|| false; + + if (this._$timer && timerRunning === false){ + var mins = minutes || 0; + var secs = seconds || 0; + var timerId = null; + var self = this; + + + this._setData('mins', mins); + this._setData('secs', secs); + + var addLeadingZero = function(num){ + if(''.concat(num).length === 1){ + return "0".concat(num); + } else { + return num; + } + + }; + + var increaseTimer = function(){ + if (self._getData('timerRunning') === false){ + return; + } + + var s = self._getData('secs') + 1; + var m = null; + var timerId = null; + + if (s < 60) { + self._setData('secs', s); + self._$timerSecs.text(self._n(addLeadingZero(s))); + } else { + s = 0; + m = self._getData('mins') + 1; + self._$timerSecs.text(self._n(addLeadingZero(s))); + self._$timerMins.text(self._n(addLeadingZero(m))); + self._setData('secs', s); + self._setData('mins', m); + } + + timerId = setTimeout(increaseTimer, 1000); + self._setData('timerId', timerId); + + }; + + timerId = setTimeout(increaseTimer , 1000); + + this._setData('timerRunning', true); + this._setData('timerId', timerId); + } + }, + /** Stop the timer + */ + stopTimer : function(){ + this._setData('timerRunning', false); + }, + _ : function(val, loc){ + return $.i18n.call($.ui.kFooter, val, loc); + }, + _n : function(val, loc){ + return $._n(val, loc); + }, + _init : function(){ + + var divDisplay = "inline"; + var score = this.options.score; + var total = this.options.total; + var self = this; + + var options = $.extend({}, $.ui.kFooter.defaults, this.options); + + this._setData('initialScore', parseInt(options.score)); + this._setData('initialTotal', parseInt(options.total)); + this._setData('score', parseInt(options.score)); + this._setData('total', parseInt(options.total)); + this._setData('winScore', parseInt(options.winningScore)); + this._setData('locale', options.locale); + + + this.element.addClass('ui-widget ui-widget-content ' + + ' ui-kFooter'); + + + var $kFooter = $("<ul></ul>"); + + + if(options.scoreboard === true){ + + var $scoreboard = $("<li class='left'>" + this._("Score") + + "</li>" + "<li class='left'>" + + "<span id='kFooterScore' class='ui-corner-all number'>" + + this._n(score) + "</span></li>" + + "<li class='left'>" + this._("Total") + "</li>" + + "<li class='left'><span id='kFooterTotal' " + + "class='ui-corner-all number'>" + + this._n(total) + "</span></li>") + .appendTo($kFooter); + + this._score = $('#kFooterScore', $scoreboard); + this._total = $('#kFooterTotal', $scoreboard); + + } + + if(options.timer === true){ + this._$timer = $("<li class='left'>" + this._("Timer") + + "</li>" + + "<li class='left'><span id='kFooterMins'" + + "class='ui-corner-all" + + " number timer'>" + this._n("00") + + "</span></li>" + + "<li class='left'><span id='kFooterSecs'" + + "class='ui-corner-all " + + "number timer'>"+ this._n("00") + + "</span></li>") + .appendTo($kFooter); + + this._$timerMins = $('#kFooterMins', this._$timer); + this._$timerSecs = $('#kFooterSecs', this._$timer); + } + + //if options.checkAnswerBtn === true + + if (options.restartButton === true){ + var $restartButton = $("<li class='right'><button " + + "class='ui-corner-all ui-state-default'>" + + "<span class='ui-icon ui-icon-arrowrefresh-1-w'>" + + "</span>" + + "<span class='text left'>" + this._('Play Again') + + "</span></button></li>") + .click(function(){ + self.startTimer(); + self.restart(); + }) + .appendTo($kFooter); + } + + if (options.pauseButton === true){ + var $pauseButton = $("<li class='right'><button " + + "class='ui-corner-all ui-state-default'>" + + "<span class='ui-icon ui-icon-pause'>" + + "</span>" + + "<span class='text left'>" + this._('Pause') + + "</span></button></li>") + .click(function(){ + self.stopTimer(); + self.element.trigger('kFooterPause'); + }) + .appendTo($kFooter); + } + + if (options.startButton === true){ + var $startButton = $("<li class='right'><button " + + "class='ui-corner-all ui-state-default'>" + + "<span class='ui-icon ui-icon-play'>" + + "</span>" + + "<span class='text left'>" + this._('Start') + + "</span></button></li>") + .click(function(){ + self.startTimer(); + self.element.trigger('kFooterStart'); + }) + .appendTo($kFooter); + } + + $('button', $kFooter).hover( + function(){ + $(this).addClass("ui-state-hover"); + }, + function(){ + $(this).removeClass("ui-state-hover"); + }); + + + // Check if any html w/in this.element, if so wrap it in <li> </li> + // and add to $kFooter later + var $userHtml = this.element + .children() + .appendTo($kFooter); + + + $userHtml.wrap('<li class="left"></li>'); + + //get rid of userHtml + this.element.empty(); + + this.element.append($kFooter); + + }, + _refresh : function(){ + this._score.text(this._n(this._getData('score'))); + this._total.text(this._n(this._getData('total'))); + }, + /** Removes the kFooter widget and all related data from the DOM */ + destroy : function(){ + this.element.remove(); + $.widget.prototype.destroy.apply(this, arguments); + } + + + }); + + $.ui.kFooter.getter = ['getScore', 'getTotal', '_n', '_' ]; + + $.ui.kFooter.i18n = {}; + + + /** Default settings for the kFooter widget + * @namespace Default settings for the kFooter widget + * @extends $.ui.kFooter + */ + $.ui.kFooter.defaults = { + /** Initial score + * @type Number + * @default 0 + */ + score: 0, + /** Initial total + * @type Number + * @default 0 + */ + total: 0, + /** The score that will win the game + * @type Number + * @default 0 + */ + winningScore: 0, + /** Default locale, valid options are "en" and "ne" + * @type String + * @default "en" + */ + locale: "ne", + /** Display the scoreboard + * @type boolean + * @default true + */ + scoreboard: true, + /** Display the Start Button + * @type boolean + * @default false + */ + startButton: false, + /** Display the Retart Button + * @type boolean + * @default true + */ + restartButton: true, + /** Display the Pause Button + * @type boolean + * @default false + */ + pauseButton: false, + /** Display the timer + * @type boolean + * @default false + */ + timer: false + }; + + })(jQuery);
\ No newline at end of file diff --git a/js/ui.kFooter.ne.json b/js/ui.kFooter.ne.json new file mode 100644 index 0000000..6a5a437 --- /dev/null +++ b/js/ui.kFooter.ne.json @@ -0,0 +1,5 @@ +$.ui.kFooter.i18n.ne = { +strings : { +"Score":"अङ्क", "Total": "जम्मा", "Play Again": "फेरी खेलौ", "Pause": "खेल रोकौ", +"Start": "सुरु गरौ" } +};
\ No newline at end of file diff --git a/js/ui.kHeader.js b/js/ui.kHeader.js new file mode 100755 index 0000000..2efac0d --- /dev/null +++ b/js/ui.kHeader.js @@ -0,0 +1,235 @@ +/** +* @fileOverview a Header widget +* @author Bryan Berry <bryan@olenepal.org> +* uses MIT License +*/ + + + +(function($){ + + // This is a dummy function, just here as placeholder to + // to make the jsdoc tool happy + /** @name $.ui.kHeader + * @namespace kHeader widget + * @example + */ + $.ui.kHeader = function(){}; + + $.widget('ui.kHeader', + /** @lends $.ui.kHeader.prototype */ + { _ : function(val, loc){ + if($.i18n){ + return $.i18n.call($.ui.kHeader, val, loc); + } + return val; + }, + _n : function(val, loc){ + if ($.i18n){ + return $._n(val, loc); + } + return val; + }, + + _init : function(){ + var options = $.extend({}, $.ui.kHeader.defaults, this.options); + + this.element.addClass('ui-widget ui-widget-content'); + + var $kHeader = $("<ul></ul>"); + + var backLink = "#"; + var urlParams = window.location.search.slice(1).split('&'); + if (urlParams){ + backLink = urlParams[0].split('=')[1]; + } + + var $backBtn = $("<li class='left'> <a href='" + backLink + + "' class='kHeader-btn kHeader-back'></a></li>") + .appendTo($kHeader); + + var $lessonTitle = $("<li class='left kHeader-title'>" + + "<span>" + options.title + + "</span></li>") + .appendTo($kHeader); + + + + if (options.lessonPlan || options.teacherNote){ + + var $dropDownArrow = $("<span class='kHeader-kDoc right'>" + + "</span>") + .appendTo($lessonTitle); + + var $dropDownArea = $("<div class='drop-down'></div>"); + + if (options.lessonPlan){ + $("<div>" + + "<a href='./kDoc.html?back=index.html&doc=lessonPlan'>" + + this._("Lesson Plan") + "</a></div>") + .appendTo($dropDownArea); + } + + if (options.teachersNote){ + $("<div>" + + "<a href='./kDoc.html?back=index.html&doc=teachersNote'>" + + this._("Teacher's Note") + "</a></div>") + .appendTo($dropDownArea); + } + + $dropDownArea.appendTo($dropDownArrow); + + $dropDownArrow.hover( + function(){ + $dropDownArea.show(); + }, + function(){ + $dropDownArea.hide(); + } + ); + + } + + if(options.zoom === true){ + + var iframeScale = 1.0; + var translateY = 0; + var getIframeStyle = function(){ + return window.frames[0].document.body.style; + }; + + var zoomIn = function(){ + var iframeStyle = getIframeStyle(); + iframeScale = iframeScale + 0.1; + translateY = translateY + 50; + var scale = 'scale(' + iframeScale + ')'; + var translate = "translate(0px, " + translateY + "px)"; + + iframeStyle.MozTransform = scale + ' ' + translate; + iframeStyle.WebkitTransform = scale + ' ' + translate; + }; + + var zoomOut = function(){ + var iframeStyle = getIframeStyle(); + iframeScale = iframeScale - 0.1; + translateY = translateY - 50; + + var scale = 'scale(' + iframeScale + ')'; + var translate = "translate(0px, " + translateY + "px)"; + + + iframeStyle.MozTransform = scale + ' ' + translate; + iframeStyle.WebkitTransform = scale + ' ' + translate; + + }; + + $("<li class='left kHeader-zoomIn kHeader-btn'>" + + " </li>") + .click(zoomIn) + .appendTo($kHeader); + + $("<li class='left kHeader-zoomOut " + + "kHeader-btn'> </li>") + .click(zoomOut) + .appendTo($kHeader); + } + + + + if($('#' + options.help).length){ + if($.ui.dialog){ + var $help = $('#'+ options.help) + .dialog({ + position:[ "right", "top"], + modal:'true',autoOpen:false,width:500, + height: 400, + dialogClass: 'kHeader-help' + }); + } else { + + if(console){ + console.log("You need to add the jQuery UI dialog" + + " widget in order to use Help feature."); + } + } + + } + + $("<li class='right'> <a href='#'" + + "' class='kHeader-btn kHeader-help'></a></li>") + .click(function(){ + if($.ui.dialog && $help){ + $help.dialog('open'); + } + }) + .appendTo($kHeader); + + + $("<li class='right'> <a href='http://olenepal.org'" + + "' class='kHeader-btn kHeader-brand'" + + "title='साझा शिक्षा ई-पाटी'></a></li>") + .appendTo($kHeader); + + this.element.append($kHeader); + + //0-width divs that hold hover imgs for pre-loading + var $preloadImgDivs = $("<div class='kHeader-preload-img " + + "kHeader-preload-back'></div>" + + "<div class='kHeader-preload-img " + + "kHeader-preload-zoom-in'></div>" + + "<div class='kHeader-preload-img " + + "kHeader-preload-zoom-out'></div>" + + "<div class='kHeader-preload-img " + + "kHeader-preload-ole'></div>" + + "<div class='kHeader-preload-img " + + "kHeader-preload-help'></div>" + ) + .appendTo($kHeader); + + }, + /** Removes the kHeader widget and all related data from the DOM */ + destroy : function(){ + this.element.remove(); + $.widget.prototype.destroy.apply(this, arguments); + } + + + }); + + $.ui.kHeader.getter = []; + + $.ui.kHeader.i18n = {}; + + /** Default settings for the kHeader widget + * @namespace Default settings for the kHeader widget + * @extends $.ui.kHeader + */ + $.ui.kHeader.defaults = { + /** title + * @type String + * @default "" + */ + title: "", + /** Turns on zoom buttons + * @type boolean + * @default false + */ + zoom: false, + /** Creates drop-down with link to lesson plan + * @type boolean or string file path to lesson plan + * @default false + */ + lessonPlan: false, + /** Creates drop-down with link to teachersNote + * @type boolean or string file path to teachersNote + * @default false + */ + teachersNote: false, + /** Id of element containing help text + * @type String + * @default "kHelp" + */ + help: "kHelp" + }; + + })(jQuery);
\ No newline at end of file diff --git a/js/ui.kHeader.ne.json b/js/ui.kHeader.ne.json new file mode 100644 index 0000000..8f29423 --- /dev/null +++ b/js/ui.kHeader.ne.json @@ -0,0 +1,7 @@ + +$.ui.kHeader.i18n.ne = { + strings : { + "Teacher's Note": "पाठविवरण", +"Lesson Plan":"पाठयोजना" +} +}
\ No newline at end of file |